Day Events (1177 total) (
Reset to Default) | (
Clear All)
#1. (Player1) (goes/goes/goes/goes/go1) hunting.
Tributes: 1
Edit |
Remove#2. (Player1) (injures/injures/injures/injures/injure1) [typeD1].
Tributes: 1
Edit |
Remove#3. (Player1) (explores/explores/explores/explores/explore1) the arena.
Tributes: 1
Edit |
Remove#4. (Player1:1) (scares/scares/scares/scares/scare1) (Player2!1) off.
Tributes: 2
Edit |
Remove#5. (Player1:1) (diverts/diverts/diverts/diverts/divert1) (Player2!1)'s attention and (runs/runs/runs/runs/run1) away.
Tributes: 2
Edit |
Remove#6. (Player1:1) (stalks/stalks/stalks/stalks/stalk1) (Player2!1).
Tributes: 2
Edit |
Remove#7. (Player1) (fishes/fishes/fishes/fishes/fish1).
Tributes: 1
Edit |
Remove#8. (Player1) (camouflauges/camouflauges/camouflauges/camouflauges/camouflauge1) [typeD1] in the bushes.
Tributes: 1
Edit |
Remove#9. (Player1:1) (steals/steals/steals/steals/steal1) from (Player2!1) while [typeA2] (isn't/isn't/aren't/isn't/aren't2) looking.
Tributes: 2
Edit |
Remove#10. (Player1) (makes/makes/makes/makes/make1) a wooden spear.
Tributes: 1
Edit |
Remove#11. (Player1) (discovers/discovers/discovers/discovers/discover1) a cave.
Tributes: 1
Edit |
Remove#12. (Player1:1) (attacks/attacks/attacks/attacks/attack1) (Player2!1), but [typeA2] (manages/manages/manage/manages/manage2) to escape.
Tributes: 2
Edit |
Remove#13. (Player1:1) (chases/chases/chases/chases/chase1) (Player2!1).
Tributes: 2
Edit |
Remove#14. (Player1:1) (runs/runs/runs/runs/run1) away from (Player2!1).
Tributes: 2
Edit |
Remove#15. (Player1) (collects/collects/collects/collects/collect1) fruit from a tree.
Tributes: 1
Edit |
Remove#16. (Player1) (receives/receives/receives/receives/receive1) a hatchet from an unknown sponsor.
Tributes: 1
Edit |
Remove#17. (Player1) (receives/receives/receives/receives/receive1) clean water from an unknown sponsor.
Tributes: 1
Edit |
Remove#18. (Player1) (receives/receives/receives/receives/receive1) medical supplies from an unknown sponsor.
Tributes: 1
Edit |
Remove#19. (Player1) (receives/receives/receives/receives/receive1) fresh food from an unknown sponsor.
Tributes: 1
Edit |
Remove#20. (Player1) (searches/searches/searches/searches/search1) for a water source.
Tributes: 1
Edit |
Remove#21. (Player1:1) (defeats/defeats/defeats/defeats/defeat1) (Player2!1) in a fight, but (spares/spares/spares/spares/spare1) [typeC2] life.
Tributes: 2
Edit |
Remove#22. (Player1:1) and (Player2:1) work together for the day.
Tributes: 2
Edit |
Remove#23. (Player1:1) (begs/begs/begs/begs/beg1) for (Player2:1) to kill [typeB1]. [TypeA2] (refuses/refuses/refuse/refuses/refuse2), keeping (Player1) alive.
Tributes: 2
Edit |
Remove#24. (Player1) (tries/tries/tries/tries/try1) to sleep through the entire day.
Tributes: 1
Edit |
Remove#25. (Player1:1), (Player2:1), (Player3:1), and (Player4:1) raid (Player5!1)'s camp while [typeA5] (is/is/are/is/are5) hunting.
Tributes: 5
Edit |
Remove#26. (Player1) (constructs/constructs/constructs/constructs/construct1) a shack.
Tributes: 1
Edit |
Remove#27. (Player1:1) (overhears/overhears/overhears/overhears/overhear1) (Player2!1) and (Player3!1) talking in the distance.
Tributes: 3
Edit |
Remove#28. (Player1) (practices/practices/practices/practices/practice1) [typeC1] archery.
Tributes: 1
Edit |
Remove#29. (Player1) (thinks/thinks/thinks/thinks/think1) about home.
Tributes: 1
Edit |
Remove#30. (Player1) (is/is/is/is/are1) pricked by thorns while picking berries.
Tributes: 1
Edit |
Remove#31. (Player1) (tries/tries/tries/tries/try1) to spear fish with a trident.
Tributes: 1
Edit |
Remove#32. (Player1) (searches/searches/searches/searches/search1) for firewood.
Tributes: 1
Edit |
Remove#33. (Player1:1) and (Player2:1) split up to search for resources.
Tributes: 2
Edit |
Remove#34. (Player1) (picks/picks/picks/picks/pick1) flowers.
Tributes: 1
Edit |
Remove#35. (Player1:1) (tends/tends/tends/tends/tend1) to (Player2:1)'s wounds.
Tributes: 2
Edit |
Remove#36. (Player1) (sees/sees/sees/sees/see1) smoke rising in the distance, but (decides/decides/decides/decides/decide1) not to investigate.
Tributes: 1
Edit |
Remove#37. (Player1:1) (sprains/sprains/sprains/sprains/sprain1) [typeC1] ankle while running away from (Player2!1).
Tributes: 2
Edit |
Remove#38. (Player1) (makes/makes/makes/makes/make1) a slingshot.
Tributes: 1
Edit |
Remove#39. (Player1) (travels/travels/travels/travels/travel1) to higher ground.
Tributes: 1
Edit |
Remove#40. (Player1) (discovers/discovers/discovers/discovers/discover1) a river.
Tributes: 1
Edit |
Remove#41. (Player1) (hunts/hunts/hunts/hunts/hunt1) for other tributes.
Tributes: 1
Edit |
Remove#42. (Player1:1) and (Player2:1) hunt for other tributes.
Tributes: 2
Edit |
Remove#43. (Player1:1), (Player2:1), and (Player3:1) hunt for other tributes.
Tributes: 3
Edit |
Remove#44. (Player1:1), (Player2:1), (Player3:1), and (Player4:1) hunt for other tributes.
Tributes: 4
Edit |
Remove#45. (Player1:1), (Player2:1), (Player3:1), (Player4:1), and (Player5:1) hunt for other tributes.
Tributes: 5
Edit |
Remove#46. (Player1) (receives/receives/receives/receives/receive1) an explosive from an unknown sponsor.
Tributes: 1
Edit |
Remove#47. (Player1) (questions/questions/questions/questions/question1) [typeC1] sanity.
Tributes: 1
Edit |
Remove#48. (Player1) (casts/casts/casts/casts/cast1) Lost Death. It has no effect on (Player2).
Tributes: 2
Edit |
Remove#49. (Player1) (casts/casts/casts/casts/cast1) Lost Protect on [typeD1] and (Player2). (Player2) (casts/casts/casts/casts/cast2) Lost Shell on [typeD2] and (Player1).
Tributes: 2
Edit |
Remove#50. (Player1) and (Player2) argue over whether Android or Apple is better.
Tributes: 2
Edit |
Remove#51. (Player1) and (Player2) suddenly gain the ability to hear each other's thoughts.
Tributes: 2
Edit |
Remove#52. (Player1) (attempts/attempts/attempts/attempts/attempt1) to talk to (Player2) without using the letter E. [TypeA1] (succeeds/succeeds/succeed/succeeds/succeed1).
Tributes: 2
Edit |
Remove#53. (Player1) (attempts/attempts/attempts/attempts/attempt1) to talk to (Player2) without using the letter E. [TypeA1] (fails/fails/fail/fails/fail1).
Tributes: 2
Edit |
Remove#54. (Player1) (is/is/is/is/are1) about to kill (Player2), but [typeA1] (comes/comes/come/comes/come1) to [typeC1] senses at the last minute and (breaks/breaks/break/breaks/break1) down, begging (Player2) not to tell anyone.
Tributes: 2
Edit |
Remove#55. (Player1) (confesses/confesses/confesses/confesses/confess1) to (Player2) that [typeA1] (has/has/have/has/have1) a crush on (Player3). (Player2) (agrees/agrees/agrees/agrees/agree2) to help them get together.
Tributes: 3
Edit |
Remove#56. (Player1) (confesses/confesses/confesses/confesses/confess1) to (Player2) that [typeA1] (has/has/have/has/have1) a crush on (Player3). (Player2) (tells/tells/tells/tells/tell2) [typeB1] that (Player3) (is/is/is/is/are3) not the right (person/person/person/person/people3) for [typeB1] and that [typeA1] should move on.
Tributes: 3
Edit |
Remove#57. Upon observing the latest fatal event, (Player1) (thinks/thinks/thinks/thinks/think1) to [typeD1] 'wow, that was a dumb way to die.'
Tributes: 1
Edit |
Remove#58. (Player1) desperately (tries/tries/tries/tries/try1) to hide [typeC1] crush on (Player2).
Tributes: 2
Edit |
Remove#59. Upon seeing a floating apple being eaten, (Player1) (throws/throws/throws/throws/throw1) a knife in its direction. It hits the invisible (Player2), making [typeB2] bleed, and [typeA2] (throws/throws/throw/throws/throw2) the knife back in (Player1)'s direction, hitting the wall behind [typeB1], before running away.
Tributes: 2
Edit |
Remove#60. (Player1) (throws/throws/throws/throws/throw1) (Player2) in the trash where [typeA2] belong(s/s//s/2).
Tributes: 2
Edit |
Remove#61. (Player1) (makes/makes/makes/makes/make1) a crossover of (Player2) and (Player3)'s source materials.
Tributes: 3
Edit |
Remove#62. (Player1) and (Player2) get into a ship war regarding whether (Player3) would be a better match with (Player4) or (Player5).
Tributes: 5
Edit |
Remove#63. (Player1) (grabs/grabs/grabs/grabs/grab1) (Player2) by the legs and (swings/swings/swings/swings/swing1) [typeB2] to hit (Player3).
Tributes: 3
Edit |
Remove#64. (Player1) (gets/gets/gets/gets/get1) nerfed for being too OP.
Tributes: 1
Edit |
Remove#65. (Player1) (gets/gets/gets/gets/get1) buffed for being too weak.
Tributes: 1
Edit |
Remove#66. (Player1) (opens/opens/opens/opens/open1) a link from (Player2), only to be rickrolled.
Tributes: 2
Edit |
Remove#67. (Player1) (cosplays/cosplays/cosplays/cosplays/cosplay1) as (Player2).
Tributes: 2
Edit |
Remove#68. (Player1) (catches/catches/catches/catches/catch1) (Player2) swearing and tell(s/s/s/s/1) [typeB2] to watch [typeC2] fucking language.
Tributes: 2
Edit |
Remove#69. (Player1) (buys/buys/buys/buys/buy1) snacks from a vending machine and the bag gets stuck. [TypeA1] (tries/tries/tries/tries/try1) sticking [typeC1] (arm/arm/arm/arms1) into the slot to get the snack.
Tributes: 1
Edit |
Remove#70. (Player1) (buys/buys/buys/buys/buy1) snacks from a vending machine and the bag gets stuck. [TypeA1] kick(s/s//s/1) and punch(es/es//es/1) the glass.
Tributes: 1
Edit |
Remove#71. (Player1) (buys/buys/buys/buys/buy1) snacks from a vending machine and the bag gets stuck. [TypeA1] (asks/asks/asks/ask/ask1) (Player2) for help.
Tributes: 2
Edit |
Remove#72. (Player1) (buys/buys/buys/buys/buy1) snacks from a vending machine and the bag gets stuck. [TypeA1] (sticks/sticks/stick/sticks/stick1) [typeC1] arm into the slot, (shakes/shakes/shake/shakes/shake1) the machine, (punches/punches/punch/punches/punch1) and (kicks/kicks/kick/kicks/kick1) it, and then (asks/asks/ask/asks/ask1) (Player2) for help.
Tributes: 2
Edit |
Remove#73. (Player1) (pops/pops/pops/pops/pop1) out of the trash can [typeA1] (was/was/were/was/were1) hiding in to challenge (Player2) to a fight.
Tributes: 2
Edit |
Remove#74. (Player1) (sneaks/sneaks/sneaks/sneaks/sneak1) up behind (Player2) to challenge [typeB2] to a fight.
Tributes: 2
Edit |
Remove#75. (Player1) (shoves/shoves/shoves/shoves/shove1) (a stop sign/a stop sign/a stop sign/a stop sign/stop signs1) in (Player2)'s fac(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#76. (Player1) is worried (Player2) is a bad influence on (Player3).
Tributes: 3
Edit |
Remove#77. (Player1) and (Player2) make a bet regarding who can get the most kills.
Tributes: 2
Edit |
Remove#78. (Player1) (regrets/regrets/regrets/regrets/regret1) nothing.
Tributes: 1
Edit |
Remove#79. (Player1) (breaks/breaks/breaks/breaks/break1) down crying at the grave of the latest tribute to die.
Tributes: 1
Edit |
Remove#80. (Player1) (eats/eats/eats/eats/eat1) an entire tree out of desperate hunger.
Tributes: 1
Edit |
Remove#81. (Player1) (warns/warns/warns/warns/warn1) (Player2) that (Player3) (is/is/is/is/are3) plotting to kill [typeB2].
Tributes: 3
Edit |
Remove#82. After beating (Player1) in a fight, (Player2) (says/says/says/says/say2) "your attacks are very commendable... for a kid. Hahaha now you have been burned!"
Tributes: 2
Edit |
Remove#83. After beating (Player1) in a fight, (Player2) (tells/tells/tells/tells/tell1) (Player1) [typeC1] fighting was so weak [typeA2] had time to vacuum.
Tributes: 2
Edit |
Remove#84. After beating (Player1) in a fight, (Player2) (tells/tells/tells/tells/tell1) [typeB1] that [typeC1] moves are just (Player2)'s moves done by (a revolting amateur/a revolting amateur/a revolting amateur/a revolting amateur/revolting amateurs1).
Tributes: 2
Edit |
Remove#85. (Player1) (takes/takes/takes/takes/take1) pictures of the above event and (gets/gets/gets/gets/get1) inspiration for a new attack.
Tributes: 1
Edit |
Remove#86. (Player1) (takes/takes/takes/takes/take1) pictures of the below event and (gets/gets/gets/gets/get1) inspiration for a new attack.
Tributes: 1
Edit |
Remove#87. (Player1) (checks/checks/checks/checks/check1) out the enclosed instruction book.
Tributes: 1
Edit |
Remove#88. (Player1) (leaps/leaps/leaps/leaps/leap1) at (Player2) to hug [typeB2], knocking [typeB2] over.
Tributes: 2
Edit |
Remove#89. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) to swear in [typeC1] native language.
Tributes: 2
Edit |
Remove#90. (Player1) (eats/eats/eats/eats/eat1) a cake that's been in the oven for 4.5 years.
Tributes: 1
Edit |
Remove#91. (Player1) (hits/hits/hits/hits/hit1) (Player2) with [typeC1] health (bar/bar/bar/bar/bars1).
Tributes: 2
Edit |
Remove#92. (Player1), (Player2), (Player3), (Player4), (Player5) and (Player6) have a water fight.
Tributes: 6
Edit |
Remove#93. (Player1), (Player2), (Player3), (Player4), (Player5) and (Player6) ride bumper cars.
Tributes: 6
Edit |
Remove#94. (Player1) (does/does/does/does/do1) an impression of (Player2). (Player2) (finds/finds/finds/finds/find2) it hilarious.
Tributes: 2
Edit |
Remove#95. (Player1) (decorates/decorates/decorates/decorates/decorate1) [typeC1] (camp/camp/camp/camp/camps1) with (Player2) merchandise.
Tributes: 2
Edit |
Remove#96. (Player1) (finds/finds/finds/finds/find1) a magic stopwatch capable of stopping time.
Tributes: 1
Edit |
Remove#97. (Player1) (discovers/discovers/discovers/discovers/discover1) a staff that fires a beam that hits (Player2), (Player3) and (Player4), turning them into (Player1)'s servants.
Tributes: 4
Edit |
Remove#98. (Player1) (finds/finds/finds/finds/find1) a strange tree that causes those who eat it to grow or shrink.
Tributes: 1
Edit |
Remove#99. (Player1) and (Player2) use a slot machine that gives out eggs as prizes to obtain what they want.
Tributes: 2
Edit |
Remove#100. (Player1), (Player2), (Player3), and (Player4) attempt to steal (Player5)'s chocolate spread using a drone.
Tributes: 5
Edit |
Remove#101. (Player1) (finds/finds/finds/finds/find1) a jar with a genie that resembles [typeB1], which can grant [typeC1] wishes.
Tributes: 1
Edit |
Remove#102. (Player1), (Player2), and (Player3) zap (Player4) with a device that prevents [typeB4] from attacking.
Tributes: 4
Edit |
Remove#103. (Player1), (Player2), (Player3), and (Player4) play with camera filters on a mobile app.
Tributes: 4
Edit |
Remove#104. (Player1), (Player2), (Player3), (Player4), and (Player5) have their faces changed into moose faces by a device.
Tributes: 5
Edit |
Remove#105. (Player1) (finds/finds/finds/finds/find1) a ring that allows [typeB1] to transform into various things. [TypeA1] (uses/uses/uses/uses/use1) it to transform into (a partridge/a partridge/a partridge/a partridge/partridges1) and spy on other tributes.
Tributes: 1
Edit |
Remove#106. (Player1), (Player2), (Player3), and (Player4) get small devices from a passing vehicle that allow any objects attached to it to float.
Tributes: 4
Edit |
Remove#107. (Player1) (finds/finds/finds/finds/find1) a moose-unicorn hybrid that can walk on rainbows. [TypeA1] (tries/tries/tries/tries/try1) to attract it using sweets.
Tributes: 1
Edit |
Remove#108. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) & (Player3) how to say swear words.
Tributes: 3
Edit |
Remove#109. (Player1), (Player2), and (Player3) petition for the baby spinoff of HGS.
Tributes: 3
Edit |
Remove#110. (Player1), (Player2), (Player3), and (Player4) join the Gucci Gang.
Tributes: 4
Edit |
Remove#111. (Player1) (gets/gets/gets/gets/get1) dancing lessons from (Player2).
Tributes: 2
Edit |
Remove#112. (Player1) and (Player2) have an epic rap battle.
Tributes: 2
Edit |
Remove#113. While sitting under a large tree, (Player1) (reads/reads/reads/reads/read1) (a book/a book/a book/a book/books1).
Tributes: 1
Edit |
Remove#114. (Player1), (Player2), and (Player3) play a boring game of I Spy.
Tributes: 3
Edit |
Remove#115. (Player1) (watches/watches/watches/watches/watch1) the clouds roll by.
Tributes: 1
Edit |
Remove#116. (Player1) (glomps/glomps/glomps/glomps/glomp1) (Player2) from behind.
Tributes: 2
Edit |
Remove#117. (Player1), (Player2), (Player3), and (Player4) have a tea party.
Tributes: 4
Edit |
Remove#118. (Player1), (Player2), (Player3), and (Player4) start a new dance craze.
Tributes: 4
Edit |
Remove#119. (Player1) (listens/listens/listens/listens/listen1) to [typeC1] (playlist/playlist/playlist/playlist/playlists1).
Tributes: 1
Edit |
Remove#120. (Player1), (Player2), (Player3), (Player4), and (Player5) form a rock band.
Tributes: 5
Edit |
Remove#121. (Player1) (insults/insults/insults/insults/insult1) (Player2) to tears.
Tributes: 2
Edit |
Remove#122. (Player1) (trips/trips/trips/trips/trips/trip1) (Player2).
Tributes: 2
Edit |
Remove#123. (Player1), (Player2), (Player3), (Player4), and (Player5) give (Player6) a group hug.
Tributes: 6
Edit |
Remove#124. (Player1) (pulls/pulls/pulls/pulls/pull1) a prank on (Player2).
Tributes: 2
Edit |
Remove#125. (Player1), (Player2), and (Player3) play Exploding Kittens. (Player1) (wins/wins/wins/wins/win1).
Tributes: 3
Edit |
Remove#126. (Player1) (tells/tells/tells/tells/tell1) a lie, causing [typeC1] (nose/nose/nose/nose/noses1) to grow.
Tributes: 1
Edit |
Remove#127. (Player1) (catches/catches/catches/catches/catch1) (Player2) eating sugar.
Tributes: 2
Edit |
Remove#128. (Player1) (catches/catches/catches/catches/catch1) (Player2) eating sugar. (Player2) (lies/lies/lies/lies/lie2) and (gets/gets/gets/gets/get2) away with it.
Tributes: 2
Edit |
Remove#129. (Player1) (catches/catches/catches/catches/catch1) (Player2) eating sugar. (Player2) (lies/lies/lies/lies/lie2) but (is/is/is/is/are2) found guilty.
Tributes: 2
Edit |
Remove#130. (Player1) (goes/goes/goes/goes/go1) on the Internet and (discovers/discovers/discovers/discovers/discover1) that the fanbase named a dance move after [typeB1].
Tributes: 1
Edit |
Remove#131. (Player1) (stacks/stacks/stacks/stacks/stack1) hotdogs on (Player2)'s (head/head/head/head/heads2). [TypeA1] only (manages/manages/manage/manages/manage1) to stack (thirty/thirty/thirty/thirty/thirty each1).
Tributes: 2
Edit |
Remove#132. (Player1) and (Player2) perform their friendship chant in front of (Player3).
Tributes: 3
Edit |
Remove#133. (Player1) and (Player2) perform their friendship chant in front of (Player3), but fail hilariously.
Tributes: 3
Edit |
Remove#134. (Player1) (steals/steals/steals/steals/steal1) (a cookie/a cookie/a cookie/a cookie/cookies1) from the cookie jar.
Tributes: 1
Edit |
Remove#135. (Player1) (was/was/was/was/were1) about to slice (Player2) with (a sword/a sword/a sword/a sword/swords1) when (Player3) (jumps/jumps/jumps/jumps/jump3) in front of [typeB2]. (Player3) (freezes/freezes/freezes/freezes/freeze1) just before (Player1) (strikes/strikes/strikes/strikes/strike1), but (Player2) (hugs/hugs/hugs/hugs/hug2) [typeB3] to thaw [typeC3] frozen (heart/heart/heart/heart/hearts3).
Tributes: 3
Edit |
Remove#136. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) and (Player3) how to paint self-portraits. (Player2) (makes/makes/makes/makes/make2) (an anime version/an anime version/an anime version/an anime version/anime versions2) of [typeD2], to (Player1)'s shock and (Player3)'s disappointment.
Tributes: 3
Edit |
Remove#137. (Player1) and (Player2) reach their lab before (Player3) and (Player4) do. When asked about it, (Player1) (pulls/pulls/pulls/pulls/pull1) down a map showing their routes, saying, "You got (me/me/me/me/us1). By all accounts, it doesn't make sense."
Tributes: 4
Edit |
Remove#138. (Player1) (transforms/transforms/transforms/transforms/transform1) (Player2) into (a ferret/a ferret/a ferret/a ferret/ferrets2) and (bounces/bounces/bounces/bounces/bounce1) [typeB2] up and down several times before transforming [typeB2] back. (Player2) then (says/says/says/says/say2), "(My father/My father/My father/My father/Our fathers2) will hear about this!"
Tributes: 2
Edit |
Remove#139. (Player1) (worries/worries/worries/worries/worry1) where (Player2) (is/is/is/is/are2). (Player3) (thinks/thinks/thinks/thinks/think3) [typeA2] (is/is/are/is/are2) stuck in the linen closet while (Player4) and (Player5) think [typeA2] went to the gym, but it turns out [typeA2] (is/is/are/is/are2) stuck in the 3rd dimension. After a while, (Player2) (gets/gets/gets/gets/get2) out.
Tributes: 5
Edit |
Remove#140. (Player1) (hopes/hopes/hopes/hopes/hope1) that no one (looks/looks/looks/looks/look1) at [typeC1] plans while [typeA1] (is/is/are/is/are1) sleeping. A clone of [typeB1] then (pops/pops/pops/pops/pop1) out of the folder and (taunts/taunts/taunts/taunts/taunt1) (Player2) that [typeA2]'ll never get [typeC1] plans because [typeA1] never (sleeps/sleeps/sleep/sleeps/sleep1).
Tributes: 2
Edit |
Remove#141. (Player1) (tells/tells/tells/tells/tell1) (Player2), (Player3), and (Player4) to be prepared for (Player5)'s death. (Player3) (asks/asks/asks/asks/ask3) if [typeA5] (is/is/are/is/are5) sick, but (Player1) (says/says/says/says/say1), "No, (fool/fool/fool/fool/fools3), we're gonna kill [typeB5], and (Player6) too."
Tributes: 6
Edit |
Remove#142. (Player1) (knocks/knocks/knocks/knocks/knock1) on (Player2)'s door, saying, "(I'm/I'm/I'm/I'm/We're1) trying to be the right (one/one/one/one/ones1) for you." (Player2) (gets/gets/gets/gets/get2) it and (says/says/says/says/say2), "the right (one/one/one/one/ones3) (is/is/is/is/are3) already here," while (Player3) (is/is/is/is/are3) standing behind [typeB2].
Tributes: 3
Edit |
Remove#143. If (Player1) had (a nickel/a nickel/a nickel/a nickel/a nickel each1) for every time (Player2) did something oddly specific, [typeA1]'d have (two nickels/two nickels/two nickels/two nickels/two nickels each1). Which isn't much but it's weird that it happened twice.
Tributes: 2
Edit |
Remove#144. (Player1) (pounds/pounds/pounds/pounds/pound1) on the vending machine until a snack comes out. (Player2) (gives/gives/gives/gives/give2) it to [typeB1], but [typeA1] (declines/declines/decline/declines/decline1) because [typeA1] just wanted something to pound on.
Tributes: 2
Edit |
Remove#145. (Player1) (sings/sings/sings/sings/sing1) “My Sharona” acapella.
Tributes: 1
Edit |
Remove#146. (Player1) (drinks/drinks/drinks/drinks/drink1) beer with gummy bears.
Tributes: 1
Edit |
Remove#147. (Player1) (does/does/does/does/do1) not understand.
Tributes: 1
Edit |
Remove#148. (Player1) (makes/makes/makes/makes/make1) a shitpost. (Player2) (says/says/says/says/say2), "Not funny, (Player1)."
Tributes: 2
Edit |
Remove#149. (Player1) (goes/goes/goes/goes/go1) into a tirade of swearing, only for (Player2) to censor it with the phrase "[ROOT FOR (Player2)]".
Tributes: 2
Edit |
Remove#150. (Player1) (says/says/says/says/say1) "Bloody Mary" 4 times in a mirror, and (Player2) (comes/comes/comes/comes/come2) out of the mirror.
Tributes: 2
Edit |
Remove#151. (Player1) and (Player2) become BFFs!
Tributes: 2
Edit |
Remove#152. (Player1) (sits/sits/sits/sits/sit1) on a lawn chair melting [typeC1] brai(n/n/n/n/ns1) out while listening to "Kids" by MGMT.
Tributes: 1
Edit |
Remove#153. (Player1), (Player2), (Player3), and (Player4) hear a mysterious ticking noise.
Tributes: 4
Edit |
Remove#154. (Player1) (decides/decides/decides/decides/decide1) to put [typeC1] source material through Google Translate.
Tributes: 1
Edit |
Remove#155. (Player1), (Player2), and (Player3) torture (Player4) while dancing in front of [typeB4].
Tributes: 4
Edit |
Remove#156. (Player1) (serves/serves/serves/serves/serve1) a cup of "tea" to (Player2), but (Player2) (realizes/realizes/realizes/realizes/realize2) that it is actually pee, so [typeA2] (transforms/transforms/transform/transforms/transform2) [typeC2] teeth into jellyfish.
Tributes: 2
Edit |
Remove#157. (Player1) (tries/tries/tries/tries/try1) to teach (Player2) math, but [typeA1] (stabs/stabs/stab/stabs/stab1) (Player2)'s (hand/hand/hand/hand/hands2) after [typeA2] (writes/writes/write/writes/write2) the wrong answer.
Tributes: 2
Edit |
Remove#158. (Player1) (tells/tells/tells/tells/tell1) (Player2) a driving instruction, then (asks/asks/asks/asks/ask1) [typeB2] to repeat it. However, (Player2) incorrectly (recites/recites/recites/recites/recite2) it, leading to (Player1) stabbing [typeB2] nonfatally with a car key.
Tributes: 2
Edit |
Remove#159.
(Player1) (triggers/triggers/triggers/triggers/trigger1) a particle accelerator explosion that spreads dark matter across the Arena, granting [typeD1], (Player2), (Player3), (Player4), (Player5), and (Player6) superpowers.
Tributes: 6
Edit |
Remove#160. (Player1) (paints/paints/paints/paints/paint1) a hole on the ground using black paint, causing (Player2) to nonfatally fall in and be trapped.
Tributes: 2
Edit |
Remove#161. (Player1) "(fixes/fixes/fixes/fixes/fix1)" a plate of spaghetti by reducing the dish to each of its original ingredients.
Tributes: 1
Edit |
Remove#162. (Player1) (defeats/defeats/defeats/defeats/defeat1) a monster with the help of (Player2), (Player3), (Player4), and (Player5) by playing trashcans and junk as musical instruments.
Tributes: 5
Edit |
Remove#163. (Player1) (sabotages/sabotages/sabotages/sabotages/sabotage1) the Arena elevators by making them play thrash metal at maximum volume.
Tributes: 1
Edit |
Remove#164. (Player1) (defends/defends/defends/defends/defend1) (Player2) in an online game by going on VC to threaten (Player3) with harm after [typeA3] (insults/insults/insult/insults/insult3) (Player2).
Tributes: 3
Edit |
Remove#165. (Player1) (declares/declares/declares/declares/declare1) that [typeA1] will build (Player1)land.
Tributes: 1
Edit |
Remove#166. (Player1) and (Player2) use an invisibility spray on themselves to prank people.
Tributes: 2
Edit |
Remove#167. (Player1) (transforms/transforms/transforms/transforms/transform1) into (a zombie/a zombie/a zombie/a zombie/zombies1) after eating (a floating orange burger/a floating orange burger/a floating orange burger/a floating orange burger/floating orange burgers1).
Tributes: 1
Edit |
Remove#168. (Player1) (releases/releases/releases/releases/release1) a genie from a magic lamp and (is/is/is/is/are1) given three wishes, but can't wish for more wishes. [TypeA1] (wishes/wishes/wish/wishes/wish1) to become (a royal/a royal/a royal/a royal/royals1).
Tributes: 1
Edit |
Remove#169. When (Player1) tests time travel, [typeA1] (returns/returns/return/returns/return1) as (a preteen/a preteen/a preteen/a preteen/preteens1), (an old person/an old person/an old person/an old person/old people1), and (a baby/a baby/a baby/a baby/babies1) in that order before becoming normal again.
Tributes: 1
Edit |
Remove#170. (Player1) (constructs/constructs/constructs/constructs/construct1) a golem out of blocks of snow and a pumpkin.
Tributes: 1
Edit |
Remove#171. (Player1) (constructs/constructs/constructs/constructs/construct1) a golem out of blocks of iron and a pumpkin.
Tributes: 1
Edit |
Remove#172. (Player1) (strikes/strikes/strikes/strikes/strike1) a pose from (Player2)'s source material(s). When (Player3) (asks/asks/asks/asks/ask3) [typeB1], (Player1) (says/says/says/says/say1) it's [typeC1] victory pose if [typeA1] (is/is/are/is/are1) chosen for a fighting game.
Tributes: 3
Edit |
Remove#173. (Player1) (speaks/speaks/speaks/speaks/speak1) (Player2)'s forbidden (name/name/name/name/names2). This results in [typeC1] fine china breaking, causes dramatic thunder, makes all the nearby dogs howl, causes milk to sour, and triggers a mild itching sensation on [typeB1].
Tributes: 2
Edit |
Remove#174. (Player1) (finds/finds/finds/finds/find1) yellow, pink, green, and purple syringes. [TypeA1] (injects/injects/inject/injects/inject1) [typeD1] with the yellow one and (gains/gains/gains/gains/gain1) super strength and indestructibility.
Tributes: 1
Edit |
Remove#175. (Player1) (finds/finds/finds/finds/find1) yellow, pink, green, and purple syringes. [TypeA1] (injects/injects/inject/injects/inject1) [typeD1] with the green one, which turns out to be heroin.
Tributes: 1
Edit |
Remove#176. (Player1) (finds/finds/finds/finds/find1) yellow, pink, green, and purple syringes. [TypeA1] (injects/injects/inject/injects/inject1) [typeD1] with the purple one, granting [typeB1] the ability to shapeshift into anything.
Tributes: 1
Edit |
Remove#177. (Player1) (finds/finds/finds/finds/find1) yellow, pink, green, and purple syringes. [TypeA1] (injects/injects/inject/injects/inject1) [typeD1] with the pink one, allowing [typeB1] to build anything in seconds.
Tributes: 1
Edit |
Remove#178. (Player1) (boasts/boasts/boasts/boasts/boast1) that [typeA1] brought other tributes to their knees, breezed through the Arena, and (has/has/have/has/have1) other tributes' worlds in [typeC1] expansion pack.
Tributes: 1
Edit |
Remove#179. After (Player1), (Player2), (Player3), and (Player4) get sucked into a video game, (Player4) (says/says/says/says/say4) that they all must be in a coma after being electrocuted and that the whole thing is a shared dream. (Player2) (responds/responds/responds/responds/respond1), "Together? We're all in a coma together?" They eventually return after going through a lengthy adventure.
Tributes: 4
Edit |
Remove#180. (Player1) and (Player2) are imbued with magnetic properties after touching an electrical outlet.
Tributes: 2
Edit |
Remove#181. (Player1) (enters/enters/enters/enters/enter1) a toilet, only to run away in disgust and fear after spotting an animal peeking out from the hole.
Tributes: 1
Edit |
Remove#182. (Player1) (waves/waves/waves/waves/wave1) at (a rock/a rock/a rock/a rock/rocks2) shaped like (Player2)'s (head/head/head/head/heads2) and (says/says/says/says/say1) "yo (Player2)".
Tributes: 2
Edit |
Remove#183. (Player1) (turns/turns/turns/turns/turn1) out to be sponsored by a villain from [typeC1] source material.
Tributes: 1
Edit |
Remove#184. (Player1) (buys/buys/buys/buys/buy1) some weapons from (Player2).
Tributes: 2
Edit |
Remove#185. (Player1) (reveals/reveals/reveals/reveals/reveal1) that [typeA1] (has/has/have/has/have1) a dream - to become (a gangstar/a gangstar/a gangstar/a gangstar/gangstars1), or (a gang leader/a gang leader/a gang leader/a gang leader/gang leaders1) who (defends/defends/defends/defends/defend1) helpless people.
Tributes: 1
Edit |
Remove#186. (Player1) (gets/gets/gets/get/get1) stuck in a tube slide after eating too many cheeseburgers. (Player2) (manages/manages/manages/manages/manage2) to get [typeB1] out.
Tributes: 2
Edit |
Remove#187. (Player1) (tries/tries/tries/tries/try1) to guess what the sound that (Player2) plays for [typeB1] is. (Player1)'s guess is wildly incorrect.
Tributes: 2
Edit |
Remove#188. (Player1)'s feet get stuck in the street. (Player2), (Player3), (Player4), and (Player5) try all manner of methods to get (Player1) unstuck.
Tributes: 5
Edit |
Remove#189. (Player1) (breaks/breaks/breaks/breaks/break1) 33 pencils in [typeB1] season run, and ha(s/s/s/s/ve1) (Player2) break two of those pencils because they were too hard.
Tributes: 2
Edit |
Remove#190. (Player1) accidentally (pulls/pulls/pulls/pulls/pull1) (Player2)'s hea(d/d/d/d/ds2) clean off while trying to take [typeB2] hat(t/t/t/t/ts2) off. [TypeA2] (sticks/sticks/stick/sticks/stick2) (it/it/it/it/them2) back on and (leaves/leaves/leave/leaves/leave2), offended.
Tributes: 2
Edit |
Remove#191. Upon seeing a mouse, (Player1) (flips/flips/flips/flips/flip1) out and (runs/runs/runs/runs/run1) amok, repeatedly shouting "(Player2), (Player3), the cheese!"
Tributes: 3
Edit |
Remove#192. (Player1) (creates/creates/creates/creates/create1) a music remix using voice clips of the other tributes.
Tributes: 1
Edit |
Remove#193. (Player1) (goes/goes/goes/goes/go1) lava-surfing.
Tributes: 1
Edit |
Remove#194. (Player1) (gets/gets/gets/gets/get1) turned into a minimalistic version of [typeD1].
Tributes: 1
Edit |
Remove#195. (Player1) (attacks/attacks/attacks/attacks/attack1) (Player2) with a giant spoon. [TypeA2] (survives/survives/survive/survives/survive2) and (plans/plans/plan/plans/plan2) [typeC2] revenge.
Tributes: 2
Edit |
Remove#196. (Player1) (shoulderbashes/shoulderbashes/shoulderbashes/shoulderbashes/shoulderbash1) (Player2) somewhere very sensitive.
Tributes: 2
Edit |
Remove#197. (Player1) (ascends/ascends/ascends/ascends/ascend1) to godhood.
Tributes: 1
Edit |
Remove#198. (Player1) (ascends/ascends/ascends/ascends/ascend1) to godhood and (attempts/attempts/attempts/attempts/attempt1) to smite (Player2). (Player2) (survives/survives/survives/survives/survive2) a lightning bolt, then a disintegration beam. With an exasperated cry of "I believe it not!", (Player1) (gives/gives/gives/gives/give1) up.
Tributes: 2
Edit |
Remove#199. Just (Player1).
Tributes: 1
Edit |
Remove#200. (Player1) (throws/throws/throws/throws/throw1) (Player2) in a coffin and (nails/nails/nails/nails/nail1) it shut, but (Player2) (manages/manages/manages/manages/manage2) to break the coffin open and escape.
Tributes: 2
Edit |
Remove#201. (Player1), (Player2), (Player3) and (Player4) attend the funeral of the last fallen tribute.
Tributes: 4
Edit |
Remove#202. (Player1) (makes/makes/makes/makes/make1) a (Player1) noise.
Tributes: 1
Edit |
Remove#203. (Player1) (bleeds/bleeds/bleeds/bleeds/bleed1) from [typeC1] lungs.
Tributes: 1
Edit |
Remove#204. (Player1) (eats/eats/eats/eats/eat1) blackstrap molasses straight from the jar.
Tributes: 1
Edit |
Remove#205. (Player1) (T-poses/T-poses/T-poses/T-poses/T-pose1) to assert dominance over (Player2).
Tributes: 2
Edit |
Remove#206. (Player1), (Player2) and (Player3) all agree that (Player4) (is/is/is/is/are4) the most cursed Tribute in the Arena.
Tributes: 4
Edit |
Remove#207. After catching (Player1) and (Player2) eavesdropping on [typeB3], (Player3) (accuses/accuses/accuses/accuses/accuse3) them of "snooping as usual, (I/I/I/I/we3) see?"
Tributes: 3
Edit |
Remove#208. (Player1) (is/is/is/is/are1) demoting (Player2) to Scrub (Player2) Third Class! Now go and mop up the dungeon!
Tributes: 2
Edit |
Remove#209. (Player1) (respects/respects/respects/respects/respect1) (Player2)'s privacy by knocking on the door to [typeC2] camp, but (asserts/asserts/asserts/asserts/assert1) [typeC1] authority by coming in anyway.
Tributes: 2
Edit |
Remove#210. (Player1) (explains/explains/explains/explains/explain1) the lore of [typeC1] source material to (Player2). (Player2) (is/is/is/is/are2) very confused.
Tributes: 2
Edit |
Remove#211. (Player1) must restart to install updates.
Tributes: 1
Edit |
Remove#212. (Player1) (is/is/is/is/are1) not just (a clown/a clown/a clown/a clown/clowns1). [TypeA1] (is/is/are/is/are1) the entire circus.
Tributes: 1
Edit |
Remove#213. (Player1) (is/is/is/is/are1) a hot mess.
Tributes: 1
Edit |
Remove#214. As (Player1) (walks/walks/walks/walks/walk1) through the valley of the shadow of death, [typeA1] (takes/takes/take/takes/take1) a look at [typeC1] (life/life/life/life/lives1) and (realises/realises/realise/realises/realise1) there's nothing left.
Tributes: 1
Edit |
Remove#215. (Player1) (subjects/subjects/subjects/subjects/subject1) (Player2) to a random fatal event, which fails to kill [typeB2].
Tributes: 2
Edit |
Remove#216. (Player1) sus, (Player2) saw [typeB1] vent.
Tributes: 2
Edit |
Remove#217. (Player1) (starts/starts/starts/starts/start1) seeing (Player2)'s fac(e/e/e/e/es2) wherever [typeA1] look(s/s/s/s/1).
Tributes: 2
Edit |
Remove#218. (Player1) can't fucking take it any more!
Tributes: 1
Edit |
Remove#219. (Player1) (calls/calls/calls/calls/call1) out (Player2) for messily devouring a funnel cake.
Tributes: 2
Edit |
Remove#220. (Player1) (steals/steals/steals/steals/steal1) corn from (Player2), only to get elbowbashed by [typeB2].
Tributes: 2
Edit |
Remove#221. (Player1) (accuses/accuses/accuses/accuses/accuse1) (Player2) of being (a cannibal/a cannibal/a cannibal/a cannibal/cannibals2), which [typeA1] (recitifies/recitifies/recitifies/recitifies/recitify1) by telling (Player2) that [typeA2] (feels/feels/feels/feels/feel2) comfortable being (a cannibal/a cannibal/a cannibal/a cannibal/cannibals2).
Tributes: 2
Edit |
Remove#222. (Player1) (forces/forces/forces/forces/force1) (Player2) to record a statement on a tape recorder.
Tributes: 2
Edit |
Remove#223. (Player1) (offers/offers/offers/offers/offer1) (Player2) beef broth served in (a cup/a cup/a cup/a cup/cups1), which [typeA2] politely reject(s/s//s/2).
Tributes: 2
Edit |
Remove#224. (Player1) (is/is/is/is/are1) given a box of fried fish from (Player2).
Tributes: 2
Edit |
Remove#225. (Player1) (impales/impales/impales/impales/impale1) (Player2) multiple times whilst the latter (is/is/is/is/are2) busy making cheese. [TypeA2] survive(s/s//s/2) and manage(s/s//s/2) to recover.
Tributes: 2
Edit |
Remove#226. (Player1) (cheeses/cheeses/cheeses/cheeses/cheese1) out some cheese to enjoy at a later time.
Tributes: 1
Edit |
Remove#227. (Player1) (punches/punches/punches/punches/punch1) (Player2) in the stomach because [typeA2] claimed that no two individuals can look identical.
Tributes: 2
Edit |
Remove#228. (Player1) (distracts/distracts/distracts/distracts/distract1) (Player2) by pointing at the sky and yelling "HOLY SHIT, IT".
Tributes: 2
Edit |
Remove#229. (Player1) (plays/plays/plays/plays/play1) a violin near the bridge to trigger (Player2)'s sensitive hearing.
Tributes: 2
Edit |
Remove#230. (Player1) (squirts/squirts/squirt/squirts/squirt1) lemon juice into (Player2)'s mout(h/h/h/h/hs2), then (runs/runs/runs/runs/run1) away in disgust as [typeA2] (demands/demands/demand/demands/demand2) more.
Tributes: 2
Edit |
Remove#231. (Player1) (spits/spits/spit/spits/spit1) at (Player2), only to get spat in [typeC1] mout(h/h/h/h/hs2) in retaliation.
Tributes: 2
Edit |
Remove#232. (Player1) (gets/gets/gets/gets/get1) knocked out by (Player2) for eating bug-shaped foods with googly eyes.
Tributes: 2
Edit |
Remove#233. (Player1) (throws/throws/throws/throws/throw1) a ceramic mug at the ground, injuring (Player2) with the mug's shards.
Tributes: 2
Edit |
Remove#234. (Player1) (encourages/encourages/encourages/encourages/encourage1) (Player2) to fight with strangers.
Tributes: 2
Edit |
Remove#235. (Player1) tells (Player2) that the latter's home is not safe.
Tributes: 2
Edit |
Remove#236. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) how to be boring.
Tributes: 2
Edit |
Remove#237. (Player1) (turns/turns/turns/turns/turn1) (Player2) into (a puny insect/a puny insect/a puny insect/a puny insect/puny insects2). (Player2) (manages/manages/manages/manages/manage1) to escape and turn back to normal.
Tributes: 2
Edit |
Remove#238. (Player1) (builds/builds/builds/builds/build1) a spy shack so that [typeA1] can spy on the other tributes.
Tributes: 1
Edit |
Remove#239. (Player1) (spies/spies/spies/spies/spy1) on (Player2), and (finds/finds/finds/finds/find1) out about some very classified information while doing so.
Tributes: 2
Edit |
Remove#240. (Player1) (asks/asks/asks/asks/ask1) (Player2) to praise dark shadows.
Tributes: 2
Edit |
Remove#241. (Player1) (freaks/freaks/freaks/freaks/freak1) out after seeing a rat in the arena.
Tributes: 1
Edit |
Remove#242. When (Player1) (asks/asks/asks/asks/ask1) (Player2) to name somebody with a big mouth who is not afraid to use it, the latter (responds/responds/responds/responds/respond2) by stating the former's (name/name/name/name/names1).
Tributes: 2
Edit |
Remove#243. (Player1) (receives/receives/receives/receives/receive1) a letter from somebody. That letter is labelled "Dear (Murderer/Murderer/Murderer/Murderer/Murderers1)."
Tributes: 1
Edit |
Remove#244. (Player1) (wants/wants/wants/wants/want1) to fight with strangers.
Tributes: 1
Edit |
Remove#245. "Evil will end one day," (Player1) (says/says/says/says/say1) to (Player2).
Tributes: 2
Edit |
Remove#246. (Player1) and (Player2) start a podcast called "Why ___ Lost The Hunger Games."
Tributes: 2
Edit |
Remove#247. (Player1) (was/was/was/was/were1) going to jump off a building as [typeA1] (was/was/was/was/were1) "aiming for the bushes" when (Player2) (convinces/convinces/convinces/convinces/convince2) [typeB1] not to.
Tributes: 2
Edit |
Remove#248. (Player1) (takes/takes/takes/takes/take1) a selfie.
Tributes: 1
Edit |
Remove#249. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) take a group selfie.
Tributes: 6
Edit |
Remove#250. (Player1), (Player2), (Player3), and (Player4) play a board game.
Tributes: 4
Edit |
Remove#251. (Player1) and (Player2) challenge each other to a chess match. (Player1) (wins/wins/wins/wins/win1).
Tributes: 2
Edit |
Remove#252. (Player1) and (Player2) challenge each other to a chess match. (Player2) (wins/wins/wins/wins/win2).
Tributes: 2
Edit |
Remove#253. (Player1), (Player2), (Player3), and (Player4) start a book club.
Tributes: 4
Edit |
Remove#254. (Player1) (attempts/attempts/attempts/attempts/attempt1) suicide, but (Player2) (talks/talks/talks/talks/talk2) [typeB1] out of it.
Tributes: 2
Edit |
Remove#255. (Player1) (accuses/accuses/accuses/accuses/accuse1) (Player2) of stealing (a cookie/a cookie/a cookie/ a cookie/cookies2) from the cookie jar. (Player2) (declares/declares/declares/declares/declare2) [typeC2] innocence.
Tributes: 2
Edit |
Remove#256. (Player1) (accuses/accuses/accuses/accuses/accuse1) (Player2) of stealing (a cookie/a cookie/a cookie/ a cookie/cookies2) from the cookie jar. (Player2) (denies/denies/denies/denies/deny2) it and (gets/gets/gets/gets/get2) away with it.
Tributes: 2
Edit |
Remove#257. (Player1) (accuses/accuses/accuses/accuses/accuse1) (Player2) of stealing (a cookie/a cookie/a cookie/ a cookie/cookies2) from the cookie jar. (Player2) (denies/denies/denies/denies/deny2) it but (is/is/is/is/are2) found guilty.
Tributes: 2
Edit |
Remove#258. (Player1) (asks/asks/asks/asks/ask1) (Player2), (Player3), and (Player4) if they know who stole the cooki(e/e/e/e/es4) from the cookie jar. (Player4) (admits/admits/admits/admits/admit1) to the theft.
Tributes: 4
Edit |
Remove#259. (Player1) (asks/asks/asks/asks/ask1) (Player2), (Player3), and (Player4) if they know who stole the cooki(e/e/e/e/es5) from the cookie jar. Turns out it was (Player5).
Tributes: 5
Edit |
Remove#260. (Player1) (asks/asks/asks/asks/ask1) (Player2), (Player3), and (Player4) if they know who stole the cookies from the cookie jar. All are found guilty and sent to the Fungeon.
Tributes: 4
Edit |
Remove#261. (Player1) (forces/forces/forces/forces/force1) (Player2) to perform a dangerous stunt. (Player2) (succeeds/succeeds/succeeds/succeeds/succeed2).
Tributes: 2
Edit |
Remove#262. (Player1) (arrives/arrives/arrives/arrives/arrive1) at [typeC1] camp with some pizza, only to find (Player2) and (Player3) tending to (Player4)'s (leg/leg/leg/leg/legs4) of a gunshot wound, (Player5) losing [typeC5] (arm/arm/arm/arm/arms5) in a fire, and (Player6) dyeing (a strand/a strand/a strand/a strand/strands6) of [typeC6] hair blue.
Tributes: 6
Edit |
Remove#263. (Player1) (drives/drives/drives/drives/drive1) an ice cream truck and (tries/tries/tries/tries/try1) playing a song that brainwashes (Player2), (Player3), and (Player4) when they get ice cream, but it plays [typeC1] poor rendition of "Bicycle Built For Two" instead because (Player5) secretly swapped the tapes.
Tributes: 5
Edit |
Remove#264. (Player1) (tells/tells/tells/tells/tell1) (Player2) that [typeA1] won't kill [typeB2] and [typeC2] S. O. (Player3). (Player4) (says/says/says/says/say4) that they're not dating, but (Player1) (refuses/refuses/refuses/refuses/refuse1) to believe it.
Tributes: 4
Edit |
Remove#265. (Player1) (forgets/forgets/forgets/forgets/forget1) to remove [typeC1] voice changer during [typeC1] video chat with (Player2), (Player3), and (Player4). (Player2) (snarks/snarks/snarks/snarks/snark2) that [typeA2] understood it well.
Tributes: 4
Edit |
Remove#266. (Player1) tell(s/s/s/s/1) (Player2) [typeC2] (waifu is/waifu is/waifu is/waifus are2) trash.
Tributes: 2
Edit |
Remove#267. (Player1) tell(s/s/s/s/1) (Player2) [typeC2] (husbando is/husbando is/husbando is/husbando is/husbandos are2) trash.
Tributes: 2
Edit |
Remove#268. After seeing (Player1) set fire to (Player2)'s (camp/camp/camp/camp/camps2), (Player3) and (Player4) tell (Player1) to burn down camps every day.
Tributes: 4
Edit |
Remove#269. (Player1) (yells/yells/yells/yells/yell1) "Confound those tributes! Oh, how (I/I/I/I/We1) hate them! (I/I/I/I/We1) hate (Player2)! (I/I/I/I/We1) hate (Player3)! And (I/I/I/I/We1) hate (Player4)! They drive (me/me/me/me/us1) to drink!"
Tributes: 4
Edit |
Remove#270. (Player1), (Player2), (Player3) and (Player4) play Super Smash Bros.
Tributes: 4
Edit |
Remove#271. (Player1), (Player2), (Player3) and (Player4) play Mario Kart.
Tributes: 4
Edit |
Remove#272. (Player1), (Player2), (Player3) and (Player4) play Mario Party.
Tributes: 4
Edit |
Remove#273. (Player1) (wins/wins/wins/wins/win1) (a plush/a plush/a plush/a plush/plushies2) of (Player2) from a crane game.
Tributes: 2
Edit |
Remove#274. (Player1) (throws/throws/throws/throws/throw1) darts at a dartboard with a picture of (Player2).
Tributes: 2
Edit |
Remove#275. (Player1) (climbs/climbs/climbs/climbs/climb1) to the top of a tower to fight the boss (Player2), only to interrupt [typeC2] dinner.
Tributes: 2
Edit |
Remove#276. (Player1) (glues/glues/glues/glues/glue1) (Player2) and (Player3)'s foreheads together, then (kicks/kicks/kicks/kicks/kick1) them to the ground as they struggle to pull themselves away from each other.
Tributes: 3
Edit |
Remove#277. (Player1) (downloads/downloads/downloads/downloads/download1) a car.
Tributes: 1
Edit |
Remove#278. (Player1) slowly loses [typeC1] min(d/d/d/d/ds1) while explaining the lore of (Player2)'s source material.
Tributes: 2
Edit |
Remove#279. (Player1) practis(es/es/es/es/e1) [typeC1] introduction speech before fighting (Player2).
Tributes: 2
Edit |
Remove#280. (Player1) accept(s/s/s/s/1) (Player2)'s challenge to a fight and (walks/walks/walks/walks/walk1) in on [typeB2] practising [typeC2] introduction speech.
Tributes: 2
Edit |
Remove#281. (Player1)'s (smile/smile/smile/smile/smiles1) and optimism: gone.
Tributes: 1
Edit |
Remove#282. (Player1) (walks/walks/walks/walks/walk1) off a cliff, but as [typeA1] (realizes/realizes/realize/realizes/realize1) what [typeA1]'(s/s/re/s/re1) doing, [typeA1] quickly (runs/runs/run/runs/run1) back.
Tributes: 1
Edit |
Remove#283. (Player1) get(s/s/s/s/1) a pet parrot and teaches it to say [typeC1] catchphrase.
Tributes: 1
Edit |
Remove#284. (Player1) tr(ies/ies/ies/ies/y1) cursing (Player2) with a bad luck spell, but (messes/messes/messes/messes/mess1) up and (gives/gives/gives/gives/give1) [typeB2] good luck instead.
Tributes: 2
Edit |
Remove#285. (Player1) tr(ies/ies/ies/ies/y1) blessing (Player2) with a good luck spell, but (messes/messes/messes/messes/mess1) up and (gives/gives/gives/gives/give1) [typeB2] bad luck instead.
Tributes: 2
Edit |
Remove#286. (Player1) (does/does/does/does/do1) a backwards long jump to get to the top of an endless set of stairs.
Tributes: 1
Edit |
Remove#287. (Player1) (makes/makes/makes/makes/make1) a medley of music from [typeC1] own source material.
Tributes: 1
Edit |
Remove#288. (Player1) (drags/drags/drags/drags/drag1) [typeC1] partially eaten bowl of ice cream to magically refill it.
Tributes: 1
Edit |
Remove#289. (Player1) (uses/uses/uses/uses/use1) a chair to travel great distances.
Tributes: 1
Edit |
Remove#290. (Player1) (is/is/is/is/are1) creeped out by [typeC1] own creepy whispering.
Tributes: 1
Edit |
Remove#291. (Player1) can't hear (Player2) because the rain sounds like (Player2).
Tributes: 2
Edit |
Remove#292. (Player1) (decides/decides/decides/decides/decide1) to restore (Player2)'s source material(s).
Tributes: 2
Edit |
Remove#293. (Player1) (is/is/is/is/are1) appointed to create new contents for (Player2)'s source material(s).
Tributes: 2
Edit |
Remove#294. (Player1) (discovers/discovers/discovers/discovers/discover1) that a product [typeA1] bought is fake and allegedly will expire in 1000 years.
Tributes: 1
Edit |
Remove#295. (Player1) (uses/uses/uses/uses/use1) a bottle of shampoo that makes [typeC1] hair messy.
Tributes: 1
Edit |
Remove#296. (Player1) (shrinks/shrinks/shrinks/shrinks/shrink1) [typeD1] to go inside a vending machine, but the transformation time runs out while [typeA1] (is/is/are/is/are1) still inside, leaving [typeB1] stuck inside the machine.
Tributes: 1
Edit |
Remove#297. (Player1) and (Player2) are tortured when a hidden gramophone suddenly starts playing a bad song loudly.
Tributes: 2
Edit |
Remove#298. (Player1) (scares/scares/scares/scares/scare1) (Player2) away by wearing (a whale costume/a whale costume/a whale costume/a whale costume/whale costumes1).
Tributes: 2
Edit |
Remove#299. (Player1) (tries/tries/tries/tries/try1) to replace a photo (Player2) (has/has/has/has/have2) taken in [typeC2] (phone/phone/phone/phone/phones2) after [typeA1] accidentally (deletes/deletes/deletes/deletes/delete1) it.
Tributes: 2
Edit |
Remove#300. (Player1) (buys/buys/buys/buys/buy1) a literal lemon car, which is shaped like and literally made out of a giant lemon.
Tributes: 1
Edit |
Remove#301. (Player1) (receives/receives/receives/receives/receive1) a vision of [typeD1] skateboarding in the future.
Tributes: 1
Edit |
Remove#302. (Player1) (rides/rides/rides/rides/ride1) a helicopter and (lands/lands/lands/lands/land1) on a huge statue. There, [typeA1] (finds/finds/find/finds/find1) a secret door that leads to a chamber containing the beating heart of the statue, held by chains.
Tributes: 1
Edit |
Remove#303. (Player1) (makes/makes/makes/makes/make1) a TV-style opening for the current season, composing [typeC1] own song and using all scenes of the events that have happened so far for the visuals.
Tributes: 1
Edit |
Remove#304. (Player1), (Player2), and (Player3) are gifting chocolate for (Player4) when (Player5) (reveals/reveals/reveals/reveals/reveal5) [typeC5] gift for [typeB4], (a large/a large/a large/a large/large4) Statue of Liberty-style chocolate (statue/statue/statue/statue/statues4) of (Player4).
Tributes: 5
Edit |
Remove#305. After seeing how everyone acts in the Arena, (Player1) (says/says/says/says/say1), "Has there been some kind of chemical leak today? 'Cause right now, everyone's acting like total psychos."
Tributes: 1
Edit |
Remove#306. (Player1), (Player2) and (Player3) accidentally get stuck inside a buried time capsule that (Player4) has found earlier. (Player1) and (Player2) then spray shaving cream into everyone inside, including themselves. Some time later, everyone makes it out due to (Player5) digging a hole into it and thus opening an exit, with (Player3) thinking they are in the future due to the white "beards".
Tributes: 5
Edit |
Remove#307. (Player1) (screams/screams/screams/screams/scream1), "okay, who's been messing with the clone machine?" It then shows clones of (Player2), so (Player1) (drops/drops/drops/drops/drop1) them all out of the building.
Tributes: 2
Edit |
Remove#308. (Player1) (laments/laments/laments/laments/lament1) that it's been a long day without (Player2), [typeC1] (friend/friend/friend/friend/friends1). [TypeA1]'ll tell [typeB2] all about it when [typeA1] (sees/sees/see/sees/see1) [typeB2] again.
Tributes: 2
Edit |
Remove#309. (Player1) and (Player2) take a shot (of apple juice, of course) for every game of I Spy that has happened so far.
Tributes: 2
Edit |
Remove#310. (Player1) ha(s/s/s/s/ve1) been revealed as the first Challenger Pack 3 fighte(r/r/r/r/rs1).
Tributes: 1
Edit |
Remove#311. (Player1) and (Player2) play Yacht.
Tributes: 2
Edit |
Remove#312. (Player1) ask(s/s/s/s/1) (Player2) if [typeA1] can have some ice cream. (Player2) say(s/s/s/s/2), “Only a spoonful!” This leads to (Player1) pulling out a comically large spoon.
Tributes: 2
Edit |
Remove#313. (Player1)'s (laptop/laptop/laptop/laptop/laptops1) (crashes/crashes/crashes/crashes/crash1) and (burns/burns/burns/burns/burn1) when (Player1) (is/is/is/is/are1) trying to use (it/it/it/it/them1).
Tributes: 1
Edit |
Remove#314. (Player1) (tells/tells/tells/tells/tell1) (Player2) that [typeA1] (is/is/are/is/are1) trying to sneak around, but the sound of [typeC1] buttcheeks keeps alerting (Player3) and (Player4).
Tributes: 4
Edit |
Remove#315. (Player1) (mentions/mentions/mentions/mentions/mention1) a terrifying biological fact. (Player2) (becomes/becomes/becomes/becomes/become2) terrified of [typeD2].
Tributes: 2
Edit |
Remove#316. (Player2) (exclaims/exclaims/exclaims/exclaims/exclaim2) that (Player1) will never have drip. [typeA2] (is/is/are/is/are2) immediately proven wrong by (Player1)'s overly extravagant (and somewhat stupid looking) street clothing.
Tributes: 2
Edit |
Remove#317. (Player1) (feels/feels/feels/feels/feel1) like [typeA1] (keeps/keeps/keep/keeps/keep1) doing the same things over and over.
Tributes: 1
Edit |
Remove#318. (Player1) (calls/calls/calls/calls/call1) (Player2) (a little pissbaby/a little pissbaby/a little pissbaby/a little pissbaby/little pissbabies2).
Tributes: 2
Edit |
Remove#319. (Player1) (says/says/says/says/say1) "(I/I/I/I/we1) love you" on the plane. (Player2) (says/says/says/says/say2) "(I/I/I/I/We2) love you, too."
Tributes: 2
Edit |
Remove#320. (Player1) (takes/takes/takes/takes/take1) a photo of (Player2), (Player3), and (Player4) with a faulty phone, which somehow makes them look like they have been blasted in reality.
Tributes: 4
Edit |
Remove#321. (Player1) (tries/tries/tries/tries/try1) to get (Player2) to become (a deity/a deity/a deity/a deity/deities2), but [typeA2] would be rather be lazing around instead.
Tributes: 2
Edit |
Remove#322. (Player1) (bandages/bandages/bandages/bandages/bandage1) (Player2)'s wounds while [typeA2] (fights/fights/fights/fights/fight2) against (Player3).
Tributes: 3
Edit |
Remove#323. (Player1) (screams/screams/screams/screams/scream1) loudly as (Player2) (amputates/amputates/amputates/amputates/amputate2) [typeC1] thum(b/b/b/b/bs1) to use as bait against (Player3).
Tributes: 3
Edit |
Remove#324. (Player1) jokingly (asks/asks/asks/asks/ask1) who owns [typeC1] tungsten cube, to which (Player2) (questions/questions/questions/questions/question2) whether or not (Player1)'s cube (belongs/belongs/belongs/belongs/belong1) to [typeB1].
Tributes: 2
Edit |
Remove#325. (Player1) (wonders/wonders/wonders/wonders/wonder1) what's for lunch.
Tributes: 1
Edit |
Remove#326. (Player1) (takes/takes/takes/takes/take1) (Player2) aboard [typeC1] base and torture(s/s/s/s/1) [typeB2] for the entire day.
Tributes: 2
Edit |
Remove#327. (Player1), (Player2), and (Player3) zap (Player4) with a device that prevents [typeB4] from attacking. [TypeA4] later reverses the effect.
Tributes: 4
Edit |
Remove#328. (Player1) (tells/tells/tells/tells/tell1) (Player2), "I can't believe you smoke marijuana. There are side effects don't you know." The side effect is then shown when (Player2) (makes/makes/makes/makes/make2) a bowl of cereal with milk by pouring milk into the open cereal box.
Tributes: 2
Edit |
Remove#329. (Player1) (casts/casts/casts/casts/cast1) a spell to have everybody forget something [typeA1] didn't want everybody else to know about [typeB1].
Tributes: 1
Edit |
Remove#330. When (Player1) (calls/calls/calls/calls/call1) (Player2) (a villain/a villain/a villain/a villain/villains2), the latter (responds/responds/responds/responds/respond2) by stating that [typeA2] (is/is/are/is/are2) not (a villain/a villain/a villain/a villain/villains2) but (an anti-hero/an anti-hero/an anti-hero/an anti-hero/anti-heroes2).
Tributes: 2
Edit |
Remove#331. "Thank you for your help, (idiot/idiot/idiot/idiot/idiots2)!" (Player1) (says/says/says/says/say1) to (Player2).
Tributes: 2
Edit |
Remove#332. President Snow issues a decree where any superpowers the tributes may have shall be stripped away from them. The first (victim/victim/victim/victim/victims1) of this decree (happens/happens/happens/happens/happen1) to be (Player1).
Tributes: 1
Edit |
Remove#333. (Player1) (confuses/confuses/confuses/confuses/confuse1) (Player2) with (Player3).
Tributes: 3
Edit |
Remove#334. (Player1) (hopes/hopes/hopes/hopes/hope1) (Player2) (gets/gets/gets/gets/get2) bit by (a freaking crocodile/a freaking crocodile/a freaking crocodile/a freaking crocodile/freaking crocodiles2).
Tributes: 2
Edit |
Remove#335. A wild dog comes up to (Player1), and tells [typeB1] to kill the radio.
Tributes: 1
Edit |
Remove#336. (Player1) (flicks/flicks/flicks/flicks/flick1) a dagger for fifteen minutes.
Tributes: 1
Edit |
Remove#337. (Player1) (prepares/prepares/prepares/prepares/prepare1) a salvo.
Tributes: 1
Edit |
Remove#338. (Player1) (reads/reads/reads/reads/read1) the previous season. [TypeA1] (is/is/are/is/are1) shocked by the surprise winner.
Tributes: 1
Edit |
Remove#339. They fight, and bite, and fight and fight and bite! Fight, fight, fight! Bite, bite, bite! The (Player1) & (Player2) Show!
Tributes: 2
Edit |
Remove#340. Hey all, (Player1) here!
Tributes: 1
Edit |
Remove#341. (Player1) (wonders/wonders/wonders/wonders/wonder1) what's for dinner.
Tributes: 1
Edit |
Remove#342. (Player1) (asks/asks/asks/asks/ask1) (Player2) what's wrong with [typeB1]. (Player2) (says/says/says/says/say2), “Maybe it's the way you're dressed?”
Tributes: 2
Edit |
Remove#343. (Player1) (whispers/whispers/whispers/whispers/whisper1) to (Player2) to ask for help, but accidentally (deafens/deafens/deafens/deafens/deafen2) (Player2) with [typeC1] sonic brown notes.
Tributes: 2
Edit |
Remove#344. (Player1) (helps/helps/helps/helps/help1) (Player2) flatten a crocodile into pastry dough.
Tributes: 2
Edit |
Remove#345. (Player1) (helps/helps/helps/helps/help1) (Player2) make country biscuits out of crocodile pastry dough.
Tributes: 2
Edit |
Remove#346. (Player1) (suffocates/suffocates/suffocates/suffocates/suffocate1) (Player2) by shoving spiderwebs into [typeC2] mout(h/h/h/h/hs2), but [typeA2] (manages/manages/manage/manages/manage2) to spit it out.
Tributes: 2
Edit |
Remove#347. (Player1) (chokes/chokes/chokes/chokes/choke1) (Player2) by wrapping spiderwebs around [typeC2] nec(k/k/k/k/ks2) but [typeA2] brea(ks/ks/k/ks/k2) the spiderwebs and runs away.
Tributes: 2
Edit |
Remove#348. (Player1) (gets/gets/gets/gets/get1) mocked by (Player2) over a failed attempt to blacklist the latter through convoluted reasons.
Tributes: 2
Edit |
Remove#349. (Player1) (tells/tells/tells/tells/tell1) (Player2) to shut up and get lost in the Midwest.
Tributes: 2
Edit |
Remove#350. (Player1) (forces/forces/forces/forces/force1) (Player2) to say "oof" under a death threat.
Tributes: 2
Edit |
Remove#351. (Player1) (seasons/seasons/seasons/seasons/season1) [typeC1] steak using the cutting board, aggravating (Player2), who (assumes/assumes/assumes/assumes/assume2) that the technique is objectively wrong.
Tributes: 2
Edit |
Remove#352. (Player1) (shoves/shoves/shoves/shoves/shove1) (Player2)'s hea(d/d/d/d/ds2) down (a/a/a/a/some2) saxophon(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#353. (Player1) (makes/makes/makes/makes/make1) a makeshift hot air balloon with a box and a sack. The hot air balloon fails to fly.
Tributes: 1
Edit |
Remove#354. (Player1) (makes/makes/makes/makes/make1) a makeshift hot air balloon with a box and a sack. The fire in the hot air balloon ends up burning [typeB1].
Tributes: 1
Edit |
Remove#355. (Player1) (knocks/knocks/knocks/knocks/knock1) out (Player2) with a giant chicken drumstick.
Tributes: 2
Edit |
Remove#356. One of (Player1)'s teeth gets pulled out by a parrot.
Tributes: 1
Edit |
Remove#357. (Player1) (persuades/persuades/persuades/persuades/persuade1) a parrot to remove a tooth from (Player2). The parrot successfully removes it.
Tributes: 2
Edit |
Remove#358. (Player1) (persuades/persuades/persuades/persuades/persuade1) a parrot to remove a tooth from (Player2). The parrot fails.
Tributes: 2
Edit |
Remove#359. (Player1) (persuades/persuades/persuades/persuades/persuade1) a parrot to remove a tooth from (Player2). The parrot gets killed by the latter.
Tributes: 2
Edit |
Remove#360. (Player1) (believes/believes/believes/believes/believe1) that (Player2) (has been/has been/has been/has been/have been1) compromised by a parrot.
Tributes: 2
Edit |
Remove#361. (Player1) (believes/believes/believes/believes/believe1) that (Player2) (has been/has been/has been/has been/have been1) compromised by (Player3).
Tributes: 3
Edit |
Remove#362. (Player1) (finds/finds/finds/finds/find1) a pie. [TypeA1] (takes/takes/take/takes/take1) a bite into it, discovering that it's full of toothpaste.
Tributes: 1
Edit |
Remove#363. (Player1) (finds/finds/finds/finds/find1) a pie. [TypeA1] (takes/takes/take/takes/take1) a bite into it, discovering that contains a picture of (Player2).
Tributes: 2
Edit |
Remove#364. (Player1) (destroys/destroys/destroys/destroys/destroy1) (Player2)'s cake by putting it in a washing machine.
Tributes: 2
Edit |
Remove#365. (Player1), (Player2), and (Player3) plot to take over (Player4)'s homeworld.
Tributes: 4
Edit |
Remove#366. (Player1) (burns/burns/burns/burns/burn1) down (Player2)'s camp, leaving [typeB2] to die. (Player2) survives, swearing vengeance upon (Player1).
Tributes: 2
Edit |
Remove#367. (Player1), (Player2), and (Player3) find a pirate ship, and claim it as their own, with (Player1) becoming the (captain/captain/captain/captain/captains1).
Tributes: 3
Edit |
Remove#368. (Player1) and (Player2) find a map of a part of the arena. They fight over it, tearing it in half in the process.
Tributes: 2
Edit |
Remove#369. (Player1) (finds/finds/finds/finds/find1) (a statue/a statue/a statue/a statue/statues2) of (Player2). It turns out to be (Player1)'s dream.
Tributes: 2
Edit |
Remove#370. (Player1) and (Player2) are starving, while (Player3) appears to be eating. It turns out [typeA3] (is/is/are/is/are3) pretending to eat.
Tributes: 3
Edit |
Remove#371. As (Player1) and (Player2) are fishing, (Player1) ha(s/s/s/s/ve1)n't caught anything and (gives/gives/gives/gives/give1) up. (Player2) ask(s/s/s/s/2) if [typeA1] should use bait next time.
Tributes: 2
Edit |
Remove#372. (Player1) and (Player2) are in a museum and find (a statue/a statue/a statue/a statue/statues3) identical to (Player3). The (statue/statue/statue/statue/statues3) then reveal(s/s/s/s/2) that (it is/it is/it is/it is/they are2) the real (Player3).
Tributes: 3
Edit |
Remove#373. While shopping, (Player1) and (Player2) end up getting lost. They look for each other until they meet each other.
Tributes: 2
Edit |
Remove#374. While riding a boat, (Player1) (dances/dances/dances/dances/dance1) while (Player2) (warns/warns/warns/warns/warn1) [typeB1] about falling off. [TypeA1] then (falls/falls/fall/falls/fall1) off.
Tributes: 2
Edit |
Remove#375. While riding a boat, (Player1) (dances/dances/dances/dances/dance1) while (Player2) (warns/warns/warns/warns/warn1) [typeB1] about falling off. They end up dancing together.
Tributes: 2
Edit |
Remove#376. (Player1) (watches/watches/watches/watches/watch1) vultures eating the corpse of the latest tribute who died.
Tributes: 1
Edit |
Remove#377. (Player1) (goes/goes/goes/goes/go1) birdwatching.
Tributes: 1
Edit |
Remove#378. (Player1) (listens/listens/listens/listens/listen1) to the cicadas.
Tributes: 1
Edit |
Remove#379. (Player1) (gives/gives/gives/gives/give1) (Player2) a relaxing massage.
Tributes: 2
Edit |
Remove#380. (Player1) (suplexes/suplexes/suplexes/suplexes/suplex1) a boulder, just because [typeA1] can.
Tributes: 1
Edit |
Remove#381. (Player1), (Player2), (Player3), (Player4), and (Player5) throw (Player6) a surprise party.
Tributes: 6
Edit |
Remove#382. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) how to fight.
Tributes: 2
Edit |
Remove#383. (Player1) (trains/trains/trains/trains/train1) (Player2), (Player3), (Player4), and (Player5) in combat.
Tributes: 5
Edit |
Remove#384. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) play Spin the Bottle.
Tributes: 6
Edit |
Remove#385. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) play Truth or Dare.
Tributes: 6
Edit |
Remove#386. Upon witnessing (Player1) do something disgusting, (Player2) (lets/lets/lets/lets/let2) out a big "NO!"
Tributes: 2
Edit |
Remove#387. (Player1) (gets/gets/gets/gets/get1) stuck in a cave. (Player2) (enters/enters/enters/enters/enter2) the cave to rescue [typeB1] and (succeeds/succeeds/succeeds/succeeds/succeed2).
Tributes: 2
Edit |
Remove#388. (Player1) (takes/takes/takes/takes/take1) a picture of (Player2), but it turns out [typeA1] (is/is/are/is/are1) taking a selfie instead.
Tributes: 2
Edit |
Remove#389. (Player1) (puts/puts/puts/puts/put1) a blanket over (Player2) and (tells/tells/tells/tells/tell1) (Player3), (Player4), and (Player5) to pretend [typeA2] (is/is/are/is/are2) invisible. They leave (Player2) alone.
Tributes: 5
Edit |
Remove#390. (Player1) (saves/saves/saves/saves/save1) (Player2) from drowning by giving [typeB2] CPR.
Tributes: 2
Edit |
Remove#391. (Player1) (insults/insults/insults/insults/insult1) (Player2)'s (hat/hat/hat/hat/hats2), but (Player2) (says/says/says/says/say2) that (Player3) (thinks/thinks/thinks/thinks/think3) (it's/it's/it's/it's/they're2) great... which is high praise because (Player3) (wants/wants/wants/wants/want3) [typeB2] to be more like [typeC2] (hat/hat/hat/hat/hats2).
Tributes: 3
Edit |
Remove#392. (Player1) (pets/pets/pets/pets/pet1) Dusty, the cutest kitten in all of Trouble Cube. All is well.
Tributes: 1
Edit |
Remove#393. (Player1) (breaks/breaks/breaks/breaks/break1) (Player2)'s legs because [typeA2] wouldn't stop prank calling [typeB1].
Tributes: 2
Edit |
Remove#394. (Player1) (pets/pets/pets/pets/pet1) Jupiter, the old cat who wishes he could have been TroubleCube's mascot. He bites (Player1) and draws [typeC1] blood.
Tributes: 1
Edit |
Remove#395. (Player1) (is/is/are/is/are1) at (Player2)'s source material. [TypeA1]'(s/s/re/s/re1) at (Player3)'s source material. [TypeA1]'(s/s/re/s/re1) at the combination (Player2) and (Player3)'s source materials.
Tributes: 3
Edit |
Remove#396. (Player1) (confuses/confuses/confuses/confuses/confuse1) (Player2) with (a character/a character/a character/a character/characters2) from the former's source material.
Tributes: 2
Edit |
Remove#397. (Player1) (confuses/confuses/confuses/confuses/confuse1) (Player2) with (a character/a character/a character/a character/characters2) from (Player3)'s source material.
Tributes: 3
Edit |
Remove#398. (Player1) (goes/goes/goes/goes/go1) on a quiz show. [TypeA1] (slams/slams/slam/slams/slam1) the buttons so many times the panel on [typeC1] podium, the host's podium, and the quiz sign explodes.
Tributes: 1
Edit |
Remove#399. (Player1) (manages/manages/manages/manages/manage1) to fly by flapping [typeC1] arms.
Tributes: 1
Edit |
Remove#400. (Player1) (falls/falls/falls/falls/fall1) off a cliff, but (manages/manages/manages/manages/manage1) to get back up by flapping [typeC1] arms really really hard.
Tributes: 1
Edit |
Remove#401. (Player1) (tells/tells/tells/tells/tell1) (Player2) that (Player3) (is a bad person/is a bad person/is a bad person/is a bad person/is bad persons1). (Player2) replies that to [typeB2], hero's is just bad person. (Player1) replies "(Friend/Friend/Friend/Friend/Friends2) you are crazy!"
Tributes: 3
Edit |
Remove#402. As (Player1) (tries/tries/tries/tries/try1) defeating (Player2), (Player3) (gives/gives/gives/gives/give3) (Player2) a power boost, making [typeB2] stronger than (Player1). (Player1) run(s/s/s/s/1) away.
Tributes: 3
Edit |
Remove#403. (Player1) (tries/tries/tries/tries/try1) convincing the others that (Player2) do(es/es/es/es/2)n't actually exist.
Tributes: 2
Edit |
Remove#404. (Player1) (tries/tries/tries/tries/try1) setting fire to (Player2)'s camp, but (Player2) (was/was/was/was/were1) prepared and already fireproofed it.
Tributes: 2
Edit |
Remove#405. Upon seeing (Player1) kiss (Player2), (Player3) (shakes/shakes/shakes/shakes/shake3) [typeC3] fists and (yells/yells/yell/yells/yell3) "NOOOOOOOOO!"
Tributes: 3
Edit |
Remove#406. (Player1) (cheats/cheats/cheats/cheats/cheat1) to be able to use more weapons than [typeA1] can carry.
Tributes: 1
Edit |
Remove#407. (Player1) (tells/tells/tells/tells/tell1) (Player2) [typeA2] (is/is/are/is/are2) [typeC1] favorite (character/character/character/character/characters2) from [typeC2] source material.
Tributes: 2
Edit |
Remove#408. (Player1) (tells/tells/tells/tells/tell1) (Player2) [typeA2] (is/is/are/is/are2) [typeC1] least favorite (character/character/character/character/characters2) from [typeC2] source material.
Tributes: 2
Edit |
Remove#409. (Player1) (surfs/surfs/surfs/surfs/surf1) around the Arena on a turtle shell.
Tributes: 1
Edit |
Remove#410. (Player1) (wins/wins/wins/wins/win1) a chicken. [TypeA1] (decides/decides/decides/decides/decide1) to hire it as a manager.
Tributes: 1
Edit |
Remove#411. (Player1) (grabs/grabs/grabs/grabs/grab1) a bunch of nails and (shoves/shoves/shoves/shoves/shove1) them into (Player2)'s (mouth/mouth/mouth/mouth/mouths2) before punching [typeC2] (face/face/face/face/faces2).
Tributes: 2
Edit |
Remove#412. (Player1) (grabs a kettle/grabs a kettle/grabs a kettle/grabs a kettle/grab kettles1) of boiling hot water and pour(s/s/s/s/1) it on (Player2) while stepping on [typeB2].
Tributes: 2
Edit |
Remove#413. (Player1) (puts/puts/puts/puts/put1) (an orange/an orange/an orange/an orange/oranges2) into (Player2)'s (mouth/mouth/mouth/mouth/mouths2) before stomping on [typeC2] (face/face/face/face/faces2) while [typeA2] is down, making (a fountain/a fountain/a fountain/a fountain/fountains2) of juice spout from [typeC2] (mouth/mouth/mouth/mouth/mouths2).
Tributes: 2
Edit |
Remove#414. (Player1) puts (a bottle crate/a bottle crate/a bottle crate/a bottle crate/bottle crates1) over (Player2)'s (head/head/head/head/heads2) and (kicks/kicks/kicks/kicks/kick1) it around a few times before splitting it in two with a karate chop.
Tributes: 2
Edit |
Remove#415. (Player1) (picks/picks/picks/picks/pick1) up (a motorcycle/motorcycle/motorcycle/motorcycle/motorcycles1), (knocks/knocks/knocks/knocks/knock1) over (Player2) and (breaks/breaks/breaks/breaks/break1) it in half over [typeB2].
Tributes: 2
Edit |
Remove#416. (Player1) (makes/makes/makes/makes/make1) a bootleg version of (Player2)'s source material.
Tributes: 2
Edit |
Remove#417. While watching a stream of (Player1) getting beaten up, (Player2) (laughs/laughs/laughs/laughs/laugh2) and (says/says/says/says/say2) "This is DELICIOUS!"
Tributes: 2
Edit |
Remove#418. Upon seeing (Player1) get knocked out, (Player2) lets out a triumphant "YES! YES!"
Tributes: 2
Edit |
Remove#419. (Player1) finally (goes/goes/goes/goes/go1) to jail for [typeC1] crimes.
Tributes: 1
Edit |
Remove#420. (Player1) (pushes/pushes/pushes/pushes/push1) start to rich.
Tributes: 1
Edit |
Remove#421. After (Player1) (cuts/cuts/cuts/cuts/cut1) off one of( / / / / each of2) (Player2)'s arms in a fight, (Player2) (says/says/says/says/say2) "'Tis but a scratch" and that [typeA2]'(s/s/ve/s/ve2) had worse.
Tributes: 2
Edit |
Remove#422. After (Player1) (cuts/cuts/cuts/cuts/cut1) off (Player2)'s arms in a fight, (Player2) (claims/claims/claims/claims/claim2) that it's just a flesh wound.
Tributes: 2
Edit |
Remove#423. (Player1), (Player2), (Player3), and (Player4) drop their chocolate spread on a rock. They decide to eat it it off the rock, but an eagle poops on it.
Tributes: 4
Edit |
Remove#424. "No copyright law in the universe is going to stop (me/me/me/me/us1)!" (Player1) (says/says/says/says/say1) before uploading a video online that gets removed ASAP due to copyright issues.
Tributes: 1
Edit |
Remove#425. After (Player1) (runs/runs/runs/runs/run1) a song's lyrics through several layers of Google Translate, [typeA1] (goes/goes/go/goes/go1) on to sing the song with the new translated lyrics.
Tributes: 1
Edit |
Remove#426. (Player1) (sings/sings/sings/sings/sing1) "Let It Snow" alongside President Snow.
Tributes: 1
Edit |
Remove#427. (Player1) (informs/informs/informs/informs/inform1) (Player2) that the latter (has/has/has/has/have2) an outdated autopsy report of the first fallen non-group tribute this season.
Tributes: 2
Edit |
Remove#428. (Player1) (dislikes/dislikes/dislikes/dislikes/dislike1) everyone else more than [typeA1] (dislikes/dislikes/dislike/dislikes/dislike1) (Player2) and (Player3), and (thinks/thinks/thinks/thinks/think1) (Player2) and (Player3) mistake that for friendship.
Tributes: 3
Edit |
Remove#429. (Player1) (saves/saves/saves/saves/save1) the life of a monster.
Tributes: 1
Edit |
Remove#430. (Player1) (finds/finds/finds/finds/find1) Dove in a soapless place.
Tributes: 1
Edit |
Remove#431. (Player1) (gains/gains/gains/gains/gain1) the power to breathe underwater, and (uses/uses/uses/uses/use1) that power to explore an underwater kingdom.
Tributes: 1
Edit |
Remove#432. "Let's get down to business to defeat (Player1)," (Player2) (says/says/says/says/say2) to (Player3), (Player4), (Player5), and (Player6).
Tributes: 6
Edit |
Remove#433. (Player1) and (Player2) decide to make a Christmas tree together.
Tributes: 2
Edit |
Remove#434. (Player1) (is/is/is/is/are1) trending on Twitter right now.
Tributes: 1
Edit |
Remove#435. (Player1) (talks/talks/talk/talks/talk1) about how [typeA1] once participated in something called the Great Caterpillar War to (Player2).
Tributes: 2
Edit |
Remove#436. (Player1) would have successfully killed (Player2) if alternate universe versions of (Player2) didn't come in to save [typeB2].
Tributes: 2
Edit |
Remove#437. "Why do donuts have to die?" (Player1) (asks/asks/asks/asks/ask1) to (Player2) who (gets/gets/gets/gets/get2) very confused by that question.
Tributes: 2
Edit |
Remove#438. "There once was a ship that sank," (Player1) (says/says/says/says/say1) to (Player2) as the former (tells/tells/tells/tells/tell1) the latter a story about the Titanic.
Tributes: 2
Edit |
Remove#439. (Player1) (transforms/transforms/transforms/transforms/transform1) into (a merman/a mermaid/a merperson/a merobject/merpeople1).
Tributes: 1
Edit |
Remove#440. (Player1) (tries/tries/tries/tries/try1) to sell a coffin to (Player2) just in case [typeA2] (dies/dies/die/dies/die2) within this deadly game.
Tributes: 2
Edit |
Remove#441. (Player1) and (Player2) try to wake up (Player3), but [typeA3] just (wouldn't/wouldn't/won't/wouldn't/won't3) wake up.
Tributes: 3
Edit |
Remove#442. (Player1) (eats/eats/eats/eats/eat1) an egg-shaped fungus.
Tributes: 1
Edit |
Remove#443. (Player1) (blows/blows/blows/blows/blow1) a balloon using an assault rifle.
Tributes: 1
Edit |
Remove#444. (Player1) (squirts/squirts/squirts/squirts/squirt1) goo from an assault rifle, disgusting (Player2).
Tributes: 2
Edit |
Remove#445. (Player1) and (Player2) play russian roulette, but with a toy gun and a balloon.
Tributes: 2
Edit |
Remove#446. Guess who's back. Back again. (Player1)(’s/’s/’s/’s/’re1) back. Tell your friends.
Tributes: 1
Edit |
Remove#447. (Player1) (gawk/gawk/gawk/gawk/gawks1) at (Player2)'s incorrectly formatted event.
Tributes: 2
Edit |
Remove#448. You know (Player1) had to do it to ‘em.
Tributes: 1
Edit |
Remove#449. (Player1) (invents/invents/invents/invents/invent1) a new fighting style called "(Player1)-Fu".
Tributes: 1
Edit |
Remove#450. (Player1) (learns/learns/learns/learns/learn1) that [typeA1] (is/is/are/is/are1) (a being/a being/a being/a being/beings1) created from (Player2)'s suppressed emotions.
Tributes: 2
Edit |
Remove#451. (Player1) (asks/asks/asks/asks/ask1) (Player2) what is the total mass of the sun. (Player2) (answers/answers/answers/answers/answer2) with "As (Player3) told (me/me/me/me/us2), it's three!".
Tributes: 3
Edit |
Remove#452. (Player1) (finds/finds/finds/finds/find1) out that [typeC1] gaming (account/account/account/account/accounts1) (is/is/is/is/are1) being hacked, and (lets/lets/lets/lets/let1) out (a hellish screech/a hellish screech/a hellish screech/a hellish screech/hellish screeches1) as a result.
Tributes: 1
Edit |
Remove#453. (Player1) (tells/tells/tells/tells/tell1) (Player2) that [typeA1] (wants/wants/want/wants/want1) to ask [typeB2] a personal question: "Have you ever seen (Player3)'s source material?"
Tributes: 3
Edit |
Remove#454. (Player1) (confesses/confesses/confesses/confesses/confess1) to (Player2) that [typeA1] can't actually read, and just likes looking at the pictures.
Tributes: 2
Edit |
Remove#455. As [typeA1] (rides/rides/ride/rides/ride1) toward the castle, (Player1) (gets/gets/gets/gets/get1) jousted and knocked off [typeC1] horse.
Tributes: 1
Edit |
Remove#456. (Player1) (says/says/says/says/say1) "Bloody Tom" four times in the mirror. Tom looks at (Player1) and ignores [typeB1].
Tributes: 1
Edit |
Remove#457. (Player1) (says/says/says/says/say1) "Bloody Tom" four times in the mirror. Tom escapes from the mirror, running right by [typeB1].
Tributes: 1
Edit |
Remove#458. (Player1) (says/says/says/says/say1) "Bloody Tom" four times in the mirror. Tom smashes his gumball head against [typeB1], severely wounding [typeB1].
Tributes: 1
Edit |
Remove#459. (Player1) can tell that (Player2) (is/is/is/is/are2) standing right behind [typeB1]. [TypeA1] overreact(s/s//s/1), tear(s/s//s/1) (Player2)'s eyes from [typeC2] head, and throw(s/s//s/1) them into the forest.
Tributes: 2
Edit |
Remove#460. (Player1) can tell that (Player2) (is/is/is/is/are2) standing right behind [typeB1]. [TypeA1] overreact(s/s//s/1), tear(s/s//s/1) [typeC1] eyes from [typeC1] own head, and throw(s/s//s/1) them into the forest.
Tributes: 2
Edit |
Remove#461. (Player1) (gives/gives/gives/gives/give1) (Player2) a coupon for new parents, but it is expired.
Tributes: 2
Edit |
Remove#462. (Player1) (yanks/yanks/yanks/yanks/yank1) (Player2)'s hair.
Tributes: 2
Edit |
Remove#463. (Player1) and (Player2) have a picnic together.
Tributes: 2
Edit |
Remove#464. (Player1) (gives/gives/gives/gives/give1) (Player2) (a wedgie/a wedgie/a wedgie/a wedgie/wedgies2).
Tributes: 2
Edit |
Remove#465. (Player1) (smokes/smokes/smokes/smokes/smoke1) (a cigarette/a cigarette/a cigarette/a cigarette/cigarettes1).
Tributes: 1
Edit |
Remove#466. (Player1) (needs/needs/needs/needs/need1) a freaking drink.
Tributes: 1
Edit |
Remove#467. (Player1) (does/does/does/does/do1) a comedy routine, with (Player2), (Player3), (Player4), (Player5), and (Player6) as the audience.
Tributes: 6
Edit |
Remove#468. (Player1) (announces/announces/announces/announces/announce1) to (Player2), (Player3), (Player4), and (Player5) that (Player6) (has/has/has/has/have6) (a rash/a rash/a rash/a rash/rashes6) in (a very embarrassing place/a very embarrassing place/a very embarrassing place/a very embarrassing place/very embarrassing places6).
Tributes: 6
Edit |
Remove#469. (Player1) (discovers/discovers/discovers/discovers/discover1) that [typeA1] can shapeshift.
Tributes: 1
Edit |
Remove#470. (Player1) accidentally (covers/covers/covers/covers/cover1) the lens while taking a picture of (Player2).
Tributes: 2
Edit |
Remove#471. (Player1) deliberately (covers/covers/covers/covers/cover1) the lens while taking a picture of (Player2).
Tributes: 2
Edit |
Remove#472. (Player1) (reads/reads/reads/reads/read1) aloud [typeC1] shipfic about (Player2) and (Player3) to (Player4) and (Player5), who were forced to listen to it.
Tributes: 5
Edit |
Remove#473. After getting into a heated argument, (Player1) and (Player2) agree not to speak to each other again.
Tributes: 2
Edit |
Remove#474. (Player1) (wishes/wishes/wishes/wishes/wish1) that (Player2) (was/was/was/was/were2) dead.
Tributes: 2
Edit |
Remove#475. (Player1) (tries/tries/tries/tries/try1) calling (Player2) with [typeC1] cellphone. All [typeA1] could hear are barking noises.
Tributes: 2
Edit |
Remove#476. (Player1) (questions/questions/questions/questions/question1) how (Player2) and (Player3) are still friends.
Tributes: 3
Edit |
Remove#477. (Player1) (calls/calls/calls/calls/call1) out (Player2) for not laughing at [typeC1] knock knock joke, saying it's the most basic of jokes. (Player2) (says/says/says/says/say2) that (Player1) (is/is/is/is/are1) the most basic of jokes.
Tributes: 2
Edit |
Remove#478. (Player1) (says/says/says/says/say1) that (Player2) (looks/looks/looks/looks/look2) like (a corpse/a corpse/a corpse/a corpse/corpses2) that (was/was/was/was/were2) just pulled out of a river. (Player2) (claims/claims/claims/claims/claim2) that [typeA2] (looks/looks/look/looks/look1) like (a cool rock star/a cool rock star/a cool rock star/a cool rock star/cool rock stars2) who just OD'd in [typeC2] own pool, and that there's a big difference between the two.
Tributes: 2
Edit |
Remove#479. (Player1) (faces/faces/faces/faces/face1) a terrifying amalgam of all of [typeC1] nominator's past tributes! [TypeA1] (flees/flees/flee/flees/flee1) in terror.
Tributes: 1
Edit |
Remove#480. (Player1) (faces/faces/faces/faces/face1) a terrifying amalgam of all of [typeC1] nominator's past tributes! [TypeA1] (manages/manages/manage/manages/manage1) to destroy it, somehow.
Tributes: 1
Edit |
Remove#481. To demonstrate the power of FlexSeal, (Player1) (saws/saws/saws/saws/saw1) (Player2) in half. The FlexSeal manages to hold (Player2) together for the rest of the season.
Tributes: 2
Edit |
Remove#482. (Player1) (unmasks/unmasks/unmasks/unmasks/unmask1) (Player2), revealing [typeC2] true identity! ... It's just (Player2) again???
Tributes: 2
Edit |
Remove#483. (Player1), (Player2), (Player3), and (Player4) die in a big fight, but (Player5) (throws/throws/throws/throws/throw5) a random object into the sky and (shouts/shouts/shouts/shouts/shout5) the name of [typeC5] source material, resurrecting them all with magic bugs.
Tributes: 5
Edit |
Remove#484. (Player1) (puts/puts/puts/puts/put1) (Player2), (Player3), (Player4), (Player5), and (Player6) on the points of a pentacle in an attempt to summon (Player7).
Tributes: 7
Edit |
Remove#485. (Player1) (hears/hears/hears/hears/hear1) it's amazing when the famous purple stuffed worm in flap-jaw space with the tuning fork does a raw blink on Hari Kiri Rock. (Player1) (needs/needs/needs/needs/need1) scissors! 61!
Tributes: 1
Edit |
Remove#486. (Player1) (references/references/references/references/reference1) That Thing You Like.
Tributes: 1
Edit |
Remove#487. (Player1) (references/references/references/references/reference1) Some Thing You've Never Heard Of.
Tributes: 1
Edit |
Remove#488. (Player1) (goes/goes/goes/goes/go1) meta and (references/references/references/references/reference1) the fact of referencing itself.
Tributes: 1
Edit |
Remove#489. "(Player1) (unleashes/unleashes/unleashes/unleashes/unleash1) a powerful attack, obliterating (Player2)!" (Player3) (narrates/narrates/narrates/narrates/narrate3) as [typeA3] (plays/plays/play/plays/play3) with [typeC3] (Player1) and (Player2) dolls.
Tributes: 3
Edit |
Remove#490. Look at (Player1)! [TypeA1]'(s/s/re/s/re1) (a/a/a/a/some1) cat(boy/girl/person/object/folk1)! Nya nya nya!
Tributes: 1
Edit |
Remove#491. (Player1) (rates/rates/rates/rates/rate1) (Player2): 8/10 too much (Player3).
Tributes: 3
Edit |
Remove#492. As a specimen, yes, (Player1) (is/is/is/is/are1) intimidating!
Tributes: 1
Edit |
Remove#493. (Player1) (surrounds/surrounds/surrounds/surrounds/surround1) [typeD1] with [typeC1] Z-Power! (Player1) (unleashs/unleashs/unleashs/unleashs/unleash1) [typeC1] full-force Z-Move! (Player1)'s Attack increased! (Player1)'s Defense increased! (Player1)'s Special Attack increased! (Player1)'s Special Defense increased! (Player1)'s Speed increased!
Tributes: 1
Edit |
Remove#494. (Player1) (surrounds/surrounds/surrounds/surrounds/surround1) [typeD1] with [typeC1] Z-Power! (Player1) (unleashes/unleashes/unleashes/unleashes/unleash1) [typeC1] full-force Z-Move! But it failed!
Tributes: 1
Edit |
Remove#495. (Player1) with [typeC1] crazy explanations, (Player2) (is/is/is/is/are2) gonna need [typeC2] medication, when [typeA2] (hears/hears/hear/hears/hear2) (Player1)'s lame exaggerations there'll be trouble in town tonight~!
Tributes: 2
Edit |
Remove#496. (Player1) would have been killed by (Player2) just then, but [typeA1] (has/has/have/has/have1) been cursed by god and [typeC1] work is never finished.
Tributes: 2
Edit |
Remove#497. Years ago, (Player1) and (Player2) went down alleyways. This technique was called a walk.
Tributes: 2
Edit |
Remove#498. (Player1) (coins/coins/coins/coins/coin1) a new word for [typeC1] conlang that means "change a creative work and unintentionally make it worse."
Tributes: 1
Edit |
Remove#499. (Player1): "My blood! (Player2) punched out ALL MY BLOOD!" Somehow [typeA1] (survives/survives/survive/survives/survive1) this.
Tributes: 2
Edit |
Remove#500. (Player1) rate(s/s/s/s/1) a film (Player2) just made. [TypeA1] (gives/gives/give/gives/give1) it a negative review. RottenTomatoes erroneously categorizes it as "Fresh".
Tributes: 2
Edit |
Remove#501. "Alas, poor tribute. (I/I/I/I/We1) knew them well," say(s/s/s/s/1) (Player1) as [typeA1] (cradles/cradles/cradle/cradles/cradle1) their skull(s) in [typeC1] hands.
Tributes: 1
Edit |
Remove#502. (Player1) find(s/s/s/s/1) a curious starry altar, but do(es/es/es/es/1)n't know how to operate it.
Tributes: 1
Edit |
Remove#503. (Player1) find(s/s/s/s/1) a curious starry altar, and use(s/s/s/s/1) a starshard on it to massively empower [typeC1] weapo(n/n/n/n/ns1).
Tributes: 1
Edit |
Remove#504. (Player1) find(s/s/s/s/1) a curious starry altar, and use(s/s/s/s/1) two starshards on it to transform [typeC1] old rusted kni(fe/fe/fe/fe/ves1) into (a /a /a /a /1)legendary weapo(n/n/n/n/ns1)!
Tributes: 1
Edit |
Remove#505. (Player1) Get The Banana
Tributes: 1
Edit |
Remove#506. (Player1)’(s/s/s/s/ve1) always been (a man/a woman/a person/a person/people1) of the [[PIPIS]]. (A r/A r/A r/A r/R1)eal [[PIPIS]] pe(rson/rson/rson/rson/ople1).
Tributes: 1
Edit |
Remove#507. (Player1) post(s/s/s/s/1) a meme in general, much to the chagrin of (Player2).
Tributes: 2
Edit |
Remove#508. (Player1) say(s/s/s/s/1) [typeA1] need(s/s//s/1) to go iron [typeC1] dog.
Tributes: 1
Edit |
Remove#509. (Player1) use(s/s/s/s/1) Judge. 2. Nothing special happens.
Tributes: 1
Edit |
Remove#510. (Player1) use(s/s/s/s/1) Judge. 3. (Player2) get(s/s/s/s/2) lightly slapped.
Tributes: 2
Edit |
Remove#511. (Player1) use(s/s/s/s/1) Judge. 4. (Player2) get(s/s/s/s/2) hurt somewhat.
Tributes: 2
Edit |
Remove#512. (Player1) use(s/s/s/s/1) Judge. 5. (Player2) get(s/s/s/s/2) a nonfatal electric shock.
Tributes: 2
Edit |
Remove#513. (Player1) use(s/s/s/s/1) Judge. 6. (Player2) get(s/s/s/s/2) lit on fire, but [typeA2] manage(s/s//s/2) to put it out.
Tributes: 2
Edit |
Remove#514. (Player1) use(s/s/s/s/1) Judge. 7. (Player2) get(s/s/s/s/2) hit, and 3 apples spontaneously appear.
Tributes: 2
Edit |
Remove#515. (Player1) use(s/s/s/s/1) Judge. 8. (Player2) get(s/s/s/s/2) temporarily frozen solid.
Tributes: 2
Edit |
Remove#516. (Player1) and (Player2) have a staring contest that lasts for 18 hours straight.
Tributes: 2
Edit |
Remove#517. (Player1) program(s/s/s/s/1) Metroid for the Nintendo Entertainment System on duct tape.
Tributes: 1
Edit |
Remove#518. (Player1) (is/is/are/is/are1) with us. Laughing at us.
Tributes: 1
Edit |
Remove#519. (Player1)'(s/s/s/s/re1) firin' [typeC1] lazar. BWAAAAH.
Tributes: 1
Edit |
Remove#520. (Player1)'(s/s/s/s/re1) firin' [typeC1] lazar at (Player2). BWAAAAH. [TypeA2] dodge(s/s//s/2) and survive(s/s//s/2).
Tributes: 2
Edit |
Remove#521. (Player1) read(s/s/s/s/1) "Ready (Player1)."
Tributes: 1
Edit |
Remove#522. (Player1) recall(s/s/s/s/1) the massacre last game.
Tributes: 1
Edit |
Remove#523. (Player1) (builds/builds/builds/builds/build1) a wall around [typeC1] camp.
Tributes: 1
Edit |
Remove#524. (Player1) and (Player2) race each other to the tallest tree. (Player1) (wins/wins/wins/wins/win1).
Tributes: 2
Edit |
Remove#525. (Player1) and (Player2) meditate together.
Tributes: 2
Edit |
Remove#526. (Player1) (pushes/pushes/pushes/pushes/push1) (Player2) into a mud puddle.
Tributes: 2
Edit |
Remove#527. (Player1) and (Player2) have coffee together.
Tributes: 2
Edit |
Remove#528. (Player1) (wakes/wakes/wakes/wakes/wake1) up (Player2) by splashing [typeC2] (head/head/head/head/heads2) with cold water.
Tributes: 2
Edit |
Remove#529. (Player1) (gives/gives/gives/gives/give1) a motivational speech to (Player2), (Player3), (Player4), (Player5), and (Player6).
Tributes: 6
Edit |
Remove#530. (Player1) (does/does/does/does/do1) a perimeter check around [typeC1] camp.
Tributes: 1
Edit |
Remove#531. (Player1) (loses/loses/loses/loses/lose1) [typeC1] (phone/phone/phone/phone/phones1).
Tributes: 1
Edit |
Remove#532. (Player1) (finds/finds/finds/finds/find1) (Player2)'s missing (phone/phone/phone/phone/phones2) and reads (its/its/its/its/their2) contents.
Tributes: 2
Edit |
Remove#533. (Player1) (finds/finds/finds/finds/find1) (Player2)'s missing (phone/phone/phone/phone/phones2) and reads (its/its/its/its/their2) contents before deleting them.
Tributes: 2
Edit |
Remove#534. (Player1) (finds/finds/finds/finds/find1) (Player2)'s missing (phone/phone/phone/phone/phones2) and (returns/returns/returns/returns/return1) (it/it/it/it/them2) to [typeB2].
Tributes: 2
Edit |
Remove#535. (Player1) (calls/calls/calls/calls/call1) out to (Player2), "(Player3), are you there? It's (me/me/me/me/us1), your best (friend/friend/friend/friend/friends1)!" before transforming into (a more powerful form/a more powerful form/a more powerful form/a more powerful form/more powerful forms1)."
Tributes: 3
Edit |
Remove#536. (Player1) can't pronounce (Player2)'s (name/name/name/name/names2) right, much to the latter's annoyance.
Tributes: 2
Edit |
Remove#537. (Player1) can't spell (Player2)'s (name/name/name/name/names2) right, much to the latter's annoyance.
Tributes: 2
Edit |
Remove#538. (Player1), (Player2), (Player3), and (Player4) form a biker gang.
Tributes: 4
Edit |
Remove#539. (Player1) (warns/warns/warns/warns/warn1) (Player2) and (Player3) that [typeC1] troops will thrash them if they go that way. (Player3) (wonders/wonders/wonders/wonders/wonder3) if that's a threat, but (Player1) (likes/likes/likes/likes/like1) to think of it as an invitation.
Tributes: 3
Edit |
Remove#540. (Player1) and (Player2) tell (Player3) that "hakuna matata"'s their motto. (Player3) (asks/asks/asks/asks/ask3) what it is, but (Player1) (says/says/says/says/say1), "Nuthin'. What's a motto with you?"
Tributes: 3
Edit |
Remove#541. (Player1), (Player2), and (Player3) step aside when (Player4), (Player5), and (Player6) fight a monster. After they defeat it, (Player3) briefly (turns/turns/turns/turns/turn3) into (Player6) when they regroup.
Tributes: 6
Edit |
Remove#542. (Player1) can't decide whether to call (Player2) to rescue (Player3) from inside a claw machine or take (a picture/a picture/a picture/a picture/pictures1) of [typeB3]. (Player1) (calls/calls/calls/calls/call1) (Player2).
Tributes: 3
Edit |
Remove#543. (Player1) (selects/selects/selects/selects/select1) pipes and piping materials.
Tributes: 1
Edit |
Remove#544. (Player1) (is/is/is/is/are1) very disgusted with the trashy (Player2).
Tributes: 2
Edit |
Remove#545. (Player1) (puts/puts/puts/puts/put1) (Player2)'s source material through several layers of Google Translate.
Tributes: 2
Edit |
Remove#546. (Player1) (uses/uses/uses/uses/use1) (a/a/a/a/1) pocket watc(h/h/h/h/hes1) to steal time.
Tributes: 1
Edit |
Remove#547. (Player1) (borrows/borrows/borrows/borrows/borrow1) (Player2)'s (car/car/car/car/cars2) for the day without telling [typeB2], and (Player2) freaks out when realizing [typeC2] car is missing.
Tributes: 2
Edit |
Remove#548. (Player1) and (Player2) go camping, but after setting up the tent, (Player2) (sees/sees/sees/sees/see2) (Player1)'s (face/face/face/face/faces1) on the wall when opening the door.
Tributes: 2
Edit |
Remove#549. (Player1) (asks/asks/asks/asks/ask1) to borrow (Player2)'s CD player, and (uses/uses/uses/uses/use1) it to play a CD labeled "Do Not Disturb".
Tributes: 2
Edit |
Remove#550. (Player1) (fights/fights/fights/fights/fight1) (Player2) in a fast-food restaurant, and (beats/beats/beats/beats/beat2) [typeB2] up before leaving with [typeC2] food.
Tributes: 2
Edit |
Remove#551. (Player1) (cosplays/cosplays/cosplays/cosplays/cosplay1) as (Player2).
Tributes: 2
Edit |
Remove#552. (Player1) drink(s/s/s/s/1) a kettle of boiling water and punch(es/es/es/es/1) out (Player2).
Tributes: 2
Edit |
Remove#553. (Player1) search(es/es/es/es/1) for fanart of [typeD1] and approve(s/s/s/s/1) of what [typeA1] sees.
Tributes: 1
Edit |
Remove#554. As (Player1) attack(s/s/s/s/1) (Player2), (Player2) pull(s/s/s/s/1) out an Uno Reverse card to reflect the attac(k/k/k/k/ks1) back at [typeB1].
Tributes: 2
Edit |
Remove#555. As (Player1) insult(s/s/s/s/1) (Player2), (Player2) pull(s/s/s/s/1) out an Uno Reverse card to reflect the insul(t/t/t/t/ts1) back at [typeB1].
Tributes: 2
Edit |
Remove#556. After stealing from (Player1)'s shop, (Player2) (is/is/is/is/are2) only known as "(THIEF/THIEF/THIEF/THIEF/THIEVES1)".
Tributes: 2
Edit |
Remove#557. (Player1) practise(s/s/s/s/1) a new language by tattooing random words and phrases onto [typeD1].
Tributes: 1
Edit |
Remove#558. Spooky scary skeletons send shivers down (Player1)'s (spine/spine/spine/spine/spines1).
Tributes: 1
Edit |
Remove#559. (Player1) chase(s/s/s/s/1) (Player2) with (a/a/a/a/1) burning stic(k/k/k/k/ks1), but (Player2) put(s/s/s/s/2) (it/it/it/it/them1) out by throwing sand at (it/it/it/it/them1).
Tributes: 2
Edit |
Remove#560. (Player1), (Player2), (Player3), (Player4) and (Player5) break into an abandoned building and spraypaint memes on the walls.
Tributes: 5
Edit |
Remove#561. (Player1) disguise(s/s/s/s/1) as (Player2) after capturing [typeB2], but (Player3) realize(s/s/s/s/3) "(Player2)" (is an/is an/is an/is an/are1) imposto(r/r/r/r/rs1) upon seeing [typeB1] drink something (Player2) hate(s/s/s/s/2), and threaten(s/s/s/s/3) [typeB1] to make [typeB1] show where the real (Player2) is.
Tributes: 3
Edit |
Remove#562. (Player1) can not fuck up for this.
Tributes: 1
Edit |
Remove#563. (Player1) mail(s/s/s/s/1) [typeD1] to (Player2) via email attachment.
Tributes: 2
Edit |
Remove#564. (Player1) step(s/s/s/s/1) on (a/a/a/a/1) Leg(o/o/o/o/os1).
Tributes: 1
Edit |
Remove#565. (Player1) run(s/s/s/s/1) towards (Player2) to hug [typeB2], but (Player2) move(s/s/s/s/2) out of the way and (Player1) crash(es/es/es/es/1) into a tree.
Tributes: 2
Edit |
Remove#566. (Player1) come(s/s/s/s/1) across a bootleg toy of [typeD1]. [TypeA1] find(s/s/s/s/1) it hilarious.
Tributes: 1
Edit |
Remove#567. (Player1) come(s/s/s/s/1) across a bootleg toy of [typeD1]. [TypeA1] find(s/s/s/s/1) it insulting.
Tributes: 1
Edit |
Remove#568. (Player1) hang(s/s/s/s/1) up a poster saying "Friendship ended with (Player2), now (Player3) (is/is/is/is/are3) my best frien(d/d/d/d/ds3)".
Tributes: 3
Edit |
Remove#569. (Player1) (subjects/subjects/subjects/subjects/subject1) President Snow to a random fatal event.
Tributes: 1
Edit |
Remove#570. (Player1) (gets/gets/gets/gets/get1) hired to assassinate President Snow in which [typeA1] (succeeds/succeeds/succeed/succeeds/succeed1) in doing so.
Tributes: 1
Edit |
Remove#571. (Player1) (gets/gets/gets/gets/get1) hired to assassinate President Snow in which [typeA1] (fails/fails/fail/fails/fail1) in doing so.
Tributes: 1
Edit |
Remove#572. (Player1) (sings/sings/sings/sings/sing1) about how money is good in front of (a very/a very/a very/a very/very2) confused (Player2).
Tributes: 2
Edit |
Remove#573. (Player1) mistakenly (thinks/thinks/thinks/thinks/think1) (Player2) (is/is/is/is/are2) actually the pet (animal/animal/animal/animal/animals2) of (Player1) reincarnated as a different species.
Tributes: 2
Edit |
Remove#574. (Player1) (tries/tries/tries/tries/try1) to buy (a plane ticket/a plane ticket/a plane ticket/a plane ticket/plane tickets1) to Havana, but accidentally (buys/buys/buys/buys/buy1) (a plane ticket/a plane ticket/a plane ticket/a plane ticket/plane tickets1) to Hawaii instead.
Tributes: 1
Edit |
Remove#575. Now that (Player1) (has/has/has/has/have1) the power, this is [typeC1] finest hour. Nothing on this Earth can stop [typeB1] now!
Tributes: 1
Edit |
Remove#576. (Player1) (runs/runs/runs/runs/run1) the above event through several layers of Google Translate.
Tributes: 1
Edit |
Remove#577. (Player1) (runs/runs/runs/runs/run1) the below event through several layers of Google Translate.
Tributes: 1
Edit |
Remove#578. (Player1) (turns/turns/turns/turns/turn1) (Player2) into (a sentient/a sentient/a sentient/a sentient/sentient2) action (figure/figure/figure/figure/figures2).
Tributes: 2
Edit |
Remove#579. While performing a play with (Player1), (Player2), (Player3), (Player4), and (Player5), (Player6) (keeps/keeps/keeps/keeps/keep6) on messing up [typeC6] lines.
Tributes: 6
Edit |
Remove#580. (Player1) (cries/cries/cries/cries/cries/cry1) about how [typeA1] can't hug every cat in the world.
Tributes: 1
Edit |
Remove#581. (Player1) (believes/believes/believes/believes/believe1) this HGS season is canon within [typeC1] own source material.
Tributes: 1
Edit |
Remove#582. (Player1) (believes/believes/believes/believes/believe1) this HGS season is canon within the source material of (Player2).
Tributes: 2
Edit |
Remove#583. (Player1) wrongly (accuses/accuses/accuses/accuses/accuse1) (Player2) of stealing a cow.
Tributes: 2
Edit |
Remove#584. "(I/I/I/I/We1) don't like your plan; it sucks," (Player1) (say/says/says/says/say1) to (Player2) after the latter (comes/comes/comes/comes/come1) up with a plan to kill (Player3).
Tributes: 3
Edit |
Remove#585. (Player1) (tries//tries/tries/tries/try1) to make an invisibility potion in order to spy on (Player2) and (Player3) only for (Player1) to epically fail at making the potion.
Tributes: 3
Edit |
Remove#586. (Player1) (finds/finds/finds/finds/find1) out that [typeC1] (purpose/purpose/purpose/purpose/purposes1) in life is to prevent the apocalypse.
Tributes: 1
Edit |
Remove#587. (Player1) (finds/finds/finds/finds/find1) out that [typeC1] (purpose/purpose/purpose/purpose/purposes1) in life is to start the apocalypse.
Tributes: 1
Edit |
Remove#588. (Player1) (finds/finds/finds/finds/find1) a book that lists every HGS tribute's fate for this season & all future ones. Though, it's in another language (Player1) (doesn't/doesn't/doesn't/doesn't/don't1) know.
Tributes: 1
Edit |
Remove#589. (Player1), (Player2), (Player3), and (Player4) discover a gem that gives those who touch it Kung-fu powers. They use it to evict (Player5) out of [typeC5] camp.
Tributes: 5
Edit |
Remove#590. While searching for food, (Player1) find(s/s/s/s/1) a box of chocolate powder. [TypeA1] mix(es/es/es/es/1) it with coconut milk and find(s/s/s/s/1) it delicious.
Tributes: 1
Edit |
Remove#591. (Player1) use(s/s/s/s/1) a crab to cut open coconuts.
Tributes: 1
Edit |
Remove#592. (Player1), (Player2), (Player3), and (Player4) discover a joystick-like object that can control a giant crab in a hidden cave. (Player1) steal(s/s/s/s/1) it and drive(s/s/s/s/1) away with the crab.
Tributes: 4
Edit |
Remove#593. A meteor with the ability to attract metallic objects crashes near (Player1)'s camp. (Player2), (Player3), and (Player4) use it to play sled.
Tributes: 4
Edit |
Remove#594. An ice cube with a frozen creature inside breaks from a glacier and lands near (Player1), (Player2), and (Player3). They thaw it to reveal a prehistoric raccoon who quickly grew attached to them.
Tributes: 3
Edit |
Remove#595. Start the new rescue helicopter! Hey! Build the helicopter and off to the rescue. Prepare the lifeline, lower the stretcher, and make the rescue, (Player1).
Tributes: 1
Edit |
Remove#596. (Player1) get(s/s/s/s/1) (one/one/one/one/each one1) of [typeC1] eyes slashed by (Player2). (Player3) then tr(ies/ies/ies/ies/y3) to save [typeB1] and (Player4) as (Player2) collapse(s/s/s/s/2) the cave they are in. [TypeA3] (is/is/is/is/are3) able to save them, but half of [typeC3] bod(y/y/y/y/ies3) get(s/s/s/s/3) crushed under a large boulder. (Player5) soon save(s/s/s/s/5) [typeB3] and augment(s/s/s/s/3) [typeC3] bod(y/y/y/y/ies3), unbeknownst to (Player1), (Player2), and (Player4).
Tributes: 5
Edit |
Remove#597. (Player1) read(s/s/s/s/1) (Player2)'s diar(y/y/y/y/ies2), causing [typeB1] to be shunned by everyone, having [typeC1] camp be repossessed, and punished by being put on (a/a/a/a/1) pillor(y/y/y/y/ies1) while having tomatoes thrown at [typeB1] by every tribute except (Player2).
Tributes: 2
Edit |
Remove#598. (Player1) get(s/s/s/s/1) eaten by a monster from the land of the dead, causing a large antimatter explosion. However, [typeA1] do(esn't/esn't/n't/esn't/n't1) die and eventually return(s/s/s/s/1) to the world of the living (aka the Arena).
Tributes: 1
Edit |
Remove#599. An alien tries to look at Earth using a telescope to find any intelligent lifeform. The alien then zooms on (Player1), who say(s/s/s/s/1) something stupid, causing the caption, "the search continues." to appear as the alien leaves.
Tributes: 1
Edit |
Remove#600. (Player1) order(s/s/s/s/1) (Player2) to crawl across a baseball field, which (Player1) refer(s/s/s/s/1) to as the "death" crawl. (Player2) then do(es/es/es/es/do2) it while (Player3) sit(s/s/s/s/3) above [typeB2], with (Player1) encouraging (Player2) to keep going as [typeA2] start(s/s/s/s/2) to get exhausted. (Player2) eventually succeed(s/s/s/s/2).
Tributes: 3
Edit |
Remove#601. (Player1) gain(s/s/s/s/1) the ability to temporarily transform into a dead tribute after absorbing their soul, which [typeA1] use(s/s//s/1) for killing. [TypeA1] then absorb(s/s/s/s/1) up to 7 souls of the latest deceased tributes and assume(s/s/s/s/1) their personae as a team of killers.
Tributes: 1
Edit |
Remove#602. (Player1) fall(s/s/s/s/1) into a world inside the TV and gain(s/s/s/s/1) (a/a/a/a/1) fighting spiri(t/t/t/t/ts1) after facing [typeC1] true sel(f/f/f/f/ves1).
Tributes: 1
Edit |
Remove#603. (Player1) end(s/s/s/s/1) up in a supernatural palace that represents (Player2)'s negative side and gain(s/s/s/s/1) (a/a/a/a/1) fighting spiri(t/t/t/t/ts1) after ripping (a/a/a/a/1) mas(k/k/k/k/ks1) from [typeC1] fac(e/e/e/e/es1).
Tributes: 2
Edit |
Remove#604. (Player1) pray(s/s/s/s/1) to RNG for luck.
Tributes: 1
Edit |
Remove#605. (Player1) displease(s/s/s/s/1) the RNG, who give(s/s/s/s/1) (Player1) bad luck.
Tributes: 1
Edit |
Remove#606. (Player1) and (Player2) get stuck on a wringer together after using superglue, but they manage to free themselves by crying.
Tributes: 2
Edit |
Remove#607. (Player1) wreck(s/s/s/s/1) a theme park.
Tributes: 1
Edit |
Remove#608. (Player1) gains a job, causing reality to become distorted because [typeA1]('s/'s/'re/'s/'re1) not supposed to be employed.
Tributes: 1
Edit |
Remove#609. (Player1), (Player2), (Player3), (Player4), and (Player5) get chased by a rampaging (Player6).
Tributes: 6
Edit |
Remove#610. (Player1) find(s/s/s/s/1) magical jewelry with (a/a/a/a/1) tiny creatur(e/e/e/e/es1) inside that transform(s/s/s/s/1) (Player1) to (a/a/a/a/1) superher(o/o/o/o/oes1).
Tributes: 1
Edit |
Remove#611. (Player1), (Player2), (Player3), and (Player4) play a magical board game-turned-video game that sucks them in and turns them into the game's avatars. They are eventually able to escape after completing the game.
Tributes: 4
Edit |
Remove#612. (Player1) ha(s/s/s/s/ve1) mutated.
Tributes: 1
Edit |
Remove#613. (Is/Is/Is/Is/Are1) (Player1) aware of (Player2)? Sure. (Is/Is/Is/Is/Are1) (Player1) aware of (Player2)? Sure. (Is/Is/Is/Is/Are1) (Player1) aware of (Player2)? Sure. (Is/Is/Is/Is/Are1) (Player1) aware of (Player2)? Sure.
Tributes: 2
Edit |
Remove#614. (Player1) find(s/s/s/s/1) [typeD1] in another part of the world, with a beautiful house and a beautiful spouse. And [typeA1] may ask [typeD1], "Well, how did I get here?"
Tributes: 1
Edit |
Remove#615. Now's (Player1)'s chance to be a [BIG SHOT].
Tributes: 1
Edit |
Remove#616. No no, (Player1) had to be a big shot, didn't [typeA1], had to open up [typeC1] mouth.
Tributes: 1
Edit |
Remove#617. (Player1) can't seem to face up to the facts. [TypeA1]'(s/s/re/s/re1) tense and nervous and [typeA1] can't relax. Can't sleep 'cause [typeC1] bed's on fire. Don't touch [typeB1], [typeA1]'(s/s/re/s/re1) a real live wire.
Tributes: 1
Edit |
Remove#618. (Player1) should stop being such a bus bipper. Whatever that means.
Tributes: 1
Edit |
Remove#619. (Player1) (is/is/is/is/are1) so fetch.
Tributes: 1
Edit |
Remove#620. (Player1) procrastinate(s/s/s/s/1) hard on writing [typeC1] essay and lose(s/s/s/s/1) sleep because of it.
Tributes: 1
Edit |
Remove#621. (Player1) accidentally hit(s/s/s/s/1) (Player2) in the eye. (Player2) fake-cr(ies/ies/ies/ies/y2) to coax (Player1) into giving [typeB2] money to support (Player3)’s business.
Tributes: 3
Edit |
Remove#622. (Player1), after getting stabbed, ask(s/s/s/s/1) what this red water is. [TypeA1]’(s/s/ve/s/ve1) never seen it before.
Tributes: 1
Edit |
Remove#623. (Player1) get(s/s/s/s/1) chased out of town for selling uncured salami on a Wednesday.
Tributes: 1
Edit |
Remove#624. (Player1) play(s/s/s/s/1) a licensed video game based on (Player2)’s source material.
Tributes: 2
Edit |
Remove#625. (Player1) find(s/s/s/s/1) (Player2)’s camp while [typeA2] (is/is/are/is/are2)n't there and take(s/s/s/s/1) a shit on [typeC2] computer.
Tributes: 2
Edit |
Remove#626. (Player1) hate(s/s/s/s/1) the RNG for what it made [typeB1] do earlier.
Tributes: 1
Edit |
Remove#627. (Player1) take(s/s/s/s/1) a few bites out of a piece of cake, before smashing it with (a/a/a/a/1) chai(r/r/r/r/rs1).
Tributes: 1
Edit |
Remove#628. As (Player1) slightly remove(s/s/s/s/1) a game cartridge from a console, (Player2) start(s/s/s/s/1) wildly spinning around on the ground.
Tributes: 2
Edit |
Remove#629. (Player1) fall(s/s/s/s/1) nonlethally onto (an/an/an/an/1) upright spik(e/e/e/e/es1) and get(s/s/s/s/1) (an/an/an/an/1) unreasonably high skill gai(n/n/n/n/ns1).
Tributes: 1
Edit |
Remove#630. (Player1) say(s/s/s/s/1) that [typeA1] is a monster... coach.
Tributes: 1
Edit |
Remove#631. (Player1) open(s/s/s/s/1) a cookie tin, only for it to be filled with sewing supplies.
Tributes: 1
Edit |
Remove#632. (Player1) open(s/s/s/s/1) a sewing kit, only for it to be filled with cookies.
Tributes: 1
Edit |
Remove#633. (Player1) go(es/es/es/es/1) to Hell to train and return(s/s/s/s/1) exhausted.
Tributes: 1
Edit |
Remove#634. (Player1) put(s/s/s/s/1) knockoff healing items that lower your health in (Player2)'s inventor(y/y/y/y/ies2). (Player2) doesn't fall for it.
Tributes: 2
Edit |
Remove#635. (Player1) put(s/s/s/s/1) knockoff healing items that lower your health in (Player2)'s inventor(y/y/y/y/ies2). (Player2) fall(s/s/s/s/1) for it.
Tributes: 2
Edit |
Remove#636. (Player1) (is/is/is/is/are1) sick of (Player2) and (Player3)'s arguing and (tells/tells/tells/tells/tell1) them to shut up once in a while so they won't get themselves killed over stupid things.
Tributes: 3
Edit |
Remove#637. (Player1) kick(s/s/s/s/1) open the door (Player2) (is/is/is/is/are2) standing in front of, sending [typeB2] flying across the room.
Tributes: 2
Edit |
Remove#638. (Player1) jump(s/s/s/s/1) into a painting on the wall, and later jump(s/s/s/s/1) out of the painting holding a star.
Tributes: 1
Edit |
Remove#639. (Player1) tr(ies/ies/ies/ies/y1) jumping into a painting on the wall, but end(s/s/s/s/1) up just crashing into the wall.
Tributes: 1
Edit |
Remove#640. (Player1) jump(s/s/s/s/1) into a painting on the wall, and later get(s/s/s/s/1) thrown out of the painting, all beaten up.
Tributes: 1
Edit |
Remove#641. (Player1) cover(s/s/s/s/1) the walls of [typeC1] cam(p/p/p/p/ps1) in bubble wrap.
Tributes: 1
Edit |
Remove#642. (Player1) run(s/s/s/s/1) up to (Player2) to fight [typeB2], but run(s/s/s/s/1) so fast [typeA1] ru(ns/ns/n/ns/n1) past [typeB2] and into an invisible wall before teleporting back.
Tributes: 2
Edit |
Remove#643. During their fight, (Player1) steal(s/s/s/s/1) (Player2)'s phon(e/e/e/e/es2) so [typeA2] can't access [typeC2] inventory ap(p/p/p/p/ps2).
Tributes: 2
Edit |
Remove#644. During (Player1)'s concert, (Player2), (Player3) and (Player4) beat (Player5) with glowsticks.
Tributes: 5
Edit |
Remove#645. (Player1) stab(s/s/s/s/1) (Player2) while [typeC2] bac(k is/k is/k is/k is/ks are2) turned, but (Player2) replaced [typeC1] kni(fe/fe/fe/fe/ves1) with (a/a/a/a/1) harmless prop kni(fe/fe/fe/fe/ves1) earlier.
Tributes: 2
Edit |
Remove#646. (Player1) put(s/s/s/s/1) together a jigsaw puzzle, but as [typeA1] (is/is/are/is/are1) about to finish it, [typeA1] notic(es/es/e/es/e1) one piece is missing.
Tributes: 1
Edit |
Remove#647. (Player1) steal(s/s/s/s/1) one of (Player2)'s jigsaw puzzle pieces when [typeA2] (isn't/isn't/aren't/isn't/aren't2) looking.
Tributes: 2
Edit |
Remove#648. (Player1) wonder(s/s/s/s/1) if anyone has really been far even as decided to use even go want to do look more like.
Tributes: 1
Edit |
Remove#649. (Player1) awaken(s/s/s/s/1) (a/a/a/a/1) magical ey(e/e/e/e/es each1) and gain(s/s/s/s/1) access to six special abilities. [TypeA1] then split(s/s//s/1) them into six clones of (his/hers/theirs/its/theirs1), each clone holding a specific ability.
Tributes: 1
Edit |
Remove#650. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) get drunk and play a horror game. (Player7) then (tries/tries/tries/tries/try7) to scare them off by transforming [typeD7] into the game's monster.
Tributes: 7
Edit |
Remove#651. As (Player1) (walks/walks/walks/walks/walk1) through the valley of the shadow of death, [typeA1] (takes/takes/take/takes/take1) a look at [typeC1] life and realize there's not much left, 'coz [typeA1]('s/'s/'ve/'s/'ve1) been blastin' and laughin' so long, that even [typeC1] mama thinks that [typeC1] mind is gone.
Tributes: 1
Edit |
Remove#652. (Player1) and (Player2) force (Player3) and (Player4), and (Player5) and (Player6) respectively to join an eating contest that is held in a restaurant, with the reward being free food for life. (Player1) even threaten(s/s/s/s/1) (Player3) and (Player4) with harm should they lose.
Tributes: 6
Edit |
Remove#653. (Player1) (pricks/pricks/pricks/pricks/prick1) [typeC1] (finger/finger/finger/finger/fingers1) on a fig tree while attending (Player2)'s deal-making class, causing a magical fig tree to sprout in front of (Player1)'s camp. (Player2) then (discovers/discovers/discovers/discovers/discover1) that it is tied to (Player1)'s life and each word (Player1) (speaks/speaks/speaks/speaks/speak1) will cause a leaf to fall off, meaning (Player1) will die if all the leaves are gone.
Tributes: 2
Edit |
Remove#654. As (Player1) (is/is/is/is/are1) about to be ground by a meat grinder thanks to (Player2), [typeA1] (says/says/say/says/say1), "Hey, (I/I/I/I/We1) ain't even gonna make (a tasty hamburger/a tasty hamburger/a tasty hamburger/a tasty hamburger/tasty hamburgers1)! (I/I/I/I/We1) only drink broccoli juic(e/e/e/e/es1)!"
Tributes: 2
Edit |
Remove#655. (Player1) make(s/s/s/s/1) (a/a/a/a/1) virtual natio(n/n/n/n/ns1) on a website.
Tributes: 1
Edit |
Remove#656. (Player1) bur(ies/ies/ies/ies/y1) [typeC1] hopes and dreams in a graveyard, with (a/a/a/a/1) headston(e/e/e/e/es1) marking (it/it/it/it/them1).
Tributes: 1
Edit |
Remove#657. (Player1) (is/is/is/is/are1) so skilled in making [typeC1] favorite food that everything [typeA1] coo(ks/ks/k/ks/k1) magically transforms into [typeC1] favorite food.
Tributes: 1
Edit |
Remove#658. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) do a sesame seed in a jar counting contest that (Player7) host(s/s/s/s/1). (Player6) win(s/s/s/s/1) and get(s/s/s/s/1) (a/a/a/a/1) burge(r/r/r/r/rs1).
Tributes: 7
Edit |
Remove#659. (Player1) get(s/s/s/s/1) dragged by [typeC1] own ca(r/r/r/r/rs1) that (Player2) (is/is/is/is/are2) stealing into clams, cheese graters, and educational radio. [TypeA1] survive(s/s/s/s/1).
Tributes: 2
Edit |
Remove#660. (Player1) and (Player2) are accused of stealing a pearl and get pelted with peanuts by every tribute, before (Player3) reveal(s/s/s/s/3) that it was (Player4) who did it.
Tributes: 4
Edit |
Remove#661. (Player1) discover(s/s/s/s/1) that [typeC1] camp is situated within an oil field. [TypeA1] then turn(s/s//s/1) the area around [typeC1] camp into an oil extraction place.
Tributes: 1
Edit |
Remove#662. (Player1) plan(s/s/s/s/1) to build a highway through the Arena to disadvantage (Player2), without regards to the enviroment.
Tributes: 2
Edit |
Remove#663. (Player1) argue(s/s/s/s/1) with (Player2) after the former complain(s/s/s/s/1) about the latter's haircut to [typeB1]. (Player2) then punch(es/es/es/es/2) (Player1) while still holding (a/a/a/a/2) razo(r/r/r/r/rs2), which accidentally slash(es/es/es/es/2) (Player1)'s throa(t/t/t/t/ts1). Fortunately, (Player1) get(s/s/s/s/1) taken to a hospital on time.
Tributes: 2
Edit |
Remove#664. (Player1)'s ca(r/r/r/r/rs1) explode(s/s/s/s/1) after (Player2) accidentally strike(s/s/s/s/2) (a/a/a/a/2) golf bal(l/l/l/l/ls2) into the exhaus(t/t/t/t/ts1).
Tributes: 2
Edit |
Remove#665. (Player1)'s ca(r/r/r/r/rs1) get(s/s/s/s/1) crushed by a passing tank while (Player1) (is/is/is/is/are1) eating (a/a/a/a/1) cupcak(e/e/e/e/es1).
Tributes: 1
Edit |
Remove#666. (Player1) paint(s/s/s/s/1) [typeC1] camp using a paint can and a dynamite, as well as covering objects with newspapers to prevent them from being stained.
Tributes: 1
Edit |
Remove#667. (Player1) give(s/s/s/s/1) (Player2) (a/a/a/a/2) giant pil(l/l/l/l/ls2) that (Player2) (is/is/is/is/are2) forced to swallow. (Player2) (is/is/is/is/are2) somehow able to do so.
Tributes: 2
Edit |
Remove#668. (Player1) order(s/s/s/s/1) (Player2) and (Player3) to paint [typeC1] camp. [TypeA1] then threaten(s/s/s/s/1) to cut off both of their butts and hang(s/s/s/s/1) them on [typeC1] fireplace should they fail.
Tributes: 3
Edit |
Remove#669. (Player1) fire(s/s/s/s/1) a literal missile toe and a literal missile fist on (Player2), but they miss.
Tributes: 2
Edit |
Remove#670. (Player1) and (Player2) make (a/a/a/a/3) nasty patt(y/y/y/y/ies3) to succesfully knock out (Player3).
Tributes: 3
Edit |
Remove#671. (Player1) and (Player2) make (a/a/a/a/3) nasty patt(y/y/y/y/ies3) to knock out (Player3), but (it/it/it/it/they3) fail(s/s/s/s/3).
Tributes: 3
Edit |
Remove#672. (Player1) (wakes/wakes/wakes/wakes/wake1) up (Player2) by crashing (a pair of cymbals/a pair of cymbals/a pair of cymbals/a pair of cymbals/cymbals1) near [typeC2] ears.
Tributes: 2
Edit |
Remove#673. (Player1), (Player2), and (Player3) have a battle of the bands against (Player4), (Player5), and (Player6).
Tributes: 6
Edit |
Remove#674. (Player1) and (Player2) have a romantic spaghetti dinner.
Tributes: 2
Edit |
Remove#675. (Player1) (bursts/bursts/bursts/bursts/burst1) into (Player2)'s camp, saying, "yer (a wizard/a witch/a mage/a mage/mages2), (Player2)." (Player2) (replies/replies/replies/replies/reply2), "(I'm a/I'm a/I'm a/I'm a/We are2) what?"
Tributes: 2
Edit |
Remove#676. (Player1) (gives/gives/gives/gives/give1) (Player2) (a noogie/a noogie/a noogie/a noogie/noogies2).
Tributes: 2
Edit |
Remove#677. (Player1) (tries/tries/tries/tries/try1) to get (Player2)-senpai to notice [typeB1].
Tributes: 2
Edit |
Remove#678. Scandalous! (Player1) (finds/finds/finds/finds/find1) (Player2)'s sock drawer.
Tributes: 2
Edit |
Remove#679. (Player1) and (Player2) get into a heated argument. (Player1) (flies/flies/flies/flies/fly1) into (a fit of rage/a fit of rage/a fit of rage/a fit of rage/fits of rage1) and (runs/runs/runs/runs/run1) away.
Tributes: 2
Edit |
Remove#680. (Player1) (decides/decides/decides/decides/decide1) to remain silent for the rest of the Games.
Tributes: 1
Edit |
Remove#681. (Player1) unknowingly (swims/swims/swims/swims/swim1) in the Stream of Silence, permanently rendering [typeB1] mute and emotionless.
Tributes: 1
Edit |
Remove#682. (Player1) (throws/throws/throws/throws/throw1) (Player2) into the Stream of Silence, permanently rendering [typeB2] mute and emotionless.
Tributes: 2
Edit |
Remove#683. (Player1) (sings/sings/sings/sings/sing1) a song about [typeC1] (race/race/race/race/race2) to (Player2).
Tributes: 2
Edit |
Remove#684. (Player1) nearly (gets/gets/gets/gets/get1) (a heart attack/a heart attack/a heart attack/a heart attack/heart attacks1) when [typeA1] (discovers/discovers/discover/discovers/discover1) that [typeC1] favorite site is down for maintenance.
Tributes: 1
Edit |
Remove#685. (Player1) (presents/presents/presents/presents/present1) [typeC1] thesis to (Player2), (Player3), and (Player4). They are impressed.
Tributes: 4
Edit |
Remove#686. (Player1) (presents/presents/presents/presents/present1) [typeC1] thesis to (Player2), (Player3), and (Player4). They are not impressed.
Tributes: 4
Edit |
Remove#687. (Player1) (cleans/cleans/cleans/cleans/clean1) [typeC1] weapons.
Tributes: 1
Edit |
Remove#688. (Player1) (cleans/cleans/cleans/cleans/clean1) (Player2)'s camp.
Tributes: 2
Edit |
Remove#689. (Player1) (catches/catches/catches/catches/catch1) (Player2) swearing and (washes/washes/washes/washes/wash1) [typeC2] (mouth/mouth/mouth/mouth/mouths2) with soap.
Tributes: 2
Edit |
Remove#690. (Player1) immediately (takes/takes/takes/takes/take1) (a bath/a bath/a bath/a bath/separate baths1) after being hugged by (Player2).
Tributes: 2
Edit |
Remove#691. (Player1) (gives/gives/gives/gives/give1) (Player2) (a bath/a bath/a bath/a bath/separate baths2).
Tributes: 2
Edit |
Remove#692. (Player1) (takes/takes/takes/takes/take1) a trip to the real world for the day.
Tributes: 1
Edit |
Remove#693. (Player1) (opens/opens/opens/opens/open1) [typeC1] (autobiography/autobiography/autobiography/autobiography/autobiographies1), and (starts/starts/starts/starts/start1) reading it to (Player2).
Tributes: 2
Edit |
Remove#694. According to President Snow, (Player1) shall now vomit at acceptable levels.
Tributes: 1
Edit |
Remove#695. After (Player1) (gets/gets/gets/gets/get1) trapped inside a McDonald's PlayPlace, (Player2) (comes/comes/comes/comes/come2) to rescue [typeB1].
Tributes: 2
Edit |
Remove#696. (Player1) accidentally (brainwashes/brainwashes/brainwashes/brainwashes/brainwash1) (Player2) into becoming (a gambling addict/a gambling addict/a gambling addict/a gambling addict/gambling addicts2).
Tributes: 2
Edit |
Remove#697. (Player1) and (Player2), while working as doctors, gamble on the (life/life/life/life/lives3) of their (patient/patient/patient/patient/patients3), (Player3). They win money after (Player3) (lives/lives/lives/lives/live3) by the way.
Tributes: 3
Edit |
Remove#698. (Player1) (wants/wants/wants/wants/want1) to spread despair to the world via memes.
Tributes: 1
Edit |
Remove#699. (Player1) (has/has/has/has/have1) something to ask of (Player2).
Tributes: 2
Edit |
Remove#700. (Player1) (investigates/investigates/investigates/investigates/investigate1) a conspiracy involving a milkman.
Tributes: 1
Edit |
Remove#701. Nobody suspects that (Player1) (is/is/is/is/are1) being controlled by (Player2), despite [typeB1] acting extremely out of character.
Tributes: 2
Edit |
Remove#702. (Player1) (dresses/dresses/dresses/dresses/dress1) up as (Santa Claus/Santa Claus/Santa Claus/Santa Claus/Santa Clauses1). (Player2) (remarks/remarks/remarks/remarks/remark2) that it's not the right time to wear such costumes.
Tributes: 2
Edit |
Remove#703. (Player1) (dresses/dresses/dresses/dresses/dress1) up as (the Easter Bunny/the Easter Bunny/the Easter Bunny/the Easter Bunny/Easter Bunnies1). (Player2) (remarks/remarks/remarks/remarks/remark2) that it's not the right time to wear such costumes.
Tributes: 2
Edit |
Remove#704. (Player1) (dresses/dresses/dresses/dresses/dress1) up for Halloween. (Player2) (remarks/remarks/remarks/remarks/remark2) that it's not the right time to wear Halloween costumes.
Tributes: 2
Edit |
Remove#705. After a cat eats the mouse (Player1), (Player1) (adopts/adopts/adopts/adopts/adopt1) the cat as [typeC1] new pet.
Tributes: 1
Edit |
Remove#706. (Player1) (pokes/pokes/pokes/pokes/poke1) an antique at a museum.
Tributes: 1
Edit |
Remove#707. It's Friday! It's Friday! (Player1) (is/is/is/is/are1) getting down on Friday!
Tributes: 1
Edit |
Remove#708. (Player1) (asks/asks/asks/asks/asks1) (Player2) if the latter has ever ignored a perfectly normal outfit.
Tributes: 2
Edit |
Remove#709. (Player1) (goes/goes/goes/goes/go1) on a boat ride that is all about (Player2).
Tributes: 2
Edit |
Remove#710. (Player1) (ends/ends/ends/ends/end1) up seeing a double rainbow, and (becomes/becomes/becomes/becomes/become1) very happy because of that.
Tributes: 1
Edit |
Remove#711. (Player1) (loses/loses/loses/loses/lose1) [typeC1] shins by a machine-gun operated by (Player2).
Tributes: 2
Edit |
Remove#712. After losing [typeC1] shins, (Player1) gets [typeC1] feet sewn to [typeC1] knees so [typeA1] can walk again.
Tributes: 1
Edit |
Remove#713. A bear attacks (Player1) and rips parts of [typeC1] survival guid(e/e/e/e/es1) as [typeA1] tr(ies/ies/y/ies/y1) to read it, but then the bear returns it. [TypeA1] says, "Go to your room. Why can't you be more like your brother?" The bear gets away as it is revealed that the e in "play dead" got ripped off, making "play dad."
Tributes: 1
Edit |
Remove#714. (Player1) (is/is/is/is/are1) where [typeA1] always (is/is/are/is/are1): in a frightening, liminal space between states of being. Not quite dead, not quite alive. It's similar to a constant state of sleep-paralysis.
Tributes: 1
Edit |
Remove#715. (Player1) think(s/s/s/s/1) [typeA1]’(s/s/re/s/re1) being haunted by the ghost of the tribute who died first the previous season.
Tributes: 1
Edit |
Remove#716. (Player1) (spikes/spikes/spikes/spikes/spike1) (Player2)'s (drinks/drinks/drinks/drinks/drinks2) with love potion. (Player2) (drinks/drinks/drinks/drinks/drinks2) (it/it/it/it/them2) and (falls/falls/falls/falls/fall2) in love with (Player3).
Tributes: 3
Edit |
Remove#717. (Player1) (spikes/spikes/spikes/spikes/spike1) (Player2)'s (drinks/drinks/drinks/drinks/drinks2) with love potion. (Player2) (drinks/drinks/drinks/drinks/drinks2) (it/it/it/it/them2) and (falls/falls/falls/falls/fall2) in love with [typeB1].
Tributes: 2
Edit |
Remove#718. (Player1) (spikes/spikes/spikes/spikes/spike1) both (Player2)'s and (Player3)'s drinks with love potion.
Tributes: 3
Edit |
Remove#719. (Player1) (spikes/spikes/spikes/spikes/spike1) (Player2)'s (drinks/drinks/drinks/drinks/drinks2) with love potion, but (mistakes/mistakes/mistakes/mistakes/mistake1) (it/it/it/it/them2) for [typeC1] own and (falls/falls/falls/falls/fall2) in love with [typeB2].
Tributes: 2
Edit |
Remove#720. (Player1) (gets/gets/gets/gets/get1) (a spoiler/a spoiler/a spoiler/a spoiler/spoilers1) from (Player2)'s (source material/source material/source material/source material/source materials2) written on [typeC1] (arm/arm/arm/arm/arms1) and (wonders/wonders/wonders/wonders/wonder1) if [typeC1] (soulmate/soulmate/soulmate/soulmate/soulmates1) would say (it/it/it/it/them2) to [typeB1].
Tributes: 2
Edit |
Remove#721. (Player1) (gets/gets/gets/gets/get1) the Hanahaki Disease, and (coughs/coughs/coughs/coughs/cough1) up petals upon seeing [typeC1] (soulmate/soulmate/soulmate/soulmate/soulmates2) (Player2).
Tributes: 2
Edit |
Remove#722. (Player1) (gets/gets/gets/gets/get1) the Hanahaki Disease, and (coughs/coughs/coughs/coughs/cough1) up petals upon seeing [typeC1] (soulmate/soulmate/soulmate/soulmate/soulmates2) (Player2). (Player2) (cures/cures/cures/cures/cure2) it by returning [typeC1] feelings.
Tributes: 2
Edit |
Remove#723. (Player1) (teaches/teaches/teaches/teaches/teach1) (Player2) how to fly.
Tributes: 2
Edit |
Remove#724. (Player1) (takes/takes/takes/takes/take1) advantage of (Player2)'s kindness by taking over [typeC2] camp.
Tributes: 2
Edit |
Remove#725. (Player1) and (Player2) make an oath as (Player3) (casts/casts/casts/casts/cast3) the Unbreakable Vow on them.
Tributes: 3
Edit |
Remove#726. (Player1) (forces/forces/forces/forces/force1) (Player2) to eat [typeC2] veggies. (Player2) (ends/ends/ends/ends/end2) up liking them.
Tributes: 2
Edit |
Remove#727. (Player1) (forces/forces/forces/forces/force1) (Player2) to eat [typeC2] veggies. (Player2) (doesn't/doesn't/doesn't/doesn't/don't2) like them, but (eats/eats/eats/eats/eat2) them anyway.
Tributes: 2
Edit |
Remove#728. (Player1) (force-feeds/force-feeds/force-feeds/force-feeds/force-feed1) (Player2) veggies. (Player2) (ends/ends/ends/ends/end2) up liking them.
Tributes: 2
Edit |
Remove#729. (Player1) (force-feeds/force-feeds/force-feeds/force-feeds/force-feed1) (Player2) veggies. (Player2) (doesn't/doesn't/doesn't/doesn't/don't2) like them and promptly (pukes/pukes/pukes/pukes/puke2).
Tributes: 2
Edit |
Remove#730. While (Player1) (is/is/is/is/are1) driving, (Player2) (warns/warns/warns/warns/warn2) [typeB1] not to hit the cars. (Player1) (crashes/crashes/crashes/crashes/crash1) into one and (sends/sends/sends/sends/send1) it flying, so (Player2) (encourages/encourages/encourages/encourages/encourage2) [typeB1] to hit them all.
Tributes: 2
Edit |
Remove#731. While (Player1) (is/is/is/is/are1) driving, (Player2) (warns/warns/warns/warns/warn2) [typeB1] not to hit the cars. (Player1) (crashes/crashes/crashes/crashes/crash1) into one but the airbags inflate, cushioning [typeB1] and (Player2).
Tributes: 2
Edit |
Remove#732. (Player1) and (Player2) star as (Player3) and (Player4), respectively in a play, and (Player3) "(kills/kills/kills/kills/kill3)" (Player4). (Player5) (asks/asks/asks/asks/ask5) if (Player4) just died, but (Player6) (says/says/says/says/say6) it wasn't really clear.
Tributes: 6
Edit |
Remove#733. (Player1) beat(s/s/s/s/1) [typeD1] up for failing to save the tribute(s) that died in the previous fatal event.
Tributes: 1
Edit |
Remove#734. (Player1) attempt(s/s/s/s/1) to save the tribute(s) that would die in the next fatal event, but ultimately fails.
Tributes: 1
Edit |
Remove#735. (Player1) (is/is/is/is/are1) waking up to ash and dust, [typeA1] wipe(s/s//s/1) [typeC1] brow and sweat(s/s//s/1) [typeC1] rust, [typeA1]'(s/s/re/s/re1) breathing in the chemicals.
Tributes: 1
Edit |
Remove#736. (Player1) cut(s/s/s/s/1) off [typeC1] hair, and use(s/s/s/s/1) it to knit some nice clothes for (Player2).
Tributes: 2
Edit |
Remove#737. After (Player1) (finishes/finishes/finishes/finishes/finish1) [typeC1] performance in a talent show, (Player2) (says/says/says/says/say2) before the judges's decision by (Player3), (Player4), and (Player5), "Seriously, guys, vote the right way 'cause some maniac's (who('s/'s/'s/'s/'re6) (Player6)) gonna fucking kill (me/me/me/me/us2)."
Tributes: 6
Edit |
Remove#738. (Player1) (reminds/reminds/reminds/reminds/remind1) [typeD1] to fart in 5000000 hours. (Player2) (says/says/says/says/say2) that 570 years from now, (Player1) shall release the ripest, deadliest ass gas to ever disgrace the Arena.
Tributes: 2
Edit |
Remove#739. (Player1) interrogate(s/s/s/s/1) (Player2) by waterboarding [typeB2], whacking [typeB2] using (a/a/a/a/1) wrenc(h/h/h/h/hes1), shocking [typeB2] with electricity, and forcefully extracting (a/a/a/a/some2) (tooth/tooth/tooth/tooth/teeth2). (Player2) pass(es/es/es/es/2) out from the torture, but (Player1) inject(s/s/s/s/1) [typeB2] with epinephrine to revive [typeB2].
Tributes: 2
Edit |
Remove#740. After suffering from an accident where [typeA1] shattered every bone in the lower half of [typeC1] (body/body/body/body/bodies1) and almost got put into the Iron Butt (machine/machine/machine/machine/machines1) to replace [typeC1] real (butt/butt/butt/butt/butts1) in the hospital, (Player1) (becomes/becomes/becomes/becomes/become1) afraid to go outside.
Tributes: 1
Edit |
Remove#741. (Player1) reveal(s/s/s/s/1) that (Player2)'s movie company is making a movie about (Player3) and (Player4) without them. When (Player3) and (Player4) say that the company can't be making a movie about them without their presence, (Player1) say(s/s/s/s/1), "But they are, and they are using... actors", with a realistic closeup of (Player1)'s (mouth/mouth/mouth/mouth/mouths1) for the audience while saying "actors". (Player3) and (Player4) gasp in horror at the news.
Tributes: 4
Edit |
Remove#742. (Player1) (wears/wears/wears/wears/wear1) (a shirt/a shirt/a shirt/a shirt/shirts1) that (says/says/says/says/say1) in the back: "Please don't talk to (me/me/me/it/us1), (I've/I've/I've/It has/We've1) no self-control and will talk to you for 2 hours and get no work done. (Player2) (looks/looks/looks/looks/look2) at [typeC1] shirt, confused.
Tributes: 2
Edit |
Remove#743. (Player1) (is/is/is/is/are1) anguished after losing [typeC1] (torta/torta/torta/torta/tortas1) thanks to a monster.
Tributes: 1
Edit |
Remove#744. (Player1) become(s/s/s/s/1) extremely (handsome/beautiful/good-looking/good-looking/good-looking1) after slipping and slamming [typeD1] on a door.
Tributes: 1
Edit |
Remove#745. (Player1) tr(ies/ies/ies/ies/y1) to teach (Player2), (Player3), and (Player4) how to ride a camel based on what [typeA1] saw in a movie, but fail(s/s/s/s/1).
Tributes: 4
Edit |
Remove#746. (Player1) get(s/s/s/s/1) a pet alligator.
Tributes: 1
Edit |
Remove#747. (Player1) lick(s/s/s/s/1) the fac(e/e/e/e/es2) of a sweating (Player2), then declare(s/s/s/s/1), "This is the taste of (a/a/a/a/2) lia(r/r/r/r/rs2), (Player2)!"
Tributes: 2
Edit |
Remove#748. (Player1) lick(s/s/s/s/1) (Player2) to determine whether [typeA2]('s/'s/'re'/'s/'re2) lying or not, but it turns out (Player1) (is/is/is/is/are1) licking (an/an/an/an/2) ice cream po(p/p/p/p/ps2) shaped like (Player2)'s hea(d/d/d/d/ds2).
Tributes: 2
Edit |
Remove#749. (Player1) venture(s/s/s/s/1) into an underwater temple, only to get attacked by its guardians. (Player1) defeat(s/s/s/s/1) them all.
Tributes: 1
Edit |
Remove#750. (Player1) venture(s/s/s/s/1) into a junge temple, only to step on a tripwire. (Player1) manage(s/s/s/s/1) to dodge an arrow that's fired from a hidden trap.
Tributes: 1
Edit |
Remove#751. (Player1) find(s/s/s/s/1) a village, where [typeA1] trade(s/s//s/1) with the villagers using emeralds for supplies.
Tributes: 1
Edit |
Remove#752. (Player1) find(s/s/s/s/1) a village, where [typeA1] attack(s/s//s/1) a villager, causing an iron golem to drive [typeB1] out of the village.
Tributes: 1
Edit |
Remove#753. (Player1) play(s/s/s/s/1) a game of Civilization with (Player2), (Player3), (Player4), (Player5), and (Player6).
Tributes: 6
Edit |
Remove#754. (Player1) find(s/s/s/s/1) a machine that can relive memories of [typeC1] ancesto(r/r/r/r/rs1) by inserting [typeC1] own genes, before playing the memories.
Tributes: 1
Edit |
Remove#755. (Player1) purchase(s/s/s/s/1) (a/a/a/a/1) Volkswage(n/n/n/n/ns1), only to get (a/a/a/a/1) literal Folk's Wago(n/n/n/n/ns1).
Tributes: 1
Edit |
Remove#756. (Player1) discover(s/s/s/s/1) a cursed fanart of [typeD1], so [typeA1] drink(s/s//s/1) brain bleach.
Tributes: 1
Edit |
Remove#757. (Player1) chase(s/s/s/s/1) (Player2), (Player3), and (Player4) while riding (a/a/a/a/1) moose. They use a magic wand to transform (Player1) and the moose into several different animals.
Tributes: 4
Edit |
Remove#758. Upon seeing (Player1) singing karaoke, (Player2) start(s/s/s/s/1) shooting the karaoke machine to destroy it.
Tributes: 2
Edit |
Remove#759. (Player1) ran off........and now.... (Player1)
Tributes: 1
Edit |
Remove#760. (Player1) turn(s/s/s/s/1) invisible, sneak(s/s/s/s/1) into (Player2)'s camp and eat(s/s/s/s/1) [typeC2] apples. (Player2) freaks out upon seeing (a/a/a/a/1) floating appl(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#761. After (Player1) (dies/dies/dies/dies/die1), the ghost of a dead tribute goes back in time to prevent [typeC1] deat(h/h/h/h/hs1) by interacting with objects, saving [typeB1].
Tributes: 1
Edit |
Remove#762. The risk (Player1) took was calculated, but man, (is/is/are/is/are1) [typeA1] bad at math.
Tributes: 1
Edit |
Remove#763. (Player1), (Player2) and (Player3) make a gag dub of (Player4)'s source material.
Tributes: 4
Edit |
Remove#764. But the truth is, (Player1) (is/is/is/is/are1) gonna end (Player2). [TypeB2]. All.
Tributes: 2
Edit |
Remove#765. (Player1)'s attac(k/k/k/k/ks1) (is/is/is/is/are1) so intense that [typeA1] (is/is/are/is/are1) also called Death.
Tributes: 1
Edit |
Remove#766. C'mon, it's time we stop this. (Player1) (is/is/is/is/are1) hungry, tired, and sleepy. Unnngh… Please! Let [typeB1] leave!
Tributes: 1
Edit |
Remove#767. (Player1) feel(s/s/s/s/1) far from good.
Tributes: 1
Edit |
Remove#768. (Player1) get(s/s/s/s/1) prosecuted to the full extent of the jam.
Tributes: 1
Edit |
Remove#769. (Player1) dress(es/es/es/es/1) up as (Player2), (Player2) dress(es/es/es/es/2) up as (Player3), and (Player3) dress(es/es/es/es/3) up as (Player1).
Tributes: 3
Edit |
Remove#770. (Player1) builds 4 copies of [typeD1] to combine into a more powerful form, but this quickly breaks apart since an important part is missing.
Tributes: 1
Edit |
Remove#771. (Player1) make(s/s/s/s/1) (a/a/a/a/1) bulletproof ves(t/t/t/t/ts1) out of Game Boys.
Tributes: 1
Edit |
Remove#772. (Player1) make(s/s/s/s/1) (a/a/a/a/1) bulletproof ves(t/t/t/t/ts1) out of Nokia 3310 phones.
Tributes: 1
Edit |
Remove#773. (Player1) get(s/s/s/s/1) unbanned from Free Ham Sandwich Day.
Tributes: 1
Edit |
Remove#774. (Player1) get(s/s/s/s/1) banned from Free Ham Sandwich Day.
Tributes: 1
Edit |
Remove#775. As (Player1) approach(es/es/es/es/1) (Player2) from behind, (Player2) turn(s/s/s/s/2) around, yelling 'What don't stare (me/me/me/me/us2) always!' before pushing (Player1) away.
Tributes: 2
Edit |
Remove#776. (Player1) learn(s/s/s/s/1) a new language through neural network.
Tributes: 1
Edit |
Remove#777. (Player1) give(s/s/s/s/1) (Player2) (a/a/a/a/1) bouque(t/t/t/t/ts2) of wilted flowers.
Tributes: 2
Edit |
Remove#778. (Player1), (Player2), (Player3) and (Player4) all line up to beat the shit out of (Player5), who only ha(s/s/s/s/ve5) a stic(k/k/k/k/k each5) to defend [typeD5] with.
Tributes: 5
Edit |
Remove#779. (Player1) fl(ies/ies/ies/ies/y1) towards (a/a/a/a/the2) terrified (Player2), saying "What? You don't know (me/me/me/me/us1)? Then it's about time."
Tributes: 2
Edit |
Remove#780. (Player1) come(s/s/s/s/1) across (Player2) dressed like [typeB1], and stare(s/s/s/s/1) at [typeB2] in confusion.
Tributes: 2
Edit |
Remove#781. (Player1) somehow kidnaps [typeD1].
Tributes: 1
Edit |
Remove#782. (Player1) take(s/s/s/s/1) a selfie after beating up (Player2), (Player3), (Player4) and (Player5).
Tributes: 5
Edit |
Remove#783. After being shown (a/a/a/a/1) figurin(e/e/e/e/es1) of [typeD1], (Player1) paints an exaggeratedly beautiful version of [typeD1].
Tributes: 1
Edit |
Remove#784. After being shown (a/a/a/a/1) figurin(e/e/e/e/es1) of (Player1), (Player2) paint(s/s/s/s/1) a quick scribble of [typeB1].
Tributes: 2
Edit |
Remove#785. While fighting (Player1), (Player2) tell(s/s/s/s/1) [typeB1] "You are a sacrifice article that I cut up rough now".
Tributes: 2
Edit |
Remove#786. (Player1) ha(s/s/s/s/ve1) fallen into the river in the Arena.
Tributes: 1
Edit |
Remove#787. (Player1) get(s/s/s/s/1) a premonition of the winner of the game.
Tributes: 1
Edit |
Remove#788. "(Player1)?" "Yes (Player2)?" "(I/I/I/I/We2) want to kill you."
Tributes: 2
Edit |
Remove#789. (Player1) chokehold(s/s/s/s/1) (Player2) as a train comes toward them. After (Player1) say(s/s/s/s/1) goodbye, (Player2) affirm(s/s/s/s/2) [typeC2] name, break(s/s/s/s/2) free of [typeC1] grip, and backflip(s/s/s/s/2) out of the tunnel as the train smashes (Player1) to bits. But (Player1) come(s/s/s/s/1) out of the train, completely unharmed.
Tributes: 2
Edit |
Remove#790. (Player1)'s (Player1) shir(t/t/t/t/ts1) (is/is/is/is/are1) just as bad as (Player1) [typeD1].
Tributes: 1
Edit |
Remove#791. (Player1) ha(s/s/s/s/ve1) (Player2)'s swor(d/d/d/d/ds2). And (Player3)'s bo(w/w/w/w/ws3). And (Player4)'s ax(e/e/e/e/es4).
Tributes: 4
Edit |
Remove#792. (Player1) bap(s/s/s/s/1) (Player2) with a pool noodle.
Tributes: 2
Edit |
Remove#793. To (Player1), (Player2) (is/is/is/is/are2) (a/a/a/a/2) loud, slow, and soft bir(d/d/d/d/ds2). (Player1) do(es/es/es/es/1)n't like to think about birds.
Tributes: 2
Edit |
Remove#794. Sometimes (Player1) give(s/s/s/s/1) [typeD1] the creeps.
Tributes: 1
Edit |
Remove#795. While driving through the city of Qrrbrbirlbel, (Player1) (is/is/is/is/are1) about to crash. (Player2) suggest(s/s/s/s/2) that [typeA1] steer, but (Player1) (is/is/is/is/are1) baaad at thaaaat. (Player2) steers away from the foot of a cliff at the last moment.
Tributes: 2
Edit |
Remove#796. (Player1) and (Player2) are playing together when the Big Wooden Hammer falls on (Player1), then (Player2). After inspecting them, however, (Player3) says "Not that bad."
Tributes: 3
Edit |
Remove#797. (Player1) (is/is/is/is/are1) covered in dinge. (Player2) tr(ies/ies/ies/ies/y2) desperately to clean [typeB1], but [typeA1] rub(s/s//s/1) [typeD1] on (Player2), freaking [typeB2] out.
Tributes: 2
Edit |
Remove#798. (Player1) got some groceries, some peanut butter, to last a couple of days.
Tributes: 1
Edit |
Remove#799. (Player1) translate(s/s/s/s/1) the next event into [typeC1] source material's language.
Tributes: 1
Edit |
Remove#800. Friends call [typeB1] (Player1). Whatever [typeA1] may touch, turns to snow in [typeC1] clutch. [TypeA1]'(s/s/re/s/re1) too much.
Tributes: 1
Edit |
Remove#801. Friends call [typeB1] (Player1). Whatever [typeA1] may touch, melts away in [typeC1] clutch. [TypeA1]'(s/s/re/s/re1) too much.
Tributes: 1
Edit |
Remove#802. Unwrapping a gift from an unknown sponsor, (Player1) find(s/s/s/s/1)... a pair of socks.
Tributes: 1
Edit |
Remove#803. Unwrapping a gift from an unknown sponsor, (Player1) find(s/s/s/s/1)... playing cards.
Tributes: 1
Edit |
Remove#804. Unwrapping a gift from an unknown sponsor, (Player1) find(s/s/s/s/1)... a crossbow!
Tributes: 1
Edit |
Remove#805. Unwrapping a gift from an unknown sponsor, (Player1) find(s/s/s/s/1)... shapeshifting Coca-Cola!
Tributes: 1
Edit |
Remove#806. Unwrapping a gift from an unknown sponsor, (Player1) find(s/s/s/s/1)... a T-bone steak!
Tributes: 1
Edit |
Remove#807. (Player1) (has/has/has/has/have1) a hard time addressing (Player2) by [typeC2] (name/name/name/name/names2) as AU versions of (Player2) that share the exact same (name/name/name/name/names2) as (Player2) stand around (Player1) and the prime universe (counterpart/counterpart/counterpart/counterpart/counterparts2) of (Player2).
Tributes: 2
Edit |
Remove#808. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on President Snow, and (turns/turns/turns/turns/turn1) him into a baby again.
Tributes: 1
Edit |
Remove#809. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on President Snow, and (turns/turns/turns/turns/turn1) him into a kid again.
Tributes: 1
Edit |
Remove#810. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on President Snow, and (turns/turns/turns/turns/turn1) him into a teen again.
Tributes: 1
Edit |
Remove#811. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on President Snow, and (turns/turns/turns/turns/turn1) him into a young adult again.
Tributes: 1
Edit |
Remove#812. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on Katniss, and (turns/turns/turns/turns/turn1) her into a baby again.
Tributes: 1
Edit |
Remove#813. (Player1) (uses/uses/uses/uses/use1) a de-aging potion on Katniss, and (turns/turns/turns/turns/turn1) her into a young kid again.
Tributes: 1
Edit |
Remove#814. (Player1) (uses/uses/uses/uses/use1) an aging potion on Katniss, and (turns/turns/turns/turns/turn1) her into a old lady.
Tributes: 1
Edit |
Remove#815. "Just scooby-doo this crap," (Player1) (says/says/says/says/say1) to (Player2) in regards to a messy situation they got into.
Tributes: 2
Edit |
Remove#816. "Just (Player1) this crap," (Player2) (says/says/says/says/say2) to (Player3) in regards to a messy situation they got into.
Tributes: 3
Edit |
Remove#817. (Player1) (uses/uses/uses/uses/use1) geometry to defeat the magic-wielding (Player2) in a battle.
Tributes: 2
Edit |
Remove#818. (Player1) survive(s/s/s/s/1) a battle against an alien made out of black goo.
Tributes: 1
Edit |
Remove#819. (Player1) (dodges/dodges/dodges/dodges/dodge1) a ton of arrows that (Player2), (Player3), (Player4), (Player5), and (Player6) end up firing.
Tributes: 6
Edit |
Remove#820. "(Player1) (sucks/sucks/sucks/sucks/suck1) at life," (Player2) (says/says/says/says/say2) to (Player3).
Tributes: 3
Edit |
Remove#821. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) all sing the Wellerman Sea Shanty together.
Tributes: 6
Edit |
Remove#822. "(I/I/I/I/We1) missed the part where that's (my/my/my/my/our1) problem," (Player1) (says/says/says/says/say2) to (Player2) after the latter tells the former about a problem [typeA2] (is/is/are/is/are2) having.
Tributes: 2
Edit |
Remove#823. (Player1) (gets/gets/gets/gets/get1) trapped inside a video game, and (ends/ends/ends/ends/end1) up killing a superboss there before going back to the arena.
Tributes: 1
Edit |
Remove#824. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) all play a game of Mad Libs together.
Tributes: 6
Edit |
Remove#825. (Player1) (wishes/wishes/wishes/wishes/wish1) [typeA1] could fight aliens after hearing stories from (Player2) and (Player3) about them fighting aliens.
Tributes: 3
Edit |
Remove#826. (Player1) (manages/manages/manages/manages/manage1) to kill President Snow, only to find out that it doesn't add up a kill count when he isn't a tribute.
Tributes: 1
Edit |
Remove#827. (Player1) nominate(s/s/s/s/1) [typeC1] nominator as a tribute.
Tributes: 1
Edit |
Remove#828. As it starts raining, (Player1) use(s/s/s/s/1) [typeC1] trusty frying pa(n/n/n/n/ns1) as (a/a/a/a/1) drying pa(n/n/n/n/ns1).
Tributes: 1
Edit |
Remove#829. (Player1) forcefeed(s/s/s/s/1) (Player2) [typeC2] least favorite food.
Tributes: 2
Edit |
Remove#830. (Player1) scream(s/s/s/s/1) for help. (Player2), (Player3) and (Player4) suddenly burst in, turn on music, and dance to cheer (Player1) on.
Tributes: 4
Edit |
Remove#831. (Player1) make(s/s/s/s/1) a mashup of [typeC1] own and (Player2)'s theme songs.
Tributes: 2
Edit |
Remove#832. (Player1) make(s/s/s/s/1) a mashup of (Player2)'s and (Player3)'s theme songs.
Tributes: 3
Edit |
Remove#833. (Player1) and (Player2) send each other the same picture at the same time.
Tributes: 2
Edit |
Remove#834. (Player1) wear(s/s/s/s/1) (a tank top/a tank top/a tank top/a tank top/tank tops1) with a picture of [typeC1] own (face/face/face/face/faces1). (Player2) laugh(s/s/s/s/1) and calls [typeB1] painful.
Tributes: 2
Edit |
Remove#835. After getting insulted by (Player1), (Player2) retort(s/s/s/s/1) "And you... YOU'RE A LOSER!"
Tributes: 2
Edit |
Remove#836. (Player1) release(s/s/s/s/1) a genie from a magic lamp and (is/is/is/is/are1) given three wishes, but can't wish for more wishes. [TypeA1] wish(es/es//es/1) for more genies.
Tributes: 1
Edit |
Remove#837. (Player1) release(s/s/s/s/1) a genie from a magic lamp and (is/is/is/is/are1) given three wishes, but can't wish for more wishes. [TypeA1] wish(es/es//es/1) they could.
Tributes: 1
Edit |
Remove#838. (Player1) write(s/s/s/s/1) down [typeC1] dream in [typeC1] dream journal, only to wake up again from that dream having forgotten it.
Tributes: 1
Edit |
Remove#839. (Player1) order(s/s/s/s/1) boneless pizza.
Tributes: 1
Edit |
Remove#840. (Player1) make(s/s/s/s/1) a Youtube Poop out of (Player2)'s source material.
Tributes: 2
Edit |
Remove#841. As (Player1) and (Player2) fight, (Player3) (throws/throws/throws/throws/throw3) (Player1) some leeks which [typeA1] (uses/uses/use/uses/use1) to beat up (Player2).
Tributes: 3
Edit |
Remove#842. As (Player1) and (Player2) fight, (Player3) throws (Player1) a bottle of hot sauce which [typeA1] pour(s/s//s/1) in (Player2)'s eyes.
Tributes: 3
Edit |
Remove#843. (Player1) (walks/walks/walks/walks/walk1) up to (Player2) to fight [typeB2], but patiently wait(s/s/s/s/1) for (Player2) to finish [typeC2] phone cal(l/l/l/l/ls2) first.
Tributes: 2
Edit |
Remove#844. (Player1) sing(s/s/s/s/1) a song to heal [typeD1], (Player2), (Player3) and (Player4).
Tributes: 4
Edit |
Remove#845. (Player1) and (Player2) shoot rockets at (Player3), but (Player3) just glare(s/s/s/s/1) at the rockets, making them fly out of [typeC3] way and miss.
Tributes: 3
Edit |
Remove#846. (Player1) advise(s/s/s/s/1) (Player2) not to punch the judge during a trial.
Tributes: 2
Edit |
Remove#847. (Player1) scan(s/s/s/s/1) a QR code to learn a new attack.
Tributes: 1
Edit |
Remove#848. (Player1) tr(ies/ies/ies/ies/y1) eating something, but can't because [typeC1] health is full.
Tributes: 1
Edit |
Remove#849. (Player1) send(s/s/s/s/1) (Player2) an envelope filled with glitter as a prank.
Tributes: 2
Edit |
Remove#850. (Player1) lose(s/s/s/s/1) [typeC1] voic(e/e/e/e/es1) after singing too much karaoke.
Tributes: 1
Edit |
Remove#851. (Player1) step(s/s/s/s/1) on (a Lego/a Lego/a Lego/a Lego/Legos1).
Tributes: 1
Edit |
Remove#852. (Player1), (Player2) and (Player3) run out of money, causing the broadcasted scene to show the voice actors/creators of (Player1), (Player2), (Player3) and (Player4) behind the fourth wall instead of the event itself. The voice actors/creators then have to work to get money, eventually restoring the original broadcast once they have enough cash.
Tributes: 4
Edit |
Remove#853. After (Player1) betray(s/s/s/s/1) (Player2), (Player2) go(es/es/es/es/2) to kill [typeB1], but (Player1) feel(s/s/s/s/1) regret for the betrayal. (Player2) decide(s/s/s/s/2) to spare [typeB1].
Tributes: 2
Edit |
Remove#854. (Player1) force(s/s/s/s/1) President Coin to kill President Snow.
Tributes: 1
Edit |
Remove#855. (Player1) reminisce(s/s/s/s/1) about [typeC1] homeworld's history while listening to "Little Dark Age" by MGMT.
Tributes: 1
Edit |
Remove#856. (Player1) have the brains of the strong physique, intelligence, and the docile's mind.
Tributes: 1
Edit |
Remove#857. (Player1) imagine(s/s/s/s/1) drawing (a/a/a/a/1) sta(r/r/r/r/rs1) and focus(es/es/es/es/1) on (it/it/it/it/them1), which temporarily grant(s/s/s/s/1) [typeB1] super speed.
Tributes: 1
Edit |
Remove#858. (Player1) destroy(s/s/s/s/1) (Player2)'s option for mercy before fighting (Player2).
Tributes: 2
Edit |
Remove#859. (Player1) absorb(s/s/s/s/1) the souls of all previous tributes ever nominated to become (a/a/a/a/1) godly bein(g/g/g/g/gs1).
Tributes: 1
Edit |
Remove#860. (Player1) get(s/s/s/s/1) items that are meant to solve the problems [typeA1] currently face(s/s//s/1).
Tributes: 1
Edit |
Remove#861. (Player1) intentionally answer(s/s/s/s/1) a question incorrectly during a quiz, causing many red beans to be fired at [typeB1], which [typeA1] eat(s/s//s/1) entirely.
Tributes: 1
Edit |
Remove#862. (Player1) mentally regress(es/es/es/es/1) into (a/a/a/a/1) bab(y/y/y/y/ies1) after accidentally banging [typeC1] hea(d/d/d/d/ds1) on a mailbox, but return(s/s/s/s/1) back to normal after [typeC1] head swelling subside(s/s/s/s/1).
Tributes: 1
Edit |
Remove#863. (Player1) transform(s/s/s/s/1) into (a/a/a/a/1) sapient snai(l/l/l/l/ls1) after (Player2) accidentally inject(s/s/s/s/2) [typeB1] with (a/a/a/a/1) snail seru(m/m/m/m/ms1).
Tributes: 2
Edit |
Remove#864. (Player1)'s camp gets launched by a burst water pipe and lands on top of an erupting volcano, plugging it in the process.
Tributes: 1
Edit |
Remove#865. (Player1), (Player2), and (Player3) pump (Player4)'s bell(y/y/y/y/ies4) with air while [typeA4]('s/'s/'re/'s/'re4) asleep, causing (Player4) to think [typeA4]('s/'s/'re/'s/'re4) pregnant.
Tributes: 4
Edit |
Remove#866. (Player1) go(es/es/es/es/1) insane after seeing many (Player2)s everywhere. The (Player2)s turn out to be (Player2)'s fans, who are all cosplaying as [typeB2].
Tributes: 2
Edit |
Remove#867. (Player1) call(s/s/s/s/1) (Player2) "(Player2) [(Player2)'s source material]".
Tributes: 2
Edit |
Remove#868. (Player1) use(s/s/s/s/1) rotten cheese as a fertilizer, which makes a plant instantly grow.
Tributes: 1
Edit |
Remove#869. (Player1) (builds/builds/builds/builds/build1) (a snowman/a snow-woman/a snowperson/a snowman/snowmen1) of [typeD1].
Tributes: 1
Edit |
Remove#870. (Player1) and (Player2) build a snowman together.
Tributes: 2
Edit |
Remove#871. (Player1) (asks/asks/asks/asks/ask1) (Player2) if [typeA2] (wants/wants/wants/wants/want2) to build a snowman. (Player2) (says/says/says/says/say2) yes.
Tributes: 2
Edit |
Remove#872. (Player1) (asks/asks/asks/asks/ask1) (Player2) if [typeA2] (wants/wants/wants/wants/want2) to build a snowman. (Player2) (says/says/says/says/say2), "Go away, (Player1)," who (replies/replies/replies/replies/reply1), "Okay, bye."
Tributes: 2
Edit |
Remove#873. (Player1), (Player2), (Player3), and (Player4) have a sled race.
Tributes: 4
Edit |
Remove#874. (Player1) and (Player2) go sledding together.
Tributes: 2
Edit |
Remove#875. (Player1) (tries/tries/tries/tries/try1) to call [typeC1] family back home, only to realize that the area [typeA1] (is/is/are/is/are1) in has no reception.
Tributes: 1
Edit |
Remove#876. (Player1) (forces/forces/forces/forces/force1) (Player2) to wear the (Cone of Shame/Cone of Shame/Cone of Shame/Cone of Shame/Cones of Shame2).
Tributes: 2
Edit |
Remove#877. (Player1), (Player2), (Player3), and (Player4) join a game show, with (Player5) as the host. (Player1) (wins/wins/wins/wins/win1).
Tributes: 5
Edit |
Remove#878. (Player1) (draws/draws/draws/draws/draw1) (Player2) like one of [typeC1] French girls.
Tributes: 2
Edit |
Remove#879. (Player1) (starts/starts/starts/starts/start1) a lemonade stand. (Player2), (Player3), and (Player4) buy [typeC1] drinks.
Tributes: 4
Edit |
Remove#880. (Player1) (goes/goes/goes/goes/go1) to (Player2)'s, (Player3)'s, and (Player4)'s camps to sell some Scout Cookies.
Tributes: 4
Edit |
Remove#881. (Player1) (goes/goes/goes/goes/go1) skiing.
Tributes: 1
Edit |
Remove#882. (Player1), (Player2), (Player3), and (Player4) kick out (Player5) from their group for being different from them.
Tributes: 5
Edit |
Remove#883. Upon seeing the body/ies of the latest tribute(s) to die, (Player1) (declares/declares/declares/declares/declare1) that they are dead while (Player2), (Player3), (Player4) and (Player5) laugh with [typeB1].
Tributes: 5
Edit |
Remove#884. (Player1) (makes/makes/makes/makes/make1) random noises near (Player2), who (responds/responds/responds/responds/respond2), "Stop it (Player1), you are doing (me/me/me/me/us2) a frighten."
Tributes: 2
Edit |
Remove#885. (Player1) (mails/mails/mails/mails/mail1) (Player2) a letter bomb. (Player2) (doesn't/doesn't/doesn't/doesn't/don't2) fall for it.
Tributes: 2
Edit |
Remove#886. (Player1) (tries/tries/tries/tries/try1) killing a cockroach. [TypeA1] (succeeds/succeeds/succeed/succeeds/succeed1).
Tributes: 1
Edit |
Remove#887. (Player1) (tries/tries/tries/tries/try1) killing a cockroach. [TypeA1] (fails/fails/fail/fails/fail1).
Tributes: 1
Edit |
Remove#888. (Player1) (forces/forces/forces/forces/force1) (Player2) to eat (a cockroach/a cockroach/a cockroach/a cockroach/cockroaches2). (Player2) (admits/admits/admits/admits/admit2) that (it/it/it/it/they2) tasted like chicken.
Tributes: 2
Edit |
Remove#889. (Player1) (forces/forces/forces/forces/force1) (Player2) to eat (a cockroach/a cockroach/a cockroach/a cockroach/cockroaches2). (Player2) promptly (pukes/pukes/pukes/pukes/puke2).
Tributes: 2
Edit |
Remove#890. (Player1), (Player2), and (Player3) each feed their pet fuzzy monster once. The monster only needed to be fed once in its lifetime, so it ends up devouring everything but the other tributes. It then grows so big it explodes into enough fuzzy monsters for everyone.
Tributes: 3
Edit |
Remove#891. (Player1) (falls/falls/falls/falls/fall1) into a deep hole. (Player2) (fills/fills/fills/fills/fill2) it with water, (Player3) (gives/gives/gives/gives/give3) (Player1) (a breathing straw/a breathing straw/a breathing straw/a breathing straw/breathing straws1), and (Player4) temporarily (freezes/freezes/freezes/freezes/freeze4) [typeB1] to float [typeB1] out.
Tributes: 4
Edit |
Remove#892. (Player1)’(s/s/s/s/ve1) got a peer-reviewed study right here that says . . . hm . . . says (Player2)’(s/s/s/s/re2) (a /a /a /a /2)puss(y/y/y/y/ies2).
Tributes: 2
Edit |
Remove#893. (Player1) and (Player2) say something at the same time. (Player1) jinx(es/es/es/es/1) (Player2).
Tributes: 2
Edit |
Remove#894. (Player1) and (Player2) say something at the same time. (Player2) jinx(es/es/es/es/2) (Player1).
Tributes: 2
Edit |
Remove#895. (Player1) receive(s/s/s/s/1) a soap bar from a known sponsor, Dr. Squatch.
Tributes: 1
Edit |
Remove#896. (Player1) receive(s/s/s/s/1) shaving cream from a known sponsor, Harry's.
Tributes: 1
Edit |
Remove#897. (Player1) receive(s/s/s/s/1) data encryption from a known sponsor, NordVPN.
Tributes: 1
Edit |
Remove#898. (Player1) call(s/s/s/s/1) (Player2) (a /a /a /a /2)stickle(r/r/r/r/rs2). (Player2) say(s/s/s/s/1), “YOU'RE (a /a /a /a /1)sticke(r/r/r/r/rs1), (Player1)!”
Tributes: 2
Edit |
Remove#899. Opening a gift from an unknown sponsor... (Player1) receive(s/s/s/s/1)... Chicory x Eggnog plushies!
Tributes: 1
Edit |
Remove#900. Opening a gift from an unknown sponsor... (Player1) receive(s/s/s/s/1)... a survival guide!
Tributes: 1
Edit |
Remove#901. (Player1) wear(s/s/s/s/1) (a /a /a /a /1)T-shir(t/t/t/t/ts1) that say(s/s/s/s/1), "(Player2) ha(s/s/s/s/ve2) forgotten how to dance." (Player2), enraged, dip(s/s/s/s/2) (Player1)'s fac(e/e/e/e/es1) in mud.
Tributes: 2
Edit |
Remove#902. (Player1) get(s/s/s/s/1) put through the (Player1) Plinko.
Tributes: 1
Edit |
Remove#903. (Player1) spike(s/s/s/s/1) (Player2)'s drink with love potion, causing [typeB2] to fall in love with (Player3). (Player3) reject(s/s/s/s/3) (Player2)'s advances.
Tributes: 3
Edit |
Remove#904. (Player1) spike(s/s/s/s/1) (Player2)'s drink with love potion, causing [typeB2] to fall in love with (Player3). (Player3) fall(s/s/s/s/3) in love with [typeB2] just the same.
Tributes: 3
Edit |
Remove#905. (Player1) spike(s/s/s/s/1) (Player2)'s drink with dove potion, causing [typeB2] to start pecking (Player3) uncontrollably.
Tributes: 3
Edit |
Remove#906. (Player1) make(s/s/s/s/1) a giant mud volcano and place(s/s/s/s/1) it under (Player2)'s base camp.
Tributes: 2
Edit |
Remove#907. (Player1) get(s/s/s/s/1) a visit from [typeC1] nominator's highest-ranking tribute.
Tributes: 1
Edit |
Remove#908. (Player1) ponder(s/s/s/s/1) the airspeed velocity of the unladen swallow.
Tributes: 1
Edit |
Remove#909. Hmm, yes, the (Player1) here is made out of (Player1).
Tributes: 1
Edit |
Remove#910. (Player1) use(s/s/s/s/1) an experimental teleporter and get(s/s/s/s/1) violently ill.
Tributes: 1
Edit |
Remove#911. Expecting a funny event? TOO BAD, (Player1) TIME!
Tributes: 1
Edit |
Remove#912. (Player1) fin(ds/ds/ds/ds/d1) a console labeled "Pay2Lose". [TypeA1] inser(ts/ts/t/ts/t1) five of [typeC1] currency and cran(ks/ks/k/ks/k1) up the other tributes' health by several hundred percent.
Tributes: 1
Edit |
Remove#913. (Player1) se(es/es/es/es/e1) a social media post telling [typeB1] to "reblog if you too are gay and/or don't go to bed on time". [TypeA1] reblo(gs/gs/g/gs/g1) it.
Tributes: 1
Edit |
Remove#914. (Player1) se(es/es/es/es/e1) a social media post telling [typeB1] to "reblog if you too are gay or don't go to bed on time". [TypeA1] scrol(ls/ls/l/ls/l1) past it.
Tributes: 1
Edit |
Remove#915. "WE HAVE TO EAT NOW!" (Player1) (yells/yells/yells/yells/yell1) out loud in front of (Player2) and (Player3).
Tributes: 3
Edit |
Remove#916. "Comedy is subjective, (Player1)," (Player2) (says/says/says/says/say2) to [typeB1] after (Player2) (states/states/states/states/state2) a joke that (Player1) (didn't/didn't/didn't/didn't/don't1) find very funny.
Tributes: 2
Edit |
Remove#917. President Snow gets subjected to so many de-aging potions that it got (Player1) confused.
Tributes: 1
Edit |
Remove#918. (Player1) (mistakes/mistakes/mistakes/mistakes/mistake1) a group from the source material of (Player2) as a band.
Tributes: 2
Edit |
Remove#919. (Player1) (uses/uses/uses/uses/use1) an aging potion on Katniss, and (ages/ages/ages/ages/age1) her up until she dies of old age.
Tributes: 1
Edit |
Remove#920. (Player1) (puts/puts/puts/puts/put1) (on an/on an/on an/on an/on1) emo (outfit/outfit/outfit/outfit/outfit1), and (dances/dances/dances/dance/dance1) around the streets of New York.
Tributes: 1
Edit |
Remove#921. (Player1) (visits/visits/visits/visits/visit1) a land called New Year's Eveland all by [typeD1].
Tributes: 1
Edit |
Remove#922. (Player1), (Player2), and (Player3) all visit a land called New Year's Eveland.
Tributes: 3
Edit |
Remove#923. (Player1) (uses/uses/uses/uses/use1) an aging potion on President Snow, and (ages/ages/ages/ages/age1) him up until he dies of old age.
Tributes: 1
Edit |
Remove#924. (Player1) (sings/sings/sings/sings/sing1) "Kiss The Girl" while hoping [typeB1] can hook (Player2) up (with a/with a/with a/with a/with2) random (female/female/female/female/females2) visiting the arena.
Tributes: 2
Edit |
Remove#925. (Player1) (wants/wants/wants/wants/want1) (Player2) here today as President Snow's problems.
Tributes: 2
Edit |
Remove#926. (Player1) (goes/goes/goes/goes/go1) ice skating.
Tributes: 1
Edit |
Remove#927. (Player1) and (Player2) go ice skating together.
Tributes: 2
Edit |
Remove#928. (Player1) (gets/gets/gets/gets/get1) horrifying flashbacks of [typeC1] previous Hunger Games outings.
Tributes: 1
Edit |
Remove#929. (Player1) and (Player2) lie down and feel like garbage.
Tributes: 2
Edit |
Remove#930. (Player1) and (Player2) do a Boke and Tsukkomi routine, with (Player3), (Player4), (Player5), and (Player6) as the audience.
Tributes: 6
Edit |
Remove#931. (Player1) (ruins/ruins/ruins/ruins/ruin1) (Player2)'s dream (journal/journal/journal/journal/journals2).
Tributes: 2
Edit |
Remove#932. (Player1) (accuses/accuses/accuses/accuses/accuse1) (Player2) of ruining [typeC1] dream (journal/journal/journal/journal/journals2). (Player1) (wins/wins/wins/wins/win1) the case.
Tributes: 2
Edit |
Remove#933. (Player1) (boasts/boasts/boasts/boasts/boast1) that [typeA1] (knows/knows/know/knows/know1) everything while everyone else knows nothing.
Tributes: 1
Edit |
Remove#934. (Player1) (writes/writes/writes/writes/write1) in [typeC1] dream (journal/journal/journal/journal/journals1).
Tributes: 1
Edit |
Remove#935. (Player1) (finds/finds/finds/finds/find1) the gravestone(s) of the last fallen tribute(s) with "REST IN PEPPERONI" engraved on it.
Tributes: 1
Edit |
Remove#936. (Player1) (tells/tells/tells/tells/tell1) (Player2) to pull the lever to their secret underground lab.
Tributes: 2
Edit |
Remove#937. (Player1) (cremates/cremates/cremates/cremates/cremate1) the body/ies of the last fallen tribute(s) and (carries/carries/carries/carries/carry1) the ashes with [typeB1].
Tributes: 1
Edit |
Remove#938. (Player1) (reminds/reminds/reminds/reminds/remind1) (Player2) that [typeA2] still (hasn't/hasn't/haven't/hasn't/haven't2) turned in [typeC2] homework.
Tributes: 2
Edit |
Remove#939. (Player1) (turns/turns/turns/turns/turn1) up the volume of (Player2)'s headphones to the max.
Tributes: 2
Edit |
Remove#940. (Player1) (transforms/transforms/transforms/transforms/transform1) into (Player2)'s worst (fear/fear/fear/fear/fears2) and (scares/scares/scares/scares/scare1) [typeB2] off.
Tributes: 2
Edit |
Remove#941. (Player1) (sings/sings/sings/sings/sing1) Aloha O'e to (Player2).
Tributes: 2
Edit |
Remove#942. Ok, so basically, (Player1)'(s/s/re/s/re1) very smol.
Tributes: 1
Edit |
Remove#943. No talk (Player1), [typeA1]'(s/s/re/s/re1) angy.
Tributes: 1
Edit |
Remove#944. (Player1) interrogat(es/es/es/es/e1) (Player2). [TypeA1] cannot find evidence of wrongdoing. (Player2) see(ms/ms/ms/ms/m2) innocent.
Tributes: 2
Edit |
Remove#945. (Player1) interrogat(es/es/es/es/e1) (Player2). [TypeA2] (is/is/are/is/are2) suspicious!
Tributes: 2
Edit |
Remove#946. A plague has consumed the Arena summoning (Player1), Horse(man/woman/person/being/beings1) of the Apocalypse!
Tributes: 1
Edit |
Remove#947. (Player1) ha(s/s/s/s/ve1) remembered that [typeA1] (was/was/were/was/were1) like the last fallen tribute(s).
Tributes: 1
Edit |
Remove#948. (Player1) ha(s/s/s/s/ve1) revealed [typeD1] as the Mayo(r/r/r/r/rs1)!
Tributes: 1
Edit |
Remove#949. A vision (Player1) had revealed that (Player2), (Player3), or (Player4) is evil!
Tributes: 4
Edit |
Remove#950. A vision (Player1) had revealed that (Player2) or (Player3) is good!
Tributes: 3
Edit |
Remove#951. (Player1) shoot(s/s/s/s/1) down a balloon carrying a present and get(s/s/s/s/1) a piece of furniture.
Tributes: 1
Edit |
Remove#952. (Player1) ha(s/s/s/s/ve1) a dance-off against (Player2), (Player3) and (Player4) during a serious meeting.
Tributes: 4
Edit |
Remove#953. After (Player1) tell(s/s/s/s/1) (Player2) that (Player3) and (Player4) have escaped, (Player2) tell(s/s/s/s/2) [typeB1] "(I/I/I/I/We2) should really feeds you all dog"
Tributes: 4
Edit |
Remove#954. (Player1) (is/is/is/is/are1) in despair! These games have left [typeB1] in despair!
Tributes: 1
Edit |
Remove#955. (Player1) lose(s/s/s/s/1) a game against (Player2), (Player3) and (Player4). [TypeA1] blame(s/s//s/1) the controlle(r/r/r/r/rs1).
Tributes: 4
Edit |
Remove#956. (Player1) lose(s/s/s/s/1) a game against (Player2), (Player3) and (Player4). [TypeA1] blame(s/s//s/1) lag.
Tributes: 4
Edit |
Remove#957. (Player1) lose(s/s/s/s/1) a game against (Player2), (Player3) and (Player4). [TypeA1] blame(s/s//s/1) the controlle(r/r/r/r/rs1), but (Player2) remind(s/s/s/s/2) [typeB1] it's a board game.
Tributes: 4
Edit |
Remove#958. While fighting (Player1) on a playground, (Player2) kick(s/s/s/s/2) (Player1) onto a swing, then kick(s/s/s/s/2) [typeB1] off, gets on the swing and kick(s/s/s/s/2) (Player1) far away.
Tributes: 2
Edit |
Remove#959. During (Player1)'s funeral, (Player1) knock(s/s/s/s/1) on the inside of [typeC1] coffi(n/n/n/n/ns1) and announce(s/s/s/s/1) that [typeA1]'(s/s/re/s/re1) not dead yet.
Tributes: 1
Edit |
Remove#960. (Player1) show(s/s/s/s/1) up drunk to [typeC1] fight with (Player2).
Tributes: 2
Edit |
Remove#961. (Player1) and (Player2) have a slap fight.
Tributes: 2
Edit |
Remove#962. (Player1) throw(s/s/s/s/1) plastic cups at (Player2), (Player3) and (Player4) as they ride by on bikes.
Tributes: 4
Edit |
Remove#963. (Player1) ride(s/s/s/s/1) around on a giant spider, making it eat candy to power up.
Tributes: 1
Edit |
Remove#964. (Player1) hide(s/s/s/s/1) behind a wall of giant candy blocks to avoid (Player2)'s flaming arrows.
Tributes: 2
Edit |
Remove#965. (Player1) stab(s/s/s/s/1) (Player2) with a bottle, then grab(s/s/s/s/1) the bottle to lift [typeB2] up and slam [typeB2] into the ground.
Tributes: 2
Edit |
Remove#966. (Player1) throw(s/s/s/s/1) a small statue at (Player2). It breaks, and small metal blades fall out and cut [typeC2] body.
Tributes: 2
Edit |
Remove#967. As (Player1) escape(s/s/s/s/1) by helicopter, (Player2) imagine(s/s/s/s/2) floating heads of (Player1) spinning and laughing.
Tributes: 2
Edit |
Remove#968. (Player1) skip(s/s/s/s/1) around like (a /a /a /a /1)jackas(s/s/s/s/ses1), annoying (Player2).
Tributes: 2
Edit |
Remove#969. (Player1) get(s/s/s/s/1) out (a /a /a /a /1)bucke(t/t/t/t/ts1) of ice and throw(s/s/s/s/1) the ice at (Player2), (Player3) and (Player4).
Tributes: 4
Edit |
Remove#970. (Player1) summon(s/s/s/s/1) a bunch of attack drones towards (Player2), (Player3), (Player4) and (Player5).
Tributes: 5
Edit |
Remove#971. (Player1) spin(s/s/s/s/1) (a /a /a /a /1)ladde(r/r/r/r/rs1) around before climbing halfways up (it/it/it/it/them1), jumping up in the air while holding the ladde(r/r/r/r/rs1) and landing on (Player2).
Tributes: 2
Edit |
Remove#972. (Player1) throw(s/s/s/s/1) darts up in the air, hitting (Player2), (Player3) and (Player4).
Tributes: 4
Edit |
Remove#973. (Player1) start(s/s/s/s/1) selling burgers from a food truck. When (Player2) buy(s/s/s/s/2) one and ask(s/s/s/s/2) what kind of meat this is, (Player1) freeze(s/s/s/s/1) up.
Tributes: 2
Edit |
Remove#974. (Player1) lie(s/s/s/s/1) on the ground with the words "IT'S OVER" above [typeB1], but [typeA1] manage(s/s/s/s/1) to get up again while "NOT" appears between the words.
Tributes: 1
Edit |
Remove#975. (Player1) and (Player2) have a T-posing competition. (Player1) wins.
Tributes: 2
Edit |
Remove#976. (Player1) find(s/s/s/s/1) a bootleg toy of [typeD2] combined with (Player2).
Tributes: 2
Edit |
Remove#977. (Player1) use(s/s/s/s/1) the GoldenEye satellite to fry (Player2)'s computer databases.
Tributes: 2
Edit |
Remove#978. (Player1) grab(s/s/s/s/1) a mike and say(s/s/s/s/1) "Let's green egg and ham it" before [typeA1] begin(s/s//s/1) rapping.
Tributes: 1
Edit |
Remove#979. (Player1) say(s/s/s/s/1) that (Player2) (is/is/is/is/are2) gonna pay for shooting down [typeC1] ride.
Tributes: 2
Edit |
Remove#980. (Player1) randomly shout(s/s/s/s/1) to (Player2) "I was frozen today!"
Tributes: 2
Edit |
Remove#981. (Player1) offer(s/s/s/s/1) to weight train (Player2) saying "(I'll/I'll/I'll/I'll/We'll1) make you so strong, you can bench-press a horse."
Tributes: 2
Edit |
Remove#982. (Player1) plan(s/s/s/s/1) to make a vegetable garden and grow beans, potatoes, tomatoes, fish, shrimp, bread, butter, and pizza.
Tributes: 1
Edit |
Remove#983. (Player1) notice(s/s/s/s/1) (Player2) and say(s/s/s/s/1), “Oh my god! (Player2)? From Friday Night Funkin’?”
Tributes: 2
Edit |
Remove#984. (Player1) say(s/s/s/s/1) to (Player2) and (Player3), “How can you defeat somebody you can't RECOGNIZE?” while swapping clothes with (Player4). (Player2) say(s/s/s/s/1), “Oh no! Which one do (I/I/I/I/we2) shoot?” [TypeA2] shoo(ts/ts/t/ts/t2) (Player4), leading (Player3) to say, “You idio(t/t/t/t/ts2), you shot the wrong tribut(e/e/e/e/es4).”
Tributes: 4
Edit |
Remove#985. (Player1) launch(es/es/es/es/1) a snipe shot at the announcer. Wait, fuck, that's me—
Tributes: 1
Edit |
Remove#986. (Player1) stay(s/s/s/s/1) at the cornucopia for reasons.
Tributes: 1
Edit |
Remove#987. (Player1) greet(s/s/s/s/1) (Player2), who respond(s/s/s/s/2) with a brief monologue about the imperfect world and how to make it as beautiful as [typeB2]. (Player1) wonder(s/s/s/s/1) if anyone else is listening to this.
Tributes: 2
Edit |
Remove#988. "De do do do, de da da da." That's all (Player1) want(s/s/s/s/1) to say to (Player2).
Tributes: 2
Edit |
Remove#989. (Player1) and (Player2) bury the hatchet between each other.
Tributes: 2
Edit |
Remove#990. (Player1) draw(s/s/s/s/1) [typeC1] blad(e/e/e/e/es1) at (Player2), making a metallic grinding sound. (Player2) draw(s/s/s/s/2) (his/hers/theirs/its/theirs2), but (it/it/it/it/they2) make a "THOOOOOORD" sound instead.
Tributes: 2
Edit |
Remove#991. (Player1) listen(s/s/s/s/1) to Beethoven's 5th.
Tributes: 1
Edit |
Remove#992. Yes, it was (Player1)! [TypeC1] machinations lay undetected for years, for [typeA1] (is/is/are/is/are1) a master of deceptio
Tributes: 1
Edit |
Remove#993. God! (Player1) w(as/as/as/as/ere1) angry, but now [typeA1]'(s/s/re/s/re1) just depressed!
Tributes: 1
Edit |
Remove#994. (Player1) wish(es/es/es/es/1) [typeA1] were fish, so (Player2) transform(s/s/s/s/2) [typeB1] into (on/on/on/on/som1)e.
Tributes: 2
Edit |
Remove#995. After (Player1) cut(s/s/s/s/1) two arms and a le(g/g/g/g/g each2) off of (Player2), (Player2) keep(s/s/s/s/2) on going and ram(s/s/s/s/2) [typeD2] into (Player1).
Tributes: 2
Edit |
Remove#996. (Player1) played guitar, jamming good with (Player2) and (Player3), and the Spiders from Mars.
Tributes: 3
Edit |
Remove#997. (Player1) get(s/s/s/s/1) in a fight with (Player2), and they both knock each other out at the same time.
Tributes: 2
Edit |
Remove#998. (Player1) win(s/s/s/s/1) a fight with (Player2) by impaling [typeC2] chin on a tiny church steeple. (Player2) survive(s/s/s/s/2) and ask(s/s/s/s/2) for ice cream.
Tributes: 2
Edit |
Remove#999. (Player1) see(s/s/s/s/1) "(Player1) (ī/ī/ī/ī/īte1) domum" written one hundred times on a wall. (Player2), admiring [typeC2] work, run(s/s/s/s/2) away upon seeing (Player1).
Tributes: 2
Edit |
Remove#1000. (Player1) (saves/saves/saves/saves/save1) (Player2) from choking by performing the Heimlich maneuver.
Tributes: 2
Edit |
Remove#1001. (Player1) (spends/spends/spends/spends/spend1) the day solving a newspaper puzzle.
Tributes: 1
Edit |
Remove#1002. (Player1) (reveals/reveals/reveals/reveals/reveal1) to (Player2) that the former (is/is/is/is/are1) (a robot/a robot/a robot/a robot/robots1).
Tributes: 2
Edit |
Remove#1003. (Player1) (screams/screams/screams/screams/scream1) loudly, causing (Player2) to scream loudly as well. They end up screaming at each other.
Tributes: 2
Edit |
Remove#1004. (Player1) (shoots/shoots/shoots/shoots/shoot1) (Player2) in the (butt/butt/butt/butt/butts2) with (a tranquilizer dart/a tranquilizer dart/a tranquilizer dart/a tranquilizer dart/tranquilizer darts1), knocking [typeB2] unconscious.
Tributes: 2
Edit |
Remove#1005. (Player1) (tells/tells/tells/tells/tell1) (Player2), (Player3), (Player4), and (Player5) to do the flop!
Tributes: 5
Edit |
Remove#1006. (Player1) (tells/tells/tells/tells/tell1) (Player2) that there's something on [typeC2] (face/face/face/face/faces2), then (punches/punches/punches/punches/punch1) [typeB2]. IT WAS PAIN!
Tributes: 2
Edit |
Remove#1007. (Player1) (serenades/serenades/serenades/serenades/serenade1) (Player2).
Tributes: 2
Edit |
Remove#1008. (Player1) (asks/asks/asks/asks/ask1) (Player2) out on the date. (Player2) (says/says/says/says/say2) yes.
Tributes: 2
Edit |
Remove#1009. (Player1) (asks/asks/asks/asks/ask1) (Player2) out on the date. (Player2) (says/says/says/says/say2) no and (friendzones/friendzones/friendzones/friendzones/friendzone2) [typeB1].
Tributes: 2
Edit |
Remove#1010. (Player1) (changes/changes/changes/changes/change1) the plumbing of (Player2)'s (shower/shower/shower/shower/showers2) to redirect the sewage line to (it/it/it/it/them2).
Tributes: 2
Edit |
Remove#1011. (Player1) (dumps/dumps/dumps/dumps/dump1) garbage from the top of the waterfall where (Player2) (is/is/is/is/are2) showering.
Tributes: 2
Edit |
Remove#1012. (Player1) (gets/gets/gets/gets/get1) the hiccups.
Tributes: 1
Edit |
Remove#1013. (Player1) (gets/gets/gets/gets/get1) the hiccups. [TypeA1] (cures/cures/cure/cures/cure1) it by holding [typeC1] (nose/nose/nose/nose/noses1) while drinking water.
Tributes: 1
Edit |
Remove#1014. (Player1) (tries/tries/tries/tries/try1) the most elaborate way to cure (Player2)'s hiccups. [TypeA1] (succeeds/succeeds/succeed/succeeds/succeed1).
Tributes: 2
Edit |
Remove#1015. (Player1) (tries/tries/tries/tries/try1) the most elaborate way to cure (Player2)'s hiccups. [TypeA1] (fails/fails/fail/fails/fail1).
Tributes: 2
Edit |
Remove#1016. (Player1) (orders/orders/orders/orders/order1) (Player2) to die, but (Player2) (points/points/points/points/point2) (a gun/a gun/a gun/a gun/guns2) at [typeB1] and (says/says/says/says/say2), "Not today."
Tributes: 2
Edit |
Remove#1017. Upon seeing (Player1) freak out, (Player2) (asks/asks/asks/asks/ask2) if [typeA1] (has/has/have/has/have1) gone (Player1)-nanas.
Tributes: 2
Edit |
Remove#1018. (Player1) and (Player2) set up (Player3) and (Player4) for an arranged marriage.
Tributes: 4
Edit |
Remove#1019. (Player1) and (Player2) object to their marriage arranged by (Player3) and (Player4). The wedding is off!
Tributes: 4
Edit |
Remove#1020. (Player1) (chases/chases/chases/chases/chase1) (Player2) out of [typeC1] camp with (a chainsaw/a chainsaw/a chainsaw/a chainsaw/chainsaws1), yelling, "HEY HEY HEY STAY OUTTA (MY/MY/MY/MY/OUR1) CAMP!!!"
Tributes: 2
Edit |
Remove#1021. (Player1) (cries/cries/cries/cries/cry1) out, "It's over now, isn't it? Isn't it over?"
Tributes: 1
Edit |
Remove#1022. (Player1) and (Player2) give (Player3) the "Nasty Patty", or a synchronized tag-team double-cheek punch.
Tributes: 3
Edit |
Remove#1023. (Player1) suddenly remember(s/s/s/s/1) [typeA1] left the stove on.
Tributes: 1
Edit |
Remove#1024. (Player1) stick(s/s/s/s/1) silly stickers on (Player2)'s bac(k/k/k/k/ks2).
Tributes: 2
Edit |
Remove#1025. As (Player1) get(s/s/s/s/1) ready to fight (Player2), (Player3) appear(s/s/s/s/3) next to them, flash step(s/s/s/s/3) behind (Player1) and punch(es/es/es/es/3) [typeB1] high up in the air before fighting (Player2).
Tributes: 3
Edit |
Remove#1026. (Player1) angrily complain(s/s/s/s/1) that taking part in these games is not in [typeC1] contrac(t/t/t/t/ts1).
Tributes: 1
Edit |
Remove#1027. (Player1) wake(s/s/s/s/1) up (Player2) in the middle of (a/a/a/a/their2) drea(m/m/m/m/ms2). (Player2) complain(s/s/s/s/2) that [typeA2] forgot the drea(m/m/m/m/ms2).
Tributes: 2
Edit |
Remove#1028. (Player1) go(es/es/es/es/1) to a restaurant and order(s/s/s/s/1) some food. Upon getting the wrong food, [typeA1] say(s/s/s/s/1) "No! I don't want that!" and quickly slide(s/s/s/s/1) the food away.
Tributes: 1
Edit |
Remove#1029. (Player1) order(s/s/s/s/1) a glass of water. [TypeA1] eats the entire glass.
Tributes: 1
Edit |
Remove#1030. (Player1) order(s/s/s/s/1) a can of soda. [TypeA1] eats the entire can.
Tributes: 1
Edit |
Remove#1031. (Player1) ask(s/s/s/s/1) for some salt. [TypeA1] eats the entire salt shaker.
Tributes: 1
Edit |
Remove#1032. Upon hearing (Player1) say something insulting about (Player2), (Player3) stab(s/s/s/s/1) (Player1)'s han(d/d/d/d/ds1) with (a/a/a/a/1) kni(fe/fe/fe/fe/ves1).
Tributes: 3
Edit |
Remove#1033. After a snack gets stuck in a vending machine, (Player1) break(s/s/s/s/1) the vending machine and grab(s/s/s/s/1) as many snacks as [typeA1] can carry.
Tributes: 1
Edit |
Remove#1034. (Player1) wear(s/s/s/s/1) shoes that make meowing sounds as [typeA1] walks.
Tributes: 1
Edit |
Remove#1035. As (Player1) approach(es/ea/es/es/1), (Player2) yell(s/s/s/s/2) "Oh no! It's (Player1)!" while looking and pointing in a completely different direction.
Tributes: 2
Edit |
Remove#1036. (Player1) T-pose(s/s/s/s/1) while eating strawberry leaves in front of (Player2).
Tributes: 2
Edit |
Remove#1037. (Player1) shoplift(s/s/s/s/1) at (Player2)'s shop by literally lifting the whole shop.
Tributes: 2
Edit |
Remove#1038. (Player1) drop(s/s/s/s/1) (a /a /a /a /2)saf(e/e/e/e/es2) on (Player2), but [typeA2] just opens the saf(e/e/e/e/es2) from the inside and walk(s/s/s/s/2) away.
Tributes: 2
Edit |
Remove#1039. As (Player1) is about to sit down on a chair, (Player2) pull(s/s/s/s/2) the chai(r/r/r/r/rs2) away.
Tributes: 2
Edit |
Remove#1040. After (Player1) break(s/s/s/s/1) (Player2)'s beloved (Player3) figurine, (Player1) and (Player4) bury it as (Player2) return(s/s/s/s/2).
Tributes: 4
Edit |
Remove#1041. (Player1) came here to eat (Player2) and then destroy [typeB1] city.
Tributes: 2
Edit |
Remove#1042. (Player1) overwrite(s/s/s/s/1) (Player2)'s save fil(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#1043. (Player1) play(s/s/s/s/1) Rock Paper Scissors in front of a mirror and somehow lose(s/s/s/s/1).
Tributes: 1
Edit |
Remove#1044. (Player1) write(s/s/s/s/1) a self-insert fic set in (Player2)'s universe.
Tributes: 2
Edit |
Remove#1045. (Player1) (warns/warns/warns/warns/warn1) (Player2) that (Player3) (is/is/is/is/are3) plotting to kill [typeB2], but (Player2) do(es/es/es/es/2)n't believe [typeB1].
Tributes: 3
Edit |
Remove#1046. As (Player1) is about to eat, (Player2) suddenly appears in [typeC1] food and tells [typeB1] a weird fact. (Player1) loses [typeC1] appetite.
Tributes: 2
Edit |
Remove#1047. (Player1) (ruins/ruins/ruins/ruins/ruin1) (Player2)'s nam(e/e/e/e/es2) by changing, adding or removing one letter.
Tributes: 2
Edit |
Remove#1048. (Player1)'(s/s/s/s/re1) the giant ra(t/t/t/t/ts1) that make(s/s/s/s/1) all of the rules.
Tributes: 1
Edit |
Remove#1049. (Player1) and (Player2) make a bet about who can prevent death the longest.
Tributes: 2
Edit |
Remove#1050. On their way to rescue (Player1) from (Player2), (Player3) and (Player4) do flips and spins while gunning down the guards.
Tributes: 4
Edit |
Remove#1051. On their way to rescue (Player1) from President Snow, (Player2) and (Player3) do flips and spins while gunning down the guards.
Tributes: 3
Edit |
Remove#1052. (Player1), (Player2), and (Player3) are trapped in a claw machine. (Player4) throw(s/s/s/s/4) it off a cliff to free them, successfully.
Tributes: 4
Edit |
Remove#1053. (Player1) am a sacrifice articl(e/e/e/e/eses1) that (Player2) cut up rough now.
Tributes: 2
Edit |
Remove#1054. (Player1) give(s/s/s/s/1) (Player2) a promotion, but decide(s/s/s/s/1) instead to fire [typeB2] because Marmite.
Tributes: 2
Edit |
Remove#1055. (Player1) ride(s/s/s/s/1) [typeC1] bik(e/e/e/e/es1) into (Player2) while [typeA2] (is/is/are/is/are2) talking to (Player3), so (Player3) push(es/es/es/es/3) [typeB1] off [typeC1] bik(e/e/e/e/es1).
Tributes: 3
Edit |
Remove#1056. Why didn't (Player1) get (Player2)'s mass text? [TypeA1]'(s/s/re/s/re1) in [typeC2] contacts!
Tributes: 2
Edit |
Remove#1057. (Player1) give(s/s/s/s/1) (Player2) (a/a/a/a/some2) Valentin(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#1058. (Player1) give(s/s/s/s/1) (Player2) (a/a/a/a/some2) bloody Valentin(e/e/e/e/es2).
Tributes: 2
Edit |
Remove#1059. (Player1) small, [typeA1] brawl, but most importantly, [typeA1] love you all.
Tributes: 1
Edit |
Remove#1060. (Player1) tell(s/s/s/s//1) (Player2) that [typeA1]'(s/s/s/s/re1) gnot (a /a /a /a //1)gnel(f/f/f/f/ves1), [typeA1]'(s/s/re/s/re1) gnot (a /a /a /a //1)gnobli(n/n/n/n/ns1)... [typeA1]'(s/s/re/s/re1) (a /a /a /a //1)gnom(e/e/e/e/es1)! And (Player2)'(s/s/s/s/ve2) been... gnomed!
Tributes: 2
Edit |
Remove#1061. (Player1) attac(ks/ks/ks/ks/k1) (Player2), who surviv(es/es/es/es/e2), but los(es/es/es/es/e2) [typeC1] memories.
Tributes: 2
Edit |
Remove#1062. (Player1) asks, "what about the (Player2) attack on (Player3)?" (Player4), (Player5) and (Player6) agree that (Player6) will go back up (Player3).
Tributes: 6
Edit |
Remove#1063. (Player1) (spikes/spikes/spikes/spikes/spike1) (Player2)'s (drinks/drinks/drinks/drinks/drinks2) with hate potion. (Player2) (drinks/drinks/drinks/drinks/drinks2) (it/it/it/it/them2) and destroys [typeB2] bond with (Player3).
Tributes: 3
Edit |
Remove#1064. (Player1) (spikes/spikes/spikes/spikes/spike1) (Player2)'s (drinks/drinks/drinks/drinks/drinks2) with hate potion. (Player2) (drinks/drinks/drinks/drinks/drinks2) (it/it/it/it/them2) and destroys [typeB2] bond with (Player1).
Tributes: 2
Edit |
Remove#1065. (Player1) (tries/tries/tries/tries/try1) shooting (an apple/an apple/an apple/an apple/an apple each2) off (Player2)'s (head/head/head/head/head2) with (a crossbow/a crossbow/a crossbow/a crossbow/crossbows1). [TypeA1] (succeeds/succeeds/succeed/succeeds/succeed1).
Tributes: 2
Edit |
Remove#1066. (Player1) (forces/forces/forces/forces/force1) (Player2) to look directly at the sun, permanently blinding [typeB2].
Tributes: 2
Edit |
Remove#1067. (Player1) (gets/gets/gets/gets/get1) high on magic mushrooms.
Tributes: 1
Edit |
Remove#1068. (Player1) (is/is/is/is/are1) like a box of chocolates. (Player2) never know(s/s/s/s/2) what [typeA2]'(s/s/re/s/re2) gonna get.
Tributes: 2
Edit |
Remove#1069. (Player1) love(s/s/s/s/1) (Player2) so much [typeA1] want(s/s//s/1) to eat [typeB2].
Tributes: 2
Edit |
Remove#1070. (Player1) (makes/makes/makes/makes/make1) a complex shipping chart of (Player2), (Player3), (Player4), (Player5), and (Player6).
Tributes: 6
Edit |
Remove#1071. (Player1) (receives/receives/receives/receives/receive1) homework from an unknown sponsor.
Tributes: 1
Edit |
Remove#1072. (Player1) (goes/goes/goes/goes/go1) jogging around the arena.
Tributes: 1
Edit |
Remove#1073. (Player1) (tells/tells/tells/tells/tell1) (Player2) that [typeA1] (is/is/are/is/are1) going to punch [typeB2] in the face, but (Player2) (reminds/reminds/reminds/reminds/remind2) (him/her1) that it's Opposite Day. (Player1) (ends/ends/ends/ends/end1) up punching [typeD1].
Tributes: 2
Edit |
Remove#1074. (Player1) and (Player2) get into a heated argument on which console is the best.
Tributes: 2
Edit |
Remove#1075. (Player1) (knits/knits/knits/knits/knit1) a sweater for (Player2).
Tributes: 2
Edit |
Remove#1076. (Player1) (knits/knits/knits/knits/knit1) a sweater for (Player2), who promptly (breaks/breaks/breaks/breaks/break2) up with [typeB1] for it.
Tributes: 2
Edit |
Remove#1077. (Player1) (kicks/kicks/kicks/kicks/kick1) (a bucket/a bucket/a bucket/a bucket/buckets1).
Tributes: 1
Edit |
Remove#1078. (Player1), (Player2), (Player3), (Player4), (Player5), and (Player6) play dodgeball. (Player6) wins.
Tributes: 6
Edit |
Remove#1079. Upon seeing a butterfly, (Player1) (asks/asks/asks/asks/ask1), "is this a fallen tribute?"
Tributes: 1
Edit |
Remove#1080. (Player1) (installs/installs/installs/installs/install1) security cameras in [typeC1] camp.
Tributes: 1
Edit |
Remove#1081. (Player1) (destroys/destroys/destroys/destroys/destroy1) the security cameras installed by (Player2) before raiding [typeC2] camp.
Tributes: 2
Edit |
Remove#1082. (Player1) (is/is/is/is/are1) caught on (Player2)'s security cameras as [typeA1] (is/is/are/is/are1) raiding [typeC2] camp and (is/is/is/is/are1) promptly arrested.
Tributes: 2
Edit |
Remove#1083. (Player1) (squees/squees/squees/squees/squee1) as [typeA1] (hugs/hugs/hug/hugs/hug1) (Player2) tight while shaking [typeB2].
Tributes: 2
Edit |
Remove#1084. (Player1) (approaches/approaches/approaches/approaches/approach1) (Player2)'s bullets to power up [typeC1] special (attack/attack/attack/attack/attacks1).
Tributes: 2
Edit |
Remove#1085. (Player1) (remembers/remembers/remembers/remembers/remember1) (Player2)'s advice to clench [typeC1] buttcheeks super tight and scream the word from the bottom of [typeC1] heart!
Tributes: 2
Edit |
Remove#1086. (Player1) block(s/s/s/s/1) an attack from (Player2) and counterattack(s/s/s/s/1) by grabbing [typeB2] and slamming [typeB2] into the ground, calling [typeB2] predictable.
Tributes: 2
Edit |
Remove#1087. (Player1) play(s/s/s/s/1) Rock Paper Scissors in front of a mirror and somehow win(s/s/s/s/1).
Tributes: 1
Edit |
Remove#1088. (Player1) play(s/s/s/s/1) Rock Paper Scissors against (Player2). (Player1) win(s/s/s/s/1).
Tributes: 2
Edit |
Remove#1089. (Player1) play(s/s/s/s/1) Rock Paper Scissors against (Player2). (Player2) win(s/s/s/s/2).
Tributes: 2
Edit |
Remove#1090. (Player1) attempt(s/s/s/s/1) to get (Player2) to buy some drugs, only for [typeB2] to convince [typeB1] [typeA1] do(es/es//es/1)n't want to sell (Player2) drugs, and instead go home and rethink [typeC1] li(fe/fe/fe/fe/ves1).
Tributes: 2
Edit |
Remove#1091. (Player1) drop(s/s/s/s/1) down from above, land(s/s/s/s/1) behind (Player2) and say(s/s/s/s/1), "hello there". (Player2) turn(s/s/s/s/2) around and repl(ies/ies/ies/ies/y2), "(Player1)! You are (a /a /a /a /1)bold on(e/e/e/e/es1)."
Tributes: 2
Edit |
Remove#1092. (Player1) tr(ies/ies/ies/ies/y1) to warn (Player2) that (Player3) (is/is/is/is/are3) evil, only for (Player2) to retort that from [typeC1] point of view, the side (Player1) (is/is/is/is/are1) on is evil instead. In despair, (Player1) shout(s/s/s/s/1), "well then you are lost!"
Tributes: 3
Edit |
Remove#1093. All will fear (Player1)'s giant new weapo(n/n/n/n/ns1).
Tributes: 1
Edit |
Remove#1094. (Player1) regret(s/s/s/s/1) everything.
Tributes: 1
Edit |
Remove#1095. (Player1) decide(s/s/s/s/1) to lie low for today.
Tributes: 1
Edit |
Remove#1096. (Player1) ha(s/s/s/s/ve1) come here to chew bubblegum and kick ass. And [typeA1]'(s/s/re/s/re1) all out of bubblegum.
Tributes: 1
Edit |
Remove#1097. (Player1) pass(es/es/es/es/1) up a perfect chance to kill (Player2) and regret(s/s/s/s/1) it.
Tributes: 2
Edit |
Remove#1098. (Player1) pass(es/es/es/es/1) up a perfect chance to kill (Player2).
Tributes: 2
Edit |
Remove#1099. (Player1) sell(s/s/s/s/1) propane and propane accessories.
Tributes: 1
Edit |
Remove#1100. (Player1) warn(s/s/s/s/1) (Player2), "this Arena ain't big enough for the two of us".
Tributes: 2
Edit |
Remove#1101. (Player1) warn(s/s/s/s/1) (Player2), "you'll be surprised what you can live through".
Tributes: 2
Edit |
Remove#1102. After being blackout drunk for the entire season until now, (Player1) ha(s/s/s/s/ve1) sobered up.
Tributes: 1
Edit |
Remove#1103. After being heavily intoxicated for the entire season until now, (Player1) ha(s/s/s/s/ve1) sobered up.
Tributes: 1
Edit |
Remove#1104. It was in the Arena that (Player1) met (Player2). Without a single word they knew what had to be done.
Tributes: 2
Edit |
Remove#1105. Reality suddenly changes, causing all remaining tributes to look exactly like (Player1) for the rest of the current season.
Tributes: 1
Edit |
Remove#1106. (Player1) get(s/s/s/s/1) 50 Rings to reach the special zone, then get(s/s/s/s/1) all 7 Chaos Emeralds to become Super (Player1).
Tributes: 1
Edit |
Remove#1107. (Player1) get(s/s/s/s/1) 50 Totino's Pizza Rolls to reach the special zone, then get(s/s/s/s/1) all 7 Stuffed Nachos to become Zesty (Player1).
Tributes: 1
Edit |
Remove#1108. Evil (Player1) be like... [something (Player1) wouldn't say].
Tributes: 1
Edit |
Remove#1109. (Player1), Go(d/ddess/d/d/ds1) of Hyperdeath, bring(s/s/s/s/1) (Player2) down to less than 1 HP. But (Player2)’s determination keeps [typeB2] alive.
Tributes: 2
Edit |
Remove#1110. A vote is cast to get the contestants out of the games. (Player1) (is/is/is/is/are1) the deciding vote, and everyone leaves. But they realize the prize is important and re-enter.
Tributes: 1
Edit |
Remove#1111. (Player1) catch(es/es/es/es/1) (Player2) in midair, seemingly proving (Player2)’s point that man is good. But then (Player1) get(s/s/s/s/1) horny for (Player3) and drop(s/s/s/s/1) [typeB2], proving (Player3)’s point that man is evil.
Tributes: 3
Edit |
Remove#1112. (Player1) tell(s/s/s/s/1) (Player2) [typeC2] husbando is Death.
Tributes: 2
Edit |
Remove#1113. (Player1) improvise(s/s/s/s/1) a mediocre theme song for an elimination ceremony. After (Player2) and (Player3) complain about it, [typeA1] respond(s/s//s/1) with an even worse ear-splitter.
Tributes: 3
Edit |
Remove#1114. After (Player1) catch(es/es/es/es/1) (Player2) betraying [typeB1] for (Player3), (Player2) tells [typeB1] to leave [typeC1] stupid comments in [typeC1] pocket.
Tributes: 3
Edit |
Remove#1115. Did you know that if (Player1) put(s/s/s/s/1) (Player2) in an ice cube tray, that [typeA2] will come out the shape of the ice cube tray? Okay, cool!
Tributes: 2
Edit |
Remove#1116. (Player1) get(s/s/s/s/1) stung to death by zombees, but get(s/s/s/s/1) revived by a swarm of Dusty's purrbees.
Tributes: 1
Edit |
Remove#1117. (Player1) and (Player2) blow up Mars to mess with (Player3).
Tributes: 3
Edit |
Remove#1118. (Player1) ha(s/s/s/s/ve1) been hit by the (Player2) Curse.
Tributes: 2
Edit |
Remove#1119. (Player1) should really feeds (Player2) all dog.
Tributes: 2
Edit |
Remove#1120. (Player1) only pawn in game of life.
Tributes: 1
Edit |
Remove#1121. It is [typeA1], the Frenchiest (Player1).
Tributes: 1
Edit |
Remove#1122. (Player1) ensnare(s/s/s/s/1) (Player2) in a suspended net. (Player2) escape(s/s/s/s/2) just in time and flees.
Tributes: 2
Edit |
Remove#1123. (Player1) (is/is/is/is/are1) given heart-shaped biscuits by (Player2). [TypeA1] (spits/spits/spit/spits/spit1) them out after trying them, commenting that they taste like sandpaper.
Tributes: 2
Edit |
Remove#1124. (Player1) chase(s/s/s/s/1) (Player2) until (Player3), (Player4), (Player5) and (Player6) distract and obstruct (Player1), allowing (Player2) to escape.
Tributes: 6
Edit |
Remove#1125. (Player1) bind(s/s/s/s/1) (Player2)'s limbs together and leave(s/s/s/s/1) [typeB2]. (Player3) eventually come(s/s/s/s/3) to help (Player2).
Tributes: 3
Edit |
Remove#1126. (Player1) hang(s/s/s/s/1) up a sign which says "RULES: NO EATING PEOPLE."
Tributes: 1
Edit |
Remove#1127. (Player1) turn(s/s/s/s/1) on the radio as [typeA1] and (Player2) make breakfast.
Tributes: 2
Edit |
Remove#1128. (Player1) sing(s/s/s/s/1) as [typeA1] make(s/s/s/s/1) breakfast for (Player2).
Tributes: 2
Edit |
Remove#1129. (Player1) offer(s/s/s/s/1) ketchup to (Player2), only to crush the bottle, making ketchup splatter all over [typeB2].
Tributes: 2
Edit |
Remove#1130. (Player1) rage(s/s/s/s/1) over being unable to get [typeA1] daily fix of chocolate.
Tributes: 1
Edit |
Remove#1131. (Player1) translate(s/s/s/s/1) (Player2)'s greeting to (Player3), but [typeA3] already know(s/s/s/s/3) what [typeA2] said.
Tributes: 3
Edit |
Remove#1132. (Player1) punch(es/es/es/es/1) a wall repeatedly.
Tributes: 1
Edit |
Remove#1133. (Player1) attempt(s/s/s/s/1) to swallow (Player2) whole, but (Player3) punch(es/es/es/es/1) [typeB2] out of [typeC1] mouth.
Tributes: 3
Edit |
Remove#1134. (Player1) disguise(s/s/s/s/1) [typeD1] as (Player2) to scare (Player3), but the apparent "(Player3)" (is/is/is/is/are2) (Player2) in disguise, and [typeA2] scare(s/s//s/2) [typeB1] instead.
Tributes: 3
Edit |
Remove#1135. (Player1) lament(s/s/s/s/1) [typeC1] nonexistent love li(fe/fe/fe/fe/ves1), saying all [typeA1] ha(s/s/ve/s/ve1) (is/is/is/is/are1) good looks and a mariachi band.
Tributes: 1
Edit |
Remove#1136. (Player1) sing(s/s/s/s/1) a song while being chased by (Player2), (Player3) and (Player4).
Tributes: 4
Edit |
Remove#1137. (Player1) carve(s/s/s/s/1) a statue of [typeD1] and throw(s/s/s/s/1) a drink at it, blowing up the statue.
Tributes: 1
Edit |
Remove#1138. (Player1) rescue(s/s/s/s/1) a baby pumpkin.
Tributes: 1
Edit |
Remove#1139. While playing hockey, (Player1) hit(s/s/s/s/1) the puck, causing it to fly into (Player2)'s (face/face/face/face/faces2).
Tributes: 2
Edit |
Remove#1140. (Player1), (Player2) and (Player3) form a mariachi band.
Tributes: 3
Edit |
Remove#1141. (Player1) investigate(s/s/s/s/1) a case of arson, only to find that [typeA1] (was/was/were/was/were1) the actual cause of it.
Tributes: 1
Edit |
Remove#1142. (Player1) run(s/s/s/s/1) in circles around (Player2), somehow making items nearby gradually grow.
Tributes: 2
Edit |
Remove#1143. (Player1) tr(ie/ies/ies/ies/ies1) summoning a demon, but end(s/s/s/s/1) up summoning a lemon instead.
Tributes: 1
Edit |
Remove#1144. (Player1) and (Player2) fight over playing their respective theme songs over the arena speakers.
Tributes: 2
Edit |
Remove#1145. (Player1) come(s/s/s/s/1) across a large boulder blocking [typeC1] path. [TypeA1] push(es/es//es/1) it away with ease.
Tributes: 1
Edit |
Remove#1146. (Player1) come(s/s/s/s/1) across a large boulder blocking [typeC1] path. [TypeA1] tr(ies/ies/y/ies/y1) pushing it away, but give(s/s/s/s/1) up.
Tributes: 1
Edit |
Remove#1147. (Player1) enter(s/s/s/s/1) a dark cave. [TypeA1] shine(s/s/s/s/1) a light to get through it.
Tributes: 1
Edit |
Remove#1148. (Player1) enter(s/s/s/s/1) a dark cave. [TypeA1] manage(s/s/s/s/1) to get through it with no light.
Tributes: 1
Edit |
Remove#1149. (Player1) enter(s/s/s/s/1) a dark cave. [TypeA1] tr(ies/ies/ies/ies/y1) getting through it with no light, but end(s/s/s/s/1) up getting lost.
Tributes: 1
Edit |
Remove#1150. (Player1) pretend(s/s/s/s/1) to saw (Player2) in half for a magic trick.
Tributes: 2
Edit |
Remove#1151. (Player1) give(s/s/s/s/1) (Player2) a cake that says "Congration you done it".
Tributes: 2
Edit |
Remove#1152. (Player1) tr(ies/ies/ies/ies/y1) living entirely off merchandise from (Player2)'s source material.
Tributes: 2
Edit |
Remove#1153. As (Player1) (is/is/is/is/are1) surrounded by (Player2), (Player3), (Player4) and (Player5), [typeA1] google(s/s//s/1) "how many tributes can 1 take on in a fight"
Tributes: 5
Edit |
Remove#1154. (Player1) break(s/s/s/s/1) through a wall, and it somehow fixes itself, with (Player2) walking through it shortly after.
Tributes: 2
Edit |
Remove#1155. (Player1) do(es/es/es/es/1) the most recent non-fatal event, but in a cooler way.
Tributes: 1
Edit |
Remove#1156. (Player1) send(s/s/s/s/1) a message for (Player2) to meet at [typeC1] garage, but [typeA2] misread(s/s/s/s/2) it and wait(s/s/s/s/2) near the garbage instead.
Tributes: 2
Edit |
Remove#1157. (Player1) decide(s/s/s/s/1) to BE SPICY and lend a hand.
Tributes: 1
Edit |
Remove#1158. (Player1) decide(s/s/s/s/1) to be mild and ignore (Player2).
Tributes: 2
Edit |
Remove#1159. (Player1) tr(ies/ies/ies/ies/y1) sneaking into (Player2)'s camp, but is slowly pushed out by (Player2), who say(s/s/s/s/2) "(I'm/I'm/I'm/I'm/We're) sorry, (I/I/I/I/we2) can't let you know this yet."
Tributes: 2
Edit |
Remove#1160. (Player1) dramatically walk(s/s/s/s/1) in wearing a big and heavy costume, but end(s/s/s/s/1) up falling on [typeC1] fac(e/e/e/e/es1).
Tributes: 1
Edit |
Remove#1161. (Player1) get(s/s/s/s/1) trapped in a cube and send(s/s/s/s/1) a call for help over a video screen. (Player2) goes to save [typeB1].
Tributes: 2
Edit |
Remove#1162. (Player1) and (Player2) have a long, epic pizza cutter fight.
Tributes: 2
Edit |
Remove#1163. (Player1) get(s/s/s/s/1) attacked by seagulls for [typeC1] food.
Tributes: 1
Edit |
Remove#1164. (Player1) eat(s/s/s/s/1) some creepy pasta.
Tributes: 1
Edit |
Remove#1165. (Player1), (Player2), (Player3), and (Player4) form a search party to look for (Player5). They succeed.
Tributes: 5
Edit |
Remove#1166. (Player1), (Player2), (Player3), and (Player4) form a search party to look for (Player5). They fail.
Tributes: 5
Edit |
Remove#1167. (Player1) (goes/goes/goes/goes/go1) surfing.
Tributes: 1
Edit |
Remove#1168. (Player1), (Player2), and (Player3) have a surfing contest, with (Player4), (Player5), and (Player6) as the judges. (Player1) wins.
Tributes: 6
Edit |
Remove#1169. (Player1) (yells/yells/yells/yells/yell1) "FREEZE!" at (Player2) as [typeA1] (zaps/zaps/zap/zaps/zap1) [typeB2] in mid-air with (a stunning beam/a stunning beam/a stunning beam/a stunning beam/stunning beams1).
Tributes: 2
Edit |
Remove#1170. As (Player1) (joins/joins/joins/joins/join1) (Player2) and (Player3)'s team, (Player3) (makes/makes/makes/makes/make3) a slow but grand fanfare that (Player1) (has/has/has/has/have1) joined the party.
Tributes: 3
Edit |
Remove#1171. (Player1) (gets/gets/gets/gets/get1) concerned when (Player2) (flushes/flushes/flushes/flushes/flush2) (the toilet/the toilet/the toilet/the toilet/separate toilets2) (three times/three times/three times/three times/three times each2).
Tributes: 2
Edit |
Remove#1172. (Player1) and (Player2) get into an argument over which one of them is cuter.
Tributes: 2
Edit |
Remove#1173. (Player1) (plans/plans/plans/plans/plan1) to confess [typeC1] love for (Player2), but (decides/decides/decides/decides/decide1) against it.
Tributes: 2
Edit |
Remove#1174. (Player1) (says/says/says/says/say1) that [typeA1] (has/has/have/has/have1) been (Player2)'d.
Tributes: 2
Edit |
Remove#1175. (Player1) and (Player2) infiltrate (Player3) and (Player4)'s hideout to defuse their nuclear bomb. They succeed.
Tributes: 4
Edit |
Remove#1176. (Player1) and (Player2) headbutt each other. (Player1) (knocks/knocks/knocks/knocks/knock1) (Player2) over.
Tributes: 2
Edit |
Remove#1177. (Player1) accidentally drop(s/s/s/s/1) [typeC1] ax(e/e/e/e/es1) in a river. The Water Sprite comes out and gives [typeB1] (a /a /a /a /1)golden ax(e/e/e/e/es1), but [typeA1] reject(s/s//s/1) (it/it/it/it/them1) because (it's/it's/it's/it's/they're1) not (hi/her/their/it/their1)s. The Water Sprite returns [typeC1] ax(e/e/e/e/es1) to [typeB1] and also rewards [typeB1] with the golden ax(e/e/e/e/es1) for [typeC1] honesty.
Tributes: 1
Edit |
Remove